Jump to content

3-Methyl-2-pentanol: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (changes to verified and watched fields) per Chem/Drugbox validation (report errors or bugs)
m top: GHS update: remove empty EUClass/Rphrase/Sphrase parameters (depr), replaced: | RPhrases = | → |, | SPhrases = | → |
 
(10 intermediate revisions by 8 users not shown)
Line 5: Line 5:
| Name = 3-Methyl-2-pentanol
| Name = 3-Methyl-2-pentanol
| ImageFile = 3-methyl-2-pentanol.PNG
| ImageFile = 3-methyl-2-pentanol.PNG
| ImageSize =
| ImageSize =
| ImageName =
| ImageName =
| IUPACName = 3-Methyl-2-pentanol
| PIN = 3-Methylpentan-2-ol
| OtherNames = 3-Methylpentan-2-ol
| OtherNames = 3-Methyl-2-pentanol
| Reference = <ref name="hand">
| Reference = <ref name="hand">
{{Citation
{{Citation
| last = Lide
| last = Lide
| first = David R.
| first = David R.
| author-link =
| last2 =
| first2 =
| author2-link =
| publication-date =
| date =
| year = 1998
| year = 1998
| title = Handbook of Chemistry and Physics
| title = Handbook of Chemistry and Physics
| edition = 87
| edition = 87
| publication-place = Boca Raton, Florida
| volume =
| series =
| publication-place = Boca Raton, FL
| place =
| publisher = CRC Press
| publisher = CRC Press
| id =
| isbn = 0-8493-0594-2
| isbn = 0-8493-0594-2
| doi =
| oclc =
| pages = 3-398, 5-47, 8-106
| pages = 3-398, 5-47, 8-106
| url =
| accessdate =
}}</ref>
}}</ref>
|Section1={{Chembox Identifiers
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10787
| ChemSpiderID = 10787
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 77520
| ChEBI = 77520
| InChI = 1/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3
| InChI = 1/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3
Line 48: Line 34:
| StdInChIKey = ZXNBBWHRUSXUFZ-UHFFFAOYSA-N
| StdInChIKey = ZXNBBWHRUSXUFZ-UHFFFAOYSA-N
| CASNo = 565-60-6
| CASNo = 565-60-6
| CASNo_Ref = {{cascite|changed|??}}=
| CASNo_Ref = {{cascite|correct|PubChem}}
| RTECS =
| RTECS =
| EINECS =
| EINECS =209-281-6
| PubChem =
| PubChem =11261
}}
}}
|Section2={{Chembox Properties
|Section2={{Chembox Properties
Line 60: Line 46:
| Solubility = 19 g/L
| Solubility = 19 g/L
| SolubleOther = soluble in [[ethanol]], [[diethyl ether]]
| SolubleOther = soluble in [[ethanol]], [[diethyl ether]]
| MeltingPt =
| MeltingPt =
| BoilingPtC = 134.3
| BoilingPtC = 134.3
| BoilingPt_notes =
| Boiling_notes =
| VaporPressure =
| VaporPressure =
}}
}}
|Section3={{Chembox Structure
|Section3={{Chembox Structure
| Coordination =
| Coordination =
| CrystalStruct =
| CrystalStruct =
}}
}}
|Section4={{Chembox Thermochemistry
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHf =
| DeltaHc =
| DeltaHc =
| Entropy =
| Entropy =
| HeatCapacity = 275.9 J·mol<sup>-1</sup>·K<sup>-1</sup> (liquid)
| HeatCapacity = 275.9 J·mol<sup>−1</sup>·K<sup>−1</sup> (liquid)
}}
}}
|Section7={{Chembox Hazards
|Section7={{Chembox Hazards
| ExternalMSDS =
| ExternalSDS =
| EUIndex =
| NFPA-H =
| NFPA-H =
| NFPA-F =
| NFPA-F =
| NFPA-R =
| NFPA-R =
| RPhrases =
| FlashPt =
| SPhrases =
| AutoignitionPt =
| FlashPt =
| ExploLimits =
| AutoignitionPt =
| LD50 =
| GHSPictograms = {{GHS02}}{{GHS07}}
| ExploLimits =
| GHSSignalWord = Warning
| LD50 =
| HPhrases = {{H-phrases|226|319}}
| PPhrases = {{P-phrases|210|233|240|241|242|243|264|280|303+361+353|305+351+338|337+313|370+378|403+235|501}}
}}
}}
|Section8={{Chembox Related
|Section8={{Chembox Related
| OtherCpds = [[Hexanol]]
| OtherCompounds = [[Hexanol]]
}}
}}
}}
}}


'''3-Methyl-2-pentanol''' ([[IUPAC]] name) is an [[organic chemistry|organic]] [[chemical compound]]. It has been identified as a component of [[hops]].<ref name="gc">{{Citation
'''3-Methyl-2-pentanol''' ([[IUPAC]] name: 3-methylpentan-2-ol) is an [[organic chemistry|organic]] [[chemical compound]]. It has been identified as a component of [[hops]].<ref name="gc">{{Citation
| last = Jackson
| last = Jackson
| first = John F.
| first = John F.
| author-link =
| last2 = Linskens
| last2 = Linskens
| first2 = Hans F.
| first2 = Hans F.
| author2-link =
| publication-date =
| date =
| year = 2002
| year = 2002
| title = Analysis of taste and aroma
| title = Analysis of taste and aroma
| edition =
| volume =
| series =
| publication-place =
| place =
| publisher = Springer
| publisher = Springer
| id =
| isbn = 978-3-540-41753-8
| isbn = 978-3-540-41753-8
| doi =
| oclc =
| pages = 83
| pages = 83
| url = http://books.google.com/books?id=xKQ2yKfYVRMC&pg=PA83
| url = https://books.google.com/books?id=xKQ2yKfYVRMC&pg=PA83
| accessdate = 2010-01-22
| access-date = 2010-01-22
}}</ref> Its presence in [[urine]] can be used to test for exposure to [[3-methylpentane]].<ref name="ih">{{Citation
}}</ref> Its presence in [[urine]] can be used to test for exposure to [[3-methylpentane]].<ref name="ih">{{Citation
| last = Lauwerys
| last = Lauwerys
| first = Robert R.
| first = Robert R.
| author-link =
| last2 = Hoet
| last2 = Hoet
| first2 = Perrine
| first2 = Perrine
| author2-link =
| publication-date =
| date =
| year = 2001
| year = 2001
| title = Industrial chemical exposure: guidelines for biological monitoring
| title = Industrial chemical exposure: guidelines for biological monitoring
| edition =
| volume =
| series =
| publication-place =
| place =
| publisher = CRC Press
| publisher = CRC Press
| id =
| isbn = 978-1-56670-545-5
| isbn = 978-1-56670-545-5
| doi =
| oclc =
| pages = 190
| pages = 190
| url = http://books.google.com/books?id=8pViePEG27sC&pg=PA190
| url = https://books.google.com/books?id=8pViePEG27sC&pg=PA190
| accessdate = 2010-01-22
| access-date = 2010-01-22
}}</ref>
}}</ref>


Line 147: Line 110:


{{DEFAULTSORT:Methyl-2-pentanol, 3-}}
{{DEFAULTSORT:Methyl-2-pentanol, 3-}}
{{alcohol-stub}}
[[Category:Alcohols]]
[[Category:Hexanols]]
[[Category:Hexanols]]


{{alcohol-stub}}

Latest revision as of 21:38, 11 December 2021

3-Methyl-2-pentanol[1]
Names
Preferred IUPAC name
3-Methylpentan-2-ol
Other names
3-Methyl-2-pentanol
Identifiers
3D model (JSmol)
ChEBI
ChemSpider
ECHA InfoCard 100.008.438 Edit this at Wikidata
EC Number
  • 209-281-6
  • InChI=1S/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3 checkY
    Key: ZXNBBWHRUSXUFZ-UHFFFAOYSA-N checkY
  • InChI=1/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3
    Key: ZXNBBWHRUSXUFZ-UHFFFAOYAP
  • OC(C)C(C)CC
Properties
C6H14O
Molar mass 102.174 g/mol
Appearance colorless liquid
Density 0.8307 g/cm3 at 20 °C
Boiling point 134.3 °C (273.7 °F; 407.4 K)
19 g/L
Solubility soluble in ethanol, diethyl ether
Thermochemistry
275.9 J·mol−1·K−1 (liquid)
Hazards
GHS labelling:
GHS02: FlammableGHS07: Exclamation mark
Warning
H226, H319
P210, P233, P240, P241, P242, P243, P264, P280, P303+P361+P353, P305+P351+P338, P337+P313, P370+P378, P403+P235, P501
Related compounds
Related compounds
Hexanol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is checkY☒N ?)

3-Methyl-2-pentanol (IUPAC name: 3-methylpentan-2-ol) is an organic chemical compound. It has been identified as a component of hops.[2] Its presence in urine can be used to test for exposure to 3-methylpentane.[3]

References

[edit]
  1. ^ Lide, David R. (1998), Handbook of Chemistry and Physics (87 ed.), Boca Raton, Florida: CRC Press, pp. 3–398, 5–47, 8–106, ISBN 0-8493-0594-2
  2. ^ Jackson, John F.; Linskens, Hans F. (2002), Analysis of taste and aroma, Springer, p. 83, ISBN 978-3-540-41753-8, retrieved 2010-01-22
  3. ^ Lauwerys, Robert R.; Hoet, Perrine (2001), Industrial chemical exposure: guidelines for biological monitoring, CRC Press, p. 190, ISBN 978-1-56670-545-5, retrieved 2010-01-22