Jump to content

Eletefine: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
Content deleted Content added
VisualWikitext
Kwrugg (talk | contribs)
12 edits
←Created page with '{{chembox | Name = Eletefine | OtherNames = | Section1 = {{Chembox Identifiers | SMILES = | CASNo = | RTECS = }} | Section2 = {{Chembox Properties |…'
 
 
(32 intermediate revisions by 22 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| verifiedrevid = 424908834
| Name = Eletefine
| Name = Eletefine
| ImageFile = Eletefine.svg
| OtherNames =
| OtherNames =
| Section1 = {{Chembox Identifiers
| Section1 = {{Chembox Identifiers
| SMILES =
| SMILES = O(c4c2c3c(C=1O\C(=C/CC(O)CC=1)c3ncc2)c(OC)c4OC)C
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| CASNo =
| ChemSpiderID = 8840283
| PubChem = 10664930
| InChI = 1/C19H19NO5/c1-22-17-11-8-9-20-16-13-7-5-10(21)4-6-12(25-13)15(14(11)16)18(23-2)19(17)24-3/h6-10,21H,4-5H2,1-3H3/b12-6-,13-7-
| InChIKey = LRIBDPPXLMPCHW-QXFGSWAMBK
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H19NO5/c1-22-17-11-8-9-20-16-13-7-5-10(21)4-6-12(25-13)15(14(11)16)18(23-2)19(17)24-3/h6-10,21H,4-5H2,1-3H3/b12-6-,13-7-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LRIBDPPXLMPCHW-QXFGSWAMSA-N
⚫
| CASNo =
| RTECS =
| RTECS =
}}
}}
| Section2 = {{Chembox Properties
| Section2 = {{Chembox Properties
| Formula = C<sub>19</sub>21<sub>6</sub>NO<sub>5</sub>
| Formula = C<sub>19</sub>H<sub>19</sub>NO<sub>5</sub>
| MolarMass = 343.37 g/mol
| MolarMass = 343.357 g/mol
| Appearance = red waxy solid
| Appearance = red waxy solid
| Density =
| Density =
Line 28: Line 39:
| OtherCpds =
| OtherCpds =
}}
}}
}}
'''Eletefine''' is an [[isoquinoline]] [[alkaloid]] first isolated in 1998 from ''[[Cissampelos glaberrima]]''.<ref>{{cite journal | doi = 10.1021/np980018b |date=Sep 1998 |vauthors=da Cunha EV, Cornelio ML, Barbosa Filho JM, Braz FR, Gray AI | title = Eletefine, a stephaoxocane alkaloid from ''Cissampelos glaberrima'' | volume = 61 | issue = 9 | pages = 1140–2 | issn = 0163-3864 | pmid = 9748384 | journal = Journal of Natural Products}}</ref> It is one of few known compounds containing the so-called [[stephaoxocane]] skeleton, alongside [[stephaoxocanidine]], [[excentricine]], and the [[stephalonganine]]s.<ref>{{Cite journal| first1 = N.| first2 = S.| first3 = M.| first4 = M.| first5 = J.| last1 = Kashiwaba| first6 = H.| first7 = T. | title = Stephaoxocanidine, a New Isoquinoline Alkaloid from ''Stephania cepharantha'' | journal = Natural Product Research | volume = 9| issue = 3 | pages = 177–714 | year = 1997 | doi = 10.1080/10575639708048312| last2 = Morooka| last3 = Kimura| last4 = Ono| last5 = Toda| last6 = Suzuki| last7 = Sano}}</ref><ref>{{Cite journal| first1 = A. B. J.| first2 = T. S. | title = An alternative and convenient synthesis of oct-7-enal, a naturally-occurring aldehyde isolated from the Japanese thistle ''Cirsium dipsacolepis''| last1 = Bracca| journal = Journal of the Brazilian Chemical Society | volume = 19| issue = 6| pages = 1125–1128| year = 2008 | doi = 10.1590/S0103-50532008000600011| last2 = Kaufman| doi-access = free}}</ref><ref>{{Cite journal| last1 = Zhang | first1 = H.| last2 = Yue | first2 = J. -M. | title = New Stephaoxocane Alkaloids from ''Stephania longa'' | journal = Helvetica Chimica Acta | volume = 89| issue = 6 | pages = 1105| year = 2006 | doi = 10.1002/hlca.200690108 }}</ref>

== References ==
{{Reflist}}

[[Category:Isoquinoline alkaloids]]
[[Category:Phenol ethers]]
[[Category:Oxygen heterocycles]]
[[Category:Heterocyclic compounds with 4 rings]]
[[Category:Methoxy compounds]]

Latest revision as of 21:30, 29 September 2024

Eletefine
Identifiers
3D model (JSmol)
ChemSpider
  • InChI=1S/C19H19NO5/c1-22-17-11-8-9-20-16-13-7-5-10(21)4-6-12(25-13)15(14(11)16)18(23-2)19(17)24-3/h6-10,21H,4-5H2,1-3H3/b12-6-,13-7- checkY
    Key: LRIBDPPXLMPCHW-QXFGSWAMSA-N checkY
  • InChI=1/C19H19NO5/c1-22-17-11-8-9-20-16-13-7-5-10(21)4-6-12(25-13)15(14(11)16)18(23-2)19(17)24-3/h6-10,21H,4-5H2,1-3H3/b12-6-,13-7-
    Key: LRIBDPPXLMPCHW-QXFGSWAMBK
  • O(c4c2c3c(C=1O\C(=C/CC(O)CC=1)c3ncc2)c(OC)c4OC)C
Properties
C19H19NO5
Molar mass 343.357 g/mol
Appearance red waxy solid
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
checkY verify (what is checkY☒N ?)

Eletefine is an isoquinoline alkaloid first isolated in 1998 from Cissampelos glaberrima.[1] It is one of few known compounds containing the so-called stephaoxocane skeleton, alongside stephaoxocanidine, excentricine, and the stephalonganines.[2][3][4]

References

[edit]
  1. ^ da Cunha EV, Cornelio ML, Barbosa Filho JM, Braz FR, Gray AI (Sep 1998). "Eletefine, a stephaoxocane alkaloid from Cissampelos glaberrima". Journal of Natural Products. 61 (9): 1140–2. doi:10.1021/np980018b. ISSN 0163-3864. PMID 9748384.
  2. ^ Kashiwaba, N.; Morooka, S.; Kimura, M.; Ono, M.; Toda, J.; Suzuki, H.; Sano, T. (1997). "Stephaoxocanidine, a New Isoquinoline Alkaloid from Stephania cepharantha". Natural Product Research. 9 (3): 177–714. doi:10.1080/10575639708048312.
  3. ^ Bracca, A. B. J.; Kaufman, T. S. (2008). "An alternative and convenient synthesis of oct-7-enal, a naturally-occurring aldehyde isolated from the Japanese thistle Cirsium dipsacolepis". Journal of the Brazilian Chemical Society. 19 (6): 1125–1128. doi:10.1590/S0103-50532008000600011.
  4. ^ Zhang, H.; Yue, J. -M. (2006). "New Stephaoxocane Alkaloids from Stephania longa". Helvetica Chimica Acta. 89 (6): 1105. doi:10.1002/hlca.200690108.
Retrieved from "https://en.wikipedia.org/enwiki/w/index.php?title=Eletefine&oldid=1248501488"