Jump to content

Calcium glucoheptonate: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.
Importing Wikidata short description: "Chemical compound"
 
(15 intermediate revisions by 9 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 393587479
| Watchedfields = changed
| IUPAC_name = calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate
| verifiedrevid = 401940746
| image = calcium glucoheptonate.png
| IUPAC_name = calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate
| CASNo_Ref = {{cascite|correct|CAS}}
| image = calcium glucoheptonate.png
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|calcium-glucoheptonate}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 29039-00-7
| ATC_prefix = A12
| ATC_suffix = AA10
| PubChem = 28327
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00326
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 16741933
| ChemSpiderID = 16741933
| UNII_Ref = {{fdacite|changed|FDA}}
| InChI = 1/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1
| UNII = L11651398J
| InChIKey = FATUQANACHZLRT-DKUZMZKCBH
<!--Chemical data-->
| C=14 | H=26 | Ca=1 | O=16
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1
| StdInChI = 1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FATUQANACHZLRT-YTESCSPLSA-L
| StdInChIKey = FATUQANACHZLRT-YTESCSPLSA-L
| CAS_number = 29039-00-7
| ATC_prefix = A12
| ATC_suffix = AA10
| PubChem = 28327
| DrugBank =
| chemical_formula = C<sub>14</sub>H<sub>26</sub>CaO<sub>16</sub>
| molecular_weight = 490.425 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''Calcium glucoheptonate''' is a highly water soluble [[Dietary mineral|mineral supplement]].<ref name="Wiria_2020">{{cite journal | vauthors = Wiria M, Tran HM, Nguyen PH, Valencia O, Dutta S, Pouteau E | title = Relative bioavailability and pharmacokinetic comparison of calcium glucoheptonate with calcium carbonate | journal = Pharmacology Research & Perspectives | volume = 8 | issue = 2 | pages = e00589 | date = April 2020 | pmid = 32302064 | pmc = 7164401 | doi = 10.1002/prp2.589 }}</ref>
'''Calcium glucoheptonate''' is a [[Dietary mineral|mineral supplement]].



== References ==
{{Reflist}}


{{Mineral supplements}}
{{Mineral supplements}}
{{Calcium compounds}}


[[Category:Calcium compounds]]
[[Category:Calcium compounds]]

Latest revision as of 21:09, 11 November 2023

Calcium glucoheptonate
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
  • calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
CompTox Dashboard (EPA)
ECHA InfoCard100.044.880 Edit this at Wikidata
Chemical and physical data
FormulaC14H26CaO16
Molar mass490.424 g·mol−1
3D model (JSmol)
  • [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO
  • InChI=1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 checkY
  • Key:FATUQANACHZLRT-YTESCSPLSA-L checkY
 ☒NcheckY (what is this?)  (verify)

Calcium glucoheptonate is a highly water soluble mineral supplement.[1]

References

[edit]
  1. ^ Wiria M, Tran HM, Nguyen PH, Valencia O, Dutta S, Pouteau E (April 2020). "Relative bioavailability and pharmacokinetic comparison of calcium glucoheptonate with calcium carbonate". Pharmacology Research & Perspectives. 8 (2): e00589. doi:10.1002/prp2.589. PMC 7164401. PMID 32302064.