Jump to content

Pramiconazole: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
Changed category
auto mw
 
(7 intermediate revisions by 6 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{More citations needed|date=January 2021}}
{{More citations needed|date=January 2021}}
{{Drugbox
{{Drugbox
Line 4: Line 5:
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 366890982
| verifiedrevid = 366890982
| IUPAC_name = 1-<nowiki/>{4-[4-(4-<nowiki/>{[(2''R'',4''S'')-2-(2,4-difluorophenyl)-2-(1''H''-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one
| IUPAC_name = 1-<nowiki/>{4-[4-(4-{[(2''R'',4''S'')-2-(2,4-difluorophenyl)-2-(1''H''-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one
| image = Pramiconazole.png
| image = Pramiconazole.png
| width =
| width =
| image2 =
| image2 =
| width2 =
| width2 =


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| legal_status =
| routes_of_administration = [[Oral administration|By mouth]]
| routes_of_administration = [[Oral administration|By mouth]]


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


Line 33: Line 34:
| CAS_number = 219923-85-0
| CAS_number = 219923-85-0
| ATC_prefix = none
| ATC_prefix = none
| ATC_suffix =
| ATC_suffix =
| ATC_supplemental =
| ATC_supplemental =
| PubChem2 = 11411233
| PubChem2 = 11411233
| PubChem = 3013050
| PubChem = 3013050
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4SYH0R661F
| UNII = 4SYH0R661F
Line 49: Line 50:
<!--Chemical data-->
<!--Chemical data-->
| C=35 | H=39 | F=2 | N=7 | O=4
| C=35 | H=39 | F=2 | N=7 | O=4
| molecular_weight = 659.725
| SMILES = CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F
| SMILES = CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
Line 57: Line 57:
}}
}}


'''Pramiconazole''' is a [[triazole]] [[antifungal]] which was under development by Barrier Therapeutics for the treatment of acute skin and mucosal fungal infections but was never marketed.<ref name="AdisInsight">https://adisinsight.springer.com/drugs/800020810</ref>
'''Pramiconazole''' is a [[triazole]] [[antifungal]] which was under development by Barrier Therapeutics for the treatment of acute skin and mucosal fungal infections but was never marketed.<ref name="AdisInsight">{{Cite web|url=https://adisinsight.springer.com/drugs/800020810|title=Pramiconazole - AdisInsight}}</ref><ref name="pmid18763217">{{cite journal | vauthors = Geria AN, Scheinfeld NS | title = Pramiconazole, a triazole compound for the treatment of fungal infections | journal = IDrugs: The Investigational Drugs Journal | volume = 11 | issue = 9 | pages = 661–70 | date = September 2008 | pmid = 18763217 | doi = | url = }}</ref>


==References==
==References==
Line 70: Line 70:
[[Category:Organofluorides]]
[[Category:Organofluorides]]
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]
[[Category:para-Methoxyphenylpiperazines]]
[[Category:Piperazines]]
[[Category:Phenylpiperazines]]
[[Category:Phenylethanolamine ethers]]
[[Category:Triazole antifungals]]
[[Category:Triazole antifungals]]
[[Category:Ureas]]
[[Category:Ureas]]

Latest revision as of 04:23, 25 March 2024

Pramiconazole
Clinical data
Routes of
administration
By mouth
ATC code
  • none
Identifiers
  • 1-{4-[4-(4-{[(2R,4S)-2-(2,4-difluorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one
CAS Number
PubChem CID
ChemSpider
UNII
ChEMBL
Chemical and physical data
FormulaC35H39F2N7O4
Molar mass659.739 g·mol−1
3D model (JSmol)
  • CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F
  • InChI=1S/C35H39F2N7O4/c1-25(2)43-17-18-44(34(43)45)29-6-4-27(5-7-29)40-13-15-41(16-14-40)28-8-10-30(11-9-28)46-20-33-47-22-35(48-33,21-42-24-38-23-39-42)31-12-3-26(36)19-32(31)37/h3-12,19,23-25,33H,13-18,20-22H2,1-2H3/t33-,35+/m0/s1 ☒N
  • Key:AEKNYBWUEYNWMJ-QWOOXDRHSA-N ☒N
 ☒NcheckY (what is this?)  (verify)

Pramiconazole is a triazole antifungal which was under development by Barrier Therapeutics for the treatment of acute skin and mucosal fungal infections but was never marketed.[1][2]

References

[edit]
  1. ^ "Pramiconazole - AdisInsight".
  2. ^ Geria AN, Scheinfeld NS (September 2008). "Pramiconazole, a triazole compound for the treatment of fungal infections". IDrugs: The Investigational Drugs Journal. 11 (9): 661–70. PMID 18763217.