Calcium glucoheptonate: Difference between revisions
Appearance
Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey. |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(15 intermediate revisions by 9 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Clinical data--> |
|||
| tradename = |
|||
| Drugs.com = {{drugs.com|international|calcium-glucoheptonate}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 16741933 |
| ChemSpiderID = 16741933 |
||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
| InChI = 1/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 |
|||
| UNII = L11651398J |
|||
| InChIKey = FATUQANACHZLRT-DKUZMZKCBH |
|||
<!--Chemical data--> |
|||
| C=14 | H=26 | Ca=1 | O=16 |
|||
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 |
| StdInChI = 1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = FATUQANACHZLRT-YTESCSPLSA-L |
| StdInChIKey = FATUQANACHZLRT-YTESCSPLSA-L |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| chemical_formula = C<sub>14</sub>H<sub>26</sub>CaO<sub>16</sub> |
|||
| molecular_weight = 490.425 g/mol |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''Calcium glucoheptonate''' is a highly water soluble [[Dietary mineral|mineral supplement]].<ref name="Wiria_2020">{{cite journal | vauthors = Wiria M, Tran HM, Nguyen PH, Valencia O, Dutta S, Pouteau E | title = Relative bioavailability and pharmacokinetic comparison of calcium glucoheptonate with calcium carbonate | journal = Pharmacology Research & Perspectives | volume = 8 | issue = 2 | pages = e00589 | date = April 2020 | pmid = 32302064 | pmc = 7164401 | doi = 10.1002/prp2.589 }}</ref> |
|||
'''Calcium glucoheptonate''' is a [[Dietary mineral|mineral supplement]]. |
|||
== References == |
|||
{{Reflist}} |
|||
{{Mineral supplements}} |
{{Mineral supplements}} |
||
{{Calcium compounds}} |
|||
[[Category:Calcium compounds]] |
[[Category:Calcium compounds]] |
Latest revision as of 21:09, 11 November 2023
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.044.880 |
Chemical and physical data | |
Formula | C14H26CaO16 |
Molar mass | 490.424 g·mol−1 |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Calcium glucoheptonate is a highly water soluble mineral supplement.[1]
References
[edit]- ^ Wiria M, Tran HM, Nguyen PH, Valencia O, Dutta S, Pouteau E (April 2020). "Relative bioavailability and pharmacokinetic comparison of calcium glucoheptonate with calcium carbonate". Pharmacology Research & Perspectives. 8 (2): e00589. doi:10.1002/prp2.589. PMC 7164401. PMID 32302064.