Aldesulfone sodium: Difference between revisions
Content deleted Content added
consistent citation formatting |
Merged content to Sulfoxone, redirecting; uncontested 2021 proposal; same drug (easy-merge) Tag: New redirect |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
#REDIRECT [[Sulfoxone]] |
|||
{{Drugbox |
|||
| Verifiedfields = changed |
|||
| verifiedrevid = 477314858 |
|||
| IUPAC_name = [4-[4-(sulfinomethylamino) phenyl] sulfonylphenyl] aminomethanesulfinic acid |
|||
| image = Sulfoxone.png |
|||
| alt = Skeletal formula of aldesulfone sodium |
|||
| width = 240 |
|||
| image2 = Aldesulfone-sodium-3D-spacefill.png |
|||
| alt2 = Space-filling model of the component ions of aldesulfone sodium |
|||
<!--Clinical data--> |
|||
| tradename = |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category = |
|||
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|||
| legal_UK = <!-- GSL / P / POM / CD --> |
|||
| legal_US = <!-- OTC / Rx-only --> |
|||
| legal_status = |
|||
| routes_of_administration = Oral |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = |
|||
| protein_bound = 69% |
|||
| metabolism = [[Liver|Hepatic]] |
|||
| elimination_half-life = 3 to 8 hours |
|||
| excretion = |
|||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 144-75-2 |
|||
| ATC_prefix = J04 |
|||
| ATC_suffix = BA03 |
|||
| ATC_supplemental = |
|||
| PubChem = 8954 |
|||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|||
| DrugBank = DB01145 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 8610 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 57OWB0Q221 |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D02521 |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1200580 |
|||
<!--Chemical data--> |
|||
| C=14 | H=16 |
|||
| N=2 | O=6 |
|||
| S=3 | Na=2 |
|||
| molecular_weight = 404.485 g/mol |
|||
| smiles = [Na+].[Na+].[O-]S(=O)CNc1ccc(cc1)S(=O)(=O)c2ccc(NCS([O-])=O)cc2 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C14H16N2O6S3.2Na/c17-23(18)9-15-11-1-5-13(6-2-11)25(21,22)14-7-3-12(4-8-14)16-10-24(19)20;;/h1-8,15-16H,9-10H2,(H,17,18)(H,19,20);;/q;2*+1/p-2 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = AZBNFLZFSZDPQF-UHFFFAOYSA-L |
|||
}} |
|||
'''Aldesulfone sodium''' (or '''sulfoxone''') is an [[antibiotic]] used in the treatment of [[leprosy]]. |
|||
{{R from merge}} |
|||
Sulfoxone sodium was introduced in Japan in 1948.<ref>{{cite journal | vauthors = Ozawa H, Maruyama Y | title = [A 50-year history of new drugs in Japan: the developments of antileprosy drugs and their epidemiological aspects] | journal = Yakushigaku Zasshi | volume = 37 | issue = 1 | pages = 76–83 | year = 2002 | pmid = 12412600 }}</ref> |
|||
== References == |
|||
{{reflist}} |
|||
{{Antimycobacterials}} |
|||
{{Nucleic acid inhibitors}} |
|||
[[Category:Sulfonamide antibiotics]] |
|||
[[Category:Organic sodium salts]] |
|||
{{antiinfective-drug-stub}} |
|||
Latest revision as of 14:52, 15 March 2022
Redirect to:
- From a merge: This is a redirect from a page that was merged into another page. This redirect was kept in order to preserve the edit history of this page after its content was merged into the content of the target page. Please do not remove the tag that generates this text (unless the need to recreate content on this page has been demonstrated) or delete this page.
- For redirects with substantive page histories that did not result from page merges use {{R with history}} instead.