Jump to content

Triethylene glycol dinitrate: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
corrected a mis-spelling
Undid revision 1223052230 by Trasheater Midir (talk)
 
(12 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| verifiedrevid = 316641775
| verifiedrevid = 428740427
| ImageFile = TEGDN.png
| ImageFile = TEGDN.png
| ImageSize = 200px
| ImageSize = 200px
| IUPACName = 2,2'-(Ethane-1,2-diylbis(oxy))bisethyl dinitrate ]
| IUPACName = 2,2'-(Ethane-1,2-diylbis(oxy))bisethyl dinitrate ]
| OtherNames = TEGDN
| OtherNames = TEGDN
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 111-22-8
| CASNo = 111-22-8
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem =
| UNII = 6X99UD6JTA
| PubChem = 8099
| ChemSpiderID = 7808
| StdInChI = 1S/C6H12N2O8/c9-7(10)15-5-3-13-1-2-14-4-6-16-8(11)12/h1-6H2
| StdInChIKey = AGCQZYRSTIRJFM-UHFFFAOYSA-N
| SMILES = C(CO[N+](=O)[O-])OCCOCCO[N+](=O)[O-]
| SMILES = C(CO[N+](=O)[O-])OCCOCCO[N+](=O)[O-]
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C = 6 | H = 12 | N = 2 | O = 8
| C=6 | H=12 | N=2 | O=8
| MolarMass =
| MolarMass =
| Appearance = pale yellow oily liquid
| Appearance = pale yellow oily liquid
| Density = 1.33 g/cm<sup>3</sup>
| Density = 1.33 g/cm<sup>3</sup>
| MeltingPtC = -19
| MeltingPtC = -19
| BoilingPt =
| BoilingPt =
| Solubility = }}
| Solubility = }}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition = }}
| AutoignitionPt = }}
| Section6 = {{Chembox Explosive
|Section6={{Chembox Explosive
| ShockSens =
| ShockSens =
| FrictionSens =
| FrictionSens =
| ExplosiveV =
| DetonationV =
| REFactor = }}
| REFactor = }}
}}
}}


'''Triethylene glycol dinitrate''' ('''TEGDN''') is a [[nitration|nitrated]] [[alcohol]] [[ester]] of [[triethylene glycol]]. It is used as an energetic [[plasticizer]] in [[explosive]]s and [[propellant]]s. Its chemical formula is O<sub>2</sub>N-O-CH<sub>2</sub>CH<sub>2</sub>-O-CH<sub>2</sub>CH<sub>2</sub>-O-CH<sub>2</sub>CH<sub>2</sub>-O-NO<sub>2</sub>. It is a pale yellow oily liquid.<ref>[http://www.chemyq.com/En/xz/xz6/52027hfdla.htm Triethylene glycol dinitrate] at ChemYQ</ref> It is somewhat similar to [[nitroglycerin]].
'''Triethylene glycol dinitrate''' ('''TEGDN''') is an, [[ether]], [[nitration|nitrated]] [[Alcohol (chemistry)|alcohol]] [[ester]] of [[triethylene glycol]]. It is used as an energetic [[plasticizer]] in [[explosive]]s and [[propellant]]s. It is a pale yellow [[oil]]y liquid.<ref>[http://www.chemyq.com/En/xz/xz6/52027hfdla.htm Triethylene glycol dinitrate] at ChemYQ</ref> It is somewhat similar to [[nitroglycerin]].


TEGDN is often used together with [[trimethylolethane trinitrate]] (TMETN).
TEGDN is often used together with [[trimethylolethane trinitrate]] (TMETN).


Triethylene glycol dinitrate, [[diethylene glycol dinitrate]], and trimethylolethane trinitrate are being considered as replacements for nitroglycerin in propellants.<ref>[http://www.stormingmedia.us/cat/sub/subcat20-57.html Pentagon reports] at stormingmedia.us</ref>
Triethylene glycol dinitrate, [[diethylene glycol dinitrate]], and trimethylolethane trinitrate are being considered as replacements for nitroglycerin in propellants.<ref>[http://www.stormingmedia.us/cat/sub/subcat20-57.html US DoD reports] {{Webarchive|url=https://web.archive.org/web/20120903212929/http://www.stormingmedia.us/cat/sub/subcat20-57.html |date=2012-09-03 }} at stormingmedia.us</ref>


==References==
==References==
{{reflist}}
{{reflist}}


[[Category:Alkyl nitrates]]
[[Category:Nitrate esters]]
[[Category:Ethers]]
[[Category:Explosive chemicals]]
[[Category:Explosive chemicals]]
[[Category:Liquid explosives]]
[[Category:Liquid explosives]]

Latest revision as of 15:52, 9 May 2024

Triethylene glycol dinitrate
Names
IUPAC name
2,2'-(Ethane-1,2-diylbis(oxy))bisethyl dinitrate ]
Other names
TEGDN
Identifiers
3D model (JSmol)
ChemSpider
ECHA InfoCard 100.003.498 Edit this at Wikidata
UNII
  • InChI=1S/C6H12N2O8/c9-7(10)15-5-3-13-1-2-14-4-6-16-8(11)12/h1-6H2
    Key: AGCQZYRSTIRJFM-UHFFFAOYSA-N
  • C(CO[N+](=O)[O-])OCCOCCO[N+](=O)[O-]
Properties
C6H12N2O8
Molar mass 240.168 g·mol−1
Appearance pale yellow oily liquid
Density 1.33 g/cm3
Melting point −19 °C (−2 °F; 254 K)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
checkY verify (what is checkY☒N ?)

Triethylene glycol dinitrate (TEGDN) is an, ether, nitrated alcohol ester of triethylene glycol. It is used as an energetic plasticizer in explosives and propellants. It is a pale yellow oily liquid.[1] It is somewhat similar to nitroglycerin.

TEGDN is often used together with trimethylolethane trinitrate (TMETN).

Triethylene glycol dinitrate, diethylene glycol dinitrate, and trimethylolethane trinitrate are being considered as replacements for nitroglycerin in propellants.[2]

References

[edit]
  1. ^ Triethylene glycol dinitrate at ChemYQ
  2. ^ US DoD reports Archived 2012-09-03 at the Wayback Machine at stormingmedia.us