Jump to content

Pramiconazole: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
m Quick-adding category Organofluorides (using HotCat)
auto mw
 
(42 intermediate revisions by 22 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{More citations needed|date=January 2021}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| IUPAC_name = 1-{4-[4-(4-{[(2''R'',4''S'')-2-(2,4-difluorophenyl)-2-(1''H''-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one
| Watchedfields = changed
| image = Pramiconazole.png
| verifiedrevid = 366890982
| width =
| IUPAC_name = 1-<nowiki/>{4-[4-(4-{[(2''R'',4''S'')-2-(2,4-difluorophenyl)-2-(1''H''-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one
| image2 =
| image = Pramiconazole.png
| width2 =
| width =
| imagename = <!-- else may use drug_name -->
| image2 =
| drug_name = <!-- else may use imagename -->
| width2 =
| CAS_number =
| CAS_supplemental =
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 11411233
| DrugBank =
| chemical_formula =
| C=35 | H=39 | F=2 | N=7 | O=4
| molecular_weight = 659.725 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}


<!--Clinical data-->
'''Pramiconazole''' is a [[triazole]] antifungal undergoing research for the treatment of acute skin and mucosal fungal infections.
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration = [[Oral administration|By mouth]]


<!--Pharmacokinetic data-->
It is developed by Barrier Therapeutics.
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =


<!--Identifiers-->
{{pharma-stub}}
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 219923-85-0
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem2 = 11411233
| PubChem = 3013050
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4SYH0R661F
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 175797
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2281806
| synonyms =

<!--Chemical data-->
| C=35 | H=39 | F=2 | N=7 | O=4
| SMILES = CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C35H39F2N7O4/c1-25(2)43-17-18-44(34(43)45)29-6-4-27(5-7-29)40-13-15-41(16-14-40)28-8-10-30(11-9-28)46-20-33-47-22-35(48-33,21-42-24-38-23-39-42)31-12-3-26(36)19-32(31)37/h3-12,19,23-25,33H,13-18,20-22H2,1-2H3/t33-,35+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = AEKNYBWUEYNWMJ-QWOOXDRHSA-N
}}

'''Pramiconazole''' is a [[triazole]] [[antifungal]] which was under development by Barrier Therapeutics for the treatment of acute skin and mucosal fungal infections but was never marketed.<ref name="AdisInsight">{{Cite web|url=https://adisinsight.springer.com/drugs/800020810|title=Pramiconazole - AdisInsight}}</ref><ref name="pmid18763217">{{cite journal | vauthors = Geria AN, Scheinfeld NS | title = Pramiconazole, a triazole compound for the treatment of fungal infections | journal = IDrugs: The Investigational Drugs Journal | volume = 11 | issue = 9 | pages = 661–70 | date = September 2008 | pmid = 18763217 | doi = | url = }}</ref>

==References==
{{Reflist}}


{{Antifungals}}
{{Antifungals}}


[[Category:Antifungals]]
[[Category:Dioxolanes]]
[[Category:Triazoles]]
[[Category:Imidazolidinones]]
[[Category:Isopropyl compounds]]
[[Category:Lanosterol 14α-demethylase inhibitors]]
[[Category:Organofluorides]]
[[Category:Organofluorides]]
[[Category:Phenol ethers]]
[[Category:Piperazines]]
[[Category:Phenylethanolamine ethers]]
[[Category:Triazole antifungals]]
[[Category:Ureas]]


{{Antiinfective-drug-stub}}

Latest revision as of 04:23, 25 March 2024

Pramiconazole
Clinical data
Routes of
administration		By mouth
ATC code
  • none
Identifiers
  • 1-{4-[4-(4-{[(2R,4S)-2-(2,4-difluorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one
CAS Number
PubChem CID
ChemSpider
UNII
ChEMBL
Chemical and physical data
FormulaC35H39F2N7O4
Molar mass659.739 g·mol−1
3D model (JSmol)
  • CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F
  • InChI=1S/C35H39F2N7O4/c1-25(2)43-17-18-44(34(43)45)29-6-4-27(5-7-29)40-13-15-41(16-14-40)28-8-10-30(11-9-28)46-20-33-47-22-35(48-33,21-42-24-38-23-39-42)31-12-3-26(36)19-32(31)37/h3-12,19,23-25,33H,13-18,20-22H2,1-2H3/t33-,35+/m0/s1 ☒N
  • Key:AEKNYBWUEYNWMJ-QWOOXDRHSA-N ☒N
 ☒NcheckY (what is this?)  (verify)

Pramiconazole is a triazole antifungal which was under development by Barrier Therapeutics for the treatment of acute skin and mucosal fungal infections but was never marketed.[1][2]

References

[edit]
  1. ^ "Pramiconazole - AdisInsight".
  2. ^ Geria AN, Scheinfeld NS (September 2008). "Pramiconazole, a triazole compound for the treatment of fungal infections". IDrugs: The Investigational Drugs Journal. 11 (9): 661–70. PMID 18763217.


Stub icon

This antiinfective drug article is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/enwiki/w/index.php?title=Pramiconazole&oldid=1215441490"