Jump to content

Dichlorophen: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
Importing Wikidata short description: "Chemical compound"
 
(42 intermediate revisions by 25 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| IUPAC_name = 2,2'-methylenebis(5-chlorophenol)
| Watchedfields = changed
| image = Dichlorophen.png
| verifiedrevid = 446639999
| CAS_number = 97-23-4
| IUPAC_name = 4-Chloro-2-[(5-chloro-2-hydroxyphenyl)methyl]phenol
| ATC_prefix = P02
| image = Dichlorophen.svg
| ATC_suffix = DX02
| image2 = Dichlorophen molecule ball.png
| PubChem = 3037
| width2 = 200
| DrugBank =
| alt2 = Ball-and-stick mode of the dichlorophen molecule
| C=13|H=10|Cl=2|O=2
| molecular_weight = 269.12 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}


<!--Clinical data-->
'''Dichlorophen''' is an [[anticestodal agent]].
| tradename =
| Drugs.com = {{drugs.com|international|dichlorophen}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =


<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =


<!--Identifiers-->
{{pharma-stub}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 97-23-4
| ATC_prefix = P02
| ATC_suffix = DX02
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| PubChem = 3037
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2929
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = T1J0JOU64O
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C14292
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 33845
<!--
| RTECS = SM0175000
| EINECS = 202-567-1
-->

<!--Chemical data-->
| C=13 | H=10 | Cl=2 | O=2
| smiles = C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = MDNWOSOZYLHTCG-UHFFFAOYSA-N
| density = 1.5 g/cm<sup>3</sup>
| melting_point = 177.5
| solubility = 0.003 g/100 mL<ref name="hand2">{{cite book | vauthors = Lide DR | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | location = Boca Raton, Florida | publisher = CRC Press | isbn = 0-8493-0594-2 | pages = 8–118 }}</ref>
<!--
| SolubleOther = 53 g/100 mL in [[ethanol]], 80 g/100 mL in [[acetone]]<ref name="hand">{{cite book | vauthors = Lide DR | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | location = Boca Raton, Florida | publisher = CRC Press | isbn = 0-8493-0594-2 | pages = 3–174 }}</ref>
| LD50 = 1000 mg/kg (mouse, oral)<ref name="gard"/>
-->
}}

'''Dichlorophen''' is an [[anticestodal agent]], fungicide, germicide, and antimicrobial agent.<ref name="gard">Milne, G.W.A. (Ed.). (2005). ''Gardner's commercially important chemicals: Synonyms, trade names, and properties.'' Hoboken, N.J.: Wiley-Interscience. [https://books.google.com/books?id=oWdc2qcb3QsC&pg=PA201 Google Books]</ref> It is used in combination with [[toluene]] for the removal of [[parasite]]s such as [[ascarid]]s, [[hookworm]]s, and [[tapeworm]]s from [[dog]]s and [[cat]]s.<ref name="cfr">{{Citation | title=Code of Federal Regulations | url= http://frwebgate1.access.gpo.gov/cgi-bin/TEXTgate.cgi?WAISdocID=220114194717+2+1+0&WAISaction=retrieve| work= Code of Federal Regulations, Title 21, Volume 6| publisher=U.S. Government Printing Office | date= 2005-04-01| access-date=2009-05-01}}</ref>

==Safety and regulation==
[[LD50]] (oral, mouse) is 3300 mg/kg.<ref name="a">{{Ullmann| vauthors = Fiege H, Voges HW, Hamamoto T, Umemura S, Iwata T, Miki H, Fujita Y, Buysch HJ, Garbe D, Paulus W | contribution=Phenol Derivatives | year=2007 | doi=10.1002/14356007.a19_313}}</ref>
==References==
{{reflist}}


{{Anthelmintics}}
{{Anthelmintics}}


[[Category:Antiparasitic agents]]
[[Category:Antiparasitic agents]]
[[Category:Organochlorides]]
[[Category:Chloroarenes]]
[[Category:Phenols]]
[[Category:Phenols]]
[[Category:Veterinary drugs]]



{{antiinfective-drug-stub}}
[[de:Dichlorophen]]
[[fr:Dichlorophène]]

Latest revision as of 00:51, 29 January 2023

Dichlorophen
Ball-and-stick mode of the dichlorophen molecule
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
  • 4-Chloro-2-[(5-chloro-2-hydroxyphenyl)methyl]phenol
CAS Number
PubChem CID
ChemSpider
UNII
KEGG
ChEMBL
CompTox Dashboard (EPA)
ECHA InfoCard100.002.335 Edit this at Wikidata
Chemical and physical data
FormulaC13H10Cl2O2
Molar mass269.12 g·mol−1
3D model (JSmol)
Density1.5 g/cm3 g/cm3
Melting point177.5 °C (351.5 °F)
Solubility in water0.003 g/100 mL[1] mg/mL (20 °C)
  • C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O
  • InChI=1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2 ☒N
  • Key:MDNWOSOZYLHTCG-UHFFFAOYSA-N ☒N
 ☒NcheckY (what is this?)  (verify)

Dichlorophen is an anticestodal agent, fungicide, germicide, and antimicrobial agent.[2] It is used in combination with toluene for the removal of parasites such as ascarids, hookworms, and tapeworms from dogs and cats.[3]

Safety and regulation

[edit]

LD50 (oral, mouse) is 3300 mg/kg.[4]

References

[edit]
  1. ^ Lide DR (1998). Handbook of Chemistry and Physics (87 ed.). Boca Raton, Florida: CRC Press. pp. 8–118. ISBN 0-8493-0594-2.
  2. ^ Milne, G.W.A. (Ed.). (2005). Gardner's commercially important chemicals: Synonyms, trade names, and properties. Hoboken, N.J.: Wiley-Interscience. Google Books
  3. ^ "Code of Federal Regulations", Code of Federal Regulations, Title 21, Volume 6, U.S. Government Printing Office, 2005-04-01, retrieved 2009-05-01
  4. ^ Fiege H, Voges HW, Hamamoto T, Umemura S, Iwata T, Miki H, Fujita Y, Buysch HJ, Garbe D, Paulus W (2007). "Phenol Derivatives". Ullmann's Encyclopedia of Industrial Chemistry. Weinheim: Wiley-VCH. doi:10.1002/14356007.a19_313. ISBN 978-3527306732.


Stub icon

This antiinfective drug article is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/enwiki/w/index.php?title=Dichlorophen&oldid=1136157509"