Jump to content

Antimony(III) acetate: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
mNo edit summary
 
(17 intermediate revisions by 13 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 399528978
| verifiedrevid = 429853293
| Name = Antimony(III) acetate
| Name = Antimony(III) acetate
| ImageFile = Antimony acetate.png
| ImageFile = Antimony(III)-acetate-xtal-1980-CM-3D-balls.png
| ImageSize = 150px
| ImageSize = 250px
| ImageName = Antimony(III) acetate
| ImageName = Antimony(III) acetate
| IUPACName = Antimony(III) acetate
| IUPACName = Antimony(III) acetate
| OtherNames = Antimony triacetate<br />Acetic acid, antimony(3+) salt<br />Octan antimonity<
| OtherNames = Antimony triacetate<br />Acetic acid, antimony(3+) salt
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| SMILES = CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[SbH3+3]
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 21839
| ChemSpiderID = 21839
| InChI = 1/3C2H4O2.Sb.3H/c3*1-2(3)4;;;;/h3*1H3,(H,3,4);;;;/q;;;+3;;;/p-3/r3C2H4O2.H3Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);1H3/q;;;+3/p-3
| InChI = 1/3C2H4O2.Sb.3H/c3*1-2(3)4;;;;/h3*1H3,(H,3,4);;;;/q;;;+3;;;/p-3/r3C2H4O2.H3Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);1H3/q;;;+3/p-3
Line 16: Line 16:
| InChI1 = 1/3C2H4O2.Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3
| InChI1 = 1/3C2H4O2.Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3
| InChIKey1 = JVLRYPRBKSMEBF-DFZHHIFOAU
| InChIKey1 = JVLRYPRBKSMEBF-DFZHHIFOAU
| SMILES1 = CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3]
| SMILES = O=C(C)O[Sb](OC(C)=O)OC(C)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/3C2H4O2.Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3
| StdInChI = 1S/3C2H4O2.Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JVLRYPRBKSMEBF-UHFFFAOYSA-K
| StdInChIKey = JVLRYPRBKSMEBF-UHFFFAOYSA-K
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 6923-52-0
| CASNo = 6923-52-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = F6Z6EKG4QY
| PubChem = 16685080
| PubChem = 16685080
| RTECS = AF4200000
| RTECS = AF4200000
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = Sb(CH<sub>3</sub>COO)<sub>3</sub>
| C = 6 | H = 9 | O = 6 | Sb = 1
| Appearance = White powder
| Appearance = White powder
| Density = 1.22 g/cm³ (20 °C)
| Density = 1.22 g/cm<sup>3</sup> (20 °C)
| Solubility =
| Solubility =
| MeltingPtC = 128.5
| MeltingPtC = 128.5
| Melting_notes = decomp to [[antimony(III) oxide|Sb<sub>2</sub>O<sub>3</sub>]]
| MeltingPt_notes = (decomposes to [[antimony(III) oxide|Sb<sub>2</sub>O<sub>3</sub>]])
| BoilingPt =
| BoilingPt =
| pKa =
| pKa =
| pKb =
| pKb =
| Viscosity =
| Viscosity =
}}
}}
| Section3 = {{Chembox Structure
|Section3={{Chembox Structure
| Coordination =
| Coordination =
| CrystalStruct =
| CrystalStruct =
| Dipole =
| Dipole =
}}
}}
| Section7 = {{Chembox Hazards
|Section7={{Chembox Hazards
| MainHazards =
| MainHazards =
| NFPA-H = 1
| NFPA-H = 1
| NFPA-F = 0
| NFPA-F = 0
| NFPA-R = 0
| NFPA-R = 0
| LD50 = 4480 mg/kg (rat)
| LD50 = 4480 mg/kg (rat)
| REL = TWA 0.5 mg/m<sup>3</sup> (as Sb)<ref name=PGCH>{{PGCH|0036}}</ref>
| PEL = TWA 0.5 mg/m<sup>3</sup> (as Sb)<ref name=PGCH/>
}}
}}
}}
}}


'''Antimony(III) acetate''' is the [[antimony]] [[Salt (chemistry)|salt]] of [[acetic acid]] with the [[chemical formula]] of Sb(CH<sub>3</sub>COO)<sub>3</sub>. It has the appearance of a white powder, id moderately water soluble, and is used as a [[catalyst]] in the production of [[synthetic fiber]]s.
'''Antimony(III) acetate''' is the compound of [[antimony]] with the [[chemical formula]] of Sb(CH<sub>3</sub>CO<sub>2</sub>)<sub>3</sub>. It is a white powder, is moderately water-soluble, and is used as a [[catalyst]] in the production of [[polyester]]s.


==Preparation==
==Preparation==
It can be prepared by the reaction of [[antimony(III) oxide]] with acetic acid:
It can be prepared by the reaction of [[antimony(III) oxide]] with [[acetic anhydride]]:


:Sb<sub>2</sub>O<sub>3</sub> + 6 HC<sub>2</sub>H<sub>3</sub>O<sub>2</sub> → 2 Sb(C<sub>2</sub>H<sub>3</sub>O<sub>2</sub>)<sub>3</sub> + 3H<sub>2</sub>O
:Sb<sub>2</sub>O<sub>3</sub> + 3 C<sub>4</sub>H<sub>6</sub>O<sub>3</sub> → 2 Sb(CH<sub>3</sub>CO<sub>2</sub>)<sub>3</sub>


==Structure==
==Crystal Structre==
The crystal structure of antimony(III) acetate has been determined by [[X-ray crystallography]]. It consists of discrete Sb(OAc)<sub>3</sub> monomers with monodentate [[acetate]] ligands. The monomers are linked together into chains by weaker C=O···Sb [[intermolecular interaction]]s.<ref>{{ cite journal | journal = [[Dalton Transactions|J. Chem. Soc., Dalton Trans.]] | year = 1980 | pages = 1292–1296 | first1 = M. | last1 = Hall | first2 = D. B. | last2 = Sowerby | title = Antimony(III) acetate and thioacetate: spectra and crystal structures | doi = 10.1039/DT9800001292 | issue = 8 }}</ref>
The crystal structure of antimony(III) acetate has been determined by [[X-ray crystallography]]. It consists of discrete Sb(OAc)<sub>3</sub> monomers with monodentate [[acetate]] ligands. The monomers are linked together into chains by weaker C=O···Sb [[intermolecular interaction]]s.<ref>{{ cite journal | journal = [[Dalton Transactions|J. Chem. Soc., Dalton Trans.]] | year = 1980 | pages = 1292–1296 | first1 = M. | last1 = Hall | first2 = D. B. | last2 = Sowerby | title = Antimony(III) acetate and thioacetate: spectra and crystal structures | doi = 10.1039/DT9800001292 | issue = 8 }}</ref>

[[File:Antimony(III)-acetate-xtal-1980-CM-3D-balls.png|400px]]


==References==
==References==
Line 69: Line 72:


{{Antimony compounds}}
{{Antimony compounds}}
{{clear}}
{{Acetates}}


[[Category:Antimony compounds]]
[[Category:Antimony(III) compounds]]
[[Category:Acetates]]
[[Category:Acetates]]

Latest revision as of 07:22, 29 August 2022

Antimony(III) acetate
Antimony(III) acetate
Names
IUPAC name
Antimony(III) acetate
Other names
Antimony triacetate
Acetic acid, antimony(3+) salt
Identifiers
3D model (JSmol)
ChemSpider
ECHA InfoCard 100.027.312 Edit this at Wikidata
RTECS number
  • AF4200000
UNII
  • InChI=1S/3C2H4O2.Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3 checkY
    Key: JVLRYPRBKSMEBF-UHFFFAOYSA-K checkY
  • InChI=1/3C2H4O2.Sb.3H/c3*1-2(3)4;;;;/h3*1H3,(H,3,4);;;;/q;;;+3;;;/p-3/r3C2H4O2.H3Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);1H3/q;;;+3/p-3
    Key: NSMVVPJZMRQLMR-ZHOQVWKLAW
  • InChI=1/3C2H4O2.Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3
    Key: JVLRYPRBKSMEBF-DFZHHIFOAU
  • O=C(C)O[Sb](OC(C)=O)OC(C)=O
Properties
Sb(CH3COO)3
Appearance White powder
Density 1.22 g/cm3 (20 °C)
Melting point 128.5 °C (263.3 °F; 401.6 K) (decomposes to Sb2O3)
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 1: Exposure would cause irritation but only minor residual injury. E.g. turpentineFlammability 0: Will not burn. E.g. waterInstability 0: Normally stable, even under fire exposure conditions, and is not reactive with water. E.g. liquid nitrogenSpecial hazards (white): no code
1
0
0
Lethal dose or concentration (LD, LC):
4480 mg/kg (rat)
NIOSH (US health exposure limits):
PEL (Permissible)
 TWA 0.5 mg/m3 (as Sb)[1]
REL (Recommended)
 TWA 0.5 mg/m3 (as Sb)[1]
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is checkY☒N ?)

Antimony(III) acetate is the compound of antimony with the chemical formula of Sb(CH3CO2)3. It is a white powder, is moderately water-soluble, and is used as a catalyst in the production of polyesters.

Preparation

[edit]

It can be prepared by the reaction of antimony(III) oxide with acetic anhydride:

Sb2O3 + 3 C4H6O3 → 2 Sb(CH3CO2)3

Structure

[edit]

The crystal structure of antimony(III) acetate has been determined by X-ray crystallography. It consists of discrete Sb(OAc)3 monomers with monodentate acetate ligands. The monomers are linked together into chains by weaker C=O···Sb intermolecular interactions.[2]

References

[edit]
  1. ^ a b NIOSH Pocket Guide to Chemical Hazards. "#0036". National Institute for Occupational Safety and Health (NIOSH).
  2. ^ Hall, M.; Sowerby, D. B. (1980). "Antimony(III) acetate and thioacetate: spectra and crystal structures". J. Chem. Soc., Dalton Trans. (8): 1292–1296. doi:10.1039/DT9800001292.
Stub icon

This inorganic compound–related article is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/enwiki/w/index.php?title=Antimony(III)_acetate&oldid=1107297413"