Pramiconazole: Difference between revisions
Appearance
Content deleted Content added
Citation bot (talk | contribs) Alter: journal. | Use this bot. Report bugs. | Suggested by Abductive | Category:Multiple chemicals in an infobox that need indexing | #UCB_Category 270/1863 |
auto mw |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{More citations needed|date=January 2021}} |
{{More citations needed|date=January 2021}} |
||
{{Drugbox |
{{Drugbox |
||
Line 4: | Line 5: | ||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = 366890982 |
| verifiedrevid = 366890982 |
||
| IUPAC_name = 1-<nowiki/>{4-[4-(4- |
| IUPAC_name = 1-<nowiki/>{4-[4-(4-{[(2''R'',4''S'')-2-(2,4-difluorophenyl)-2-(1''H''-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one |
||
| image = Pramiconazole.png |
| image = Pramiconazole.png |
||
| width = |
| width = |
||
| image2 = |
| image2 = |
||
| width2 = |
| width2 = |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = [[Oral administration|By mouth]] |
| routes_of_administration = [[Oral administration|By mouth]] |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
Line 33: | Line 34: | ||
| CAS_number = 219923-85-0 |
| CAS_number = 219923-85-0 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| ATC_supplemental = |
| ATC_supplemental = |
||
| PubChem2 = 11411233 |
| PubChem2 = 11411233 |
||
| PubChem = 3013050 |
| PubChem = 3013050 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 4SYH0R661F |
| UNII = 4SYH0R661F |
||
Line 49: | Line 50: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=35 | H=39 | F=2 | N=7 | O=4 |
| C=35 | H=39 | F=2 | N=7 | O=4 |
||
| molecular_weight = 659.725 |
|||
| SMILES = CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F |
| SMILES = CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F |
||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
||
Line 70: | Line 70: | ||
[[Category:Organofluorides]] |
[[Category:Organofluorides]] |
||
[[Category:Phenol ethers]] |
[[Category:Phenol ethers]] |
||
[[Category: |
[[Category:Piperazines]] |
||
[[Category:Phenylethanolamine ethers]] |
[[Category:Phenylethanolamine ethers]] |
||
[[Category:Triazole antifungals]] |
[[Category:Triazole antifungals]] |
Latest revision as of 04:23, 25 March 2024
This article needs additional citations for verification. (January 2021) |
Clinical data | |
---|---|
Routes of administration | By mouth |
ATC code |
|
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
ChEMBL | |
Chemical and physical data | |
Formula | C35H39F2N7O4 |
Molar mass | 659.739 g·mol−1 |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Pramiconazole is a triazole antifungal which was under development by Barrier Therapeutics for the treatment of acute skin and mucosal fungal infections but was never marketed.[1][2]
References
[edit]- ^ "Pramiconazole - AdisInsight".
- ^ Geria AN, Scheinfeld NS (September 2008). "Pramiconazole, a triazole compound for the treatment of fungal infections". IDrugs: The Investigational Drugs Journal. 11 (9): 661–70. PMID 18763217.