Jump to content

Propyl benzoate: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
ChuispastonBot (talk | contribs)
100,206 edits
m r2.7.1) (Robot: Adding pt:Benzoato de propila
 
(27 intermediate revisions by 23 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 400869952
| Watchedfields = changed
⚫
| verifiedrevid = 464217147
| Name = Propyl benzoate
| Name = Propyl benzoate
| ImageFile = Propyl benzoate.png
| ImageFile = Propyl benzoate.svg
| ImageSize =
| ImageSize =
| ImageName = Propyl benzoate
| ImageName = Propyl benzoate
| IUPACName = Propyl benzoate
| PIN = Propyl benzoate
| OtherNames = ''n''-propyl benzoate, benzoic acid propyl ester
| OtherNames = ''n''-propyl benzoate, benzoic acid propyl ester
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 15965
| ChemSpiderID = 15965
| PubChem = 16846
| PubChem = 16846
| ChEBI = 156072
| InChI = 1/C10H12O2/c1-2-8-12-10(11)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3
| InChI = 1/C10H12O2/c1-2-8-12-10(11)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3
| InChIKey = UDEWPOVQBGFNGE-UHFFFAOYAH
| InChIKey = UDEWPOVQBGFNGE-UHFFFAOYAH
Line 19: Line 22:
| StdInChIKey = UDEWPOVQBGFNGE-UHFFFAOYSA-N
| StdInChIKey = UDEWPOVQBGFNGE-UHFFFAOYSA-N
| CASNo = 2315-68-6
| CASNo = 2315-68-6
| CASNo_Ref =
| CASNo_Ref = {{cascite|correct|CAS}}
| CASOther =
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| RTECS =
| UNII = VWK210B7WS
⚫
| RTECS =
| EINECS = 219-020-8
| EINECS = 219-020-8
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = C<sub>10</sub>H<sub>12</sub>O<sub>2</sub>
| Formula = C<sub>10</sub>H<sub>12</sub>O<sub>2</sub>
| MolarMass = 164.201 g/mol
| MolarMass = 164.201 g/mol
| Appearance = colorless oily liquid, nutty odor
| Appearance = colorless oily liquid, nutty odor
| Density = 1.0230 g/cm<sup>3</sup> at 20°C
| Density = 1.0230 g/cm<sup>3</sup> at 20&nbsp;°C
| MagSus = -105.00·10<sup>−6</sup> cm<sup>3</sup>/mol
| MeltingPt = -51.6°C
| MeltingPtC = −51.6
⚫
| BoilingPt = 230°C<ref name="BookPreserv"/>
| BoilingPtC = 230
⚫
| BoilingPt_ref = <ref name="BookPreserv"/>
| Solubility = insoluble
| Solubility = insoluble
| SolubleOther = miscible with [[ethanol]], [[diethyl ether]]<ref name="hand">
| SolubleOther = miscible with [[ethanol]], [[diethyl ether]]<ref name="hand">
{{Cite book
{{Cite book
| last = Lide
| last = Lide
| first = David R.
| first = David R.
| author-link =
| author-link =
⚫
| publication-date =
| last2 =
| first2 =
| year = 1998
⚫
| title = Handbook of Chemistry and Physics
| author2-link =
| edition = 87
⚫
| publication-date =
| date =
| volume =
| year = 1998
| series =
⚫
| location = Boca Raton, Florida
⚫
| title = Handbook of Chemistry and Physics
| edition = 87
| place =
| volume =
| publisher = CRC Press
| series =
| id =
| isbn = 0-8493-0594-2
⚫
| publication-place = Boca Raton, FL
| place =
| doi =
⚫
| oclc =
⚫
| publisher = CRC Press
| id =
| pages = 3–484
⚫
| url =
| isbn = 0849305942
| doi =
| accessdate =
⚫
| oclc =
| pages = 3–484
⚫
| url =
| accessdate =
}}</ref>
}}</ref>
}}
}}
| Section3 = {{Chembox Structure
|Section3={{Chembox Structure
| Coordination =
| Coordination =
| CrystalStruct =
| CrystalStruct =
}}
}}
| Section4 = {{Chembox Thermochemistry
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHf =
| DeltaHc =
| DeltaHc =
| Entropy =
| Entropy =
| HeatCapacity =
| HeatCapacity =
}}
}}
| Section7 = {{Chembox Hazards
|Section7={{Chembox Hazards
| ExternalSDS = [https://fscimage.fishersci.com/msds/00105.htm External MSDS]
| ExternalMSDS =
| EUIndex =
| NFPA-H =
| NFPA-H =
| NFPA-F =
| NFPA-F =
| NFPA-R =
| NFPA-R =
| RPhrases =
| HPhrases =
| SPhrases =
| PPhrases =
| GHS_ref =
⚫
| FlashPt = 98°C<ref name="BookPreserv"/>
| FlashPtC = 98
⚫
| FlashPt_ref = <ref name="BookPreserv"/>
}}
}}
| Section8 = {{Chembox Related
|Section8={{Chembox Related
| OtherCpds = [[Methyl benzoate]]<br/>[[Ethyl benzoate]]
| OtherCompounds = [[Methyl benzoate]]<br/>[[Ethyl benzoate]]
}}
}}
}}
}}
Line 87: Line 91:


==Uses==
==Uses==
Propyl benzoate has a nutty odor and sweet fruity or nut-like taste, and as such, it is used as a synthetic flavoring agent in foods. It also has [[antimicrobial]] properties and is used as a preservative in [[cosmetics]]. It occurs naturally in the [[sweet cherry]] and in [[clove]] [[Plant stem|stems]], as well as in [[butter]].<ref name="BookPreserv">{{cite book |last=Ash |first=Michael |coauthors=Ash, Irene |title=Handbook of Preservatives |url=http://books.google.com/?id=XZ2QB7bu5LwC&pg=PA404 |accessdate=2009-05-04 |year=2004 |publisher=Synapse Information Resources |isbn=1890595667 |page=508}}</ref><ref name="encyc">{{cite book
Propyl benzoate has a nutty odor and sweet fruity or nut-like taste, and as such, it is used as a synthetic flavoring agent in foods. It also has [[antimicrobial]] properties and is used as a preservative in [[cosmetics]]. It occurs naturally in the [[sweet cherry]] and in [[clove]] [[Plant stem|stems]], as well as in [[butter]].<ref name="BookPreserv">{{cite book |last=Ash |first=Michael |author2=Ash, Irene |title=Handbook of Preservatives |url=https://books.google.com/books?id=XZ2QB7bu5LwC&pg=PA404 |accessdate=2009-05-04 |year=2004 |publisher=Synapse Information Resources |isbn=1-890595-66-7 |page=508}}</ref><ref name="encyc">{{cite book
| last = Burdock
| last = Burdock
| first = George A.
| first = George A.
| authorlink =
| authorlink =
⚫
| title = Encyclopedia of Food and Color Additives
| coauthors =
⚫
| publisher = CRC Press
⚫
| title = Encyclopedia of Food and Color Additives
| date = 1997
| publisher = CRC Press
| date = 1997
| location =
| location =
| pages = 2340
⚫
| url = https://books.google.com/books?id=JAVvqWBsBK0C&q=%22Propyl+benzoate%22&pg=PA2340
| pages = 2340
| doi =
⚫
| url = http://books.google.com/?id=JAVvqWBsBK0C&pg=PA2340&dq=%22Propyl+benzoate%22
| doi =
| id =
⚫
| isbn = 978-0-8493-9416-4}}</ref>
| id =
⚫
| isbn = 9780849394164}}</ref>


==Reactions==
==Reactions==
Propyl benzoate can be synthesized by the [[esterification]] of [[methyl benzoate]] with [[propanol]].<ref name="encyc"/>
Propyl benzoate can be synthesized by the [[transesterification]] of [[methyl benzoate]] with [[propanol]].<ref name="encyc"/>
Propyl benzoate can also be synthesized by means of [[Fischer esterification]] of [[benzoic acid]] with [[propanol]].


==References==
==References==
{{Reflist}}
{{Reflist}}

{{organic-compound-stub}}


[[Category:Food additives]]
[[Category:Food additives]]
[[Category:Preservatives]]
[[Category:Preservatives]]
[[Category:Benzoates]]
[[Category:Benzoate esters]]



{{ester-stub}}{{Esters}}
[[pt:Benzoato de propila]]

Latest revision as of 16:02, 12 October 2024

Propyl benzoate
Propyl benzoate
Names
Preferred IUPAC name
Propyl benzoate
Other names
n-propyl benzoate, benzoic acid propyl ester
Identifiers
3D model (JSmol)
ChEBI
ChemSpider
ECHA InfoCard 100.017.292 Edit this at Wikidata
EC Number
  • 219-020-8
UNII
  • InChI=1S/C10H12O2/c1-2-8-12-10(11)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 checkY
    Key: UDEWPOVQBGFNGE-UHFFFAOYSA-N checkY
  • InChI=1/C10H12O2/c1-2-8-12-10(11)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3
    Key: UDEWPOVQBGFNGE-UHFFFAOYAH
  • O=C(OCCC)c1ccccc1
Properties
C10H12O2
Molar mass 164.201 g/mol
Appearance colorless oily liquid, nutty odor
Density 1.0230 g/cm3 at 20 °C
Melting point −51.6 °C (−60.9 °F; 221.6 K)
Boiling point 230 °C (446 °F; 503 K)[2]
insoluble
Solubility miscible with ethanol, diethyl ether[1]
-105.00·10−6 cm3/mol
Hazards
Flash point 98 °C (208 °F; 371 K)[2]
Safety data sheet (SDS) External MSDS
Related compounds
Related compounds
 Methyl benzoate
Ethyl benzoate
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is checkY☒N ?)

Propyl benzoate is an organic chemical compound used as a food additive. It is an ester.

Uses

[edit]

Propyl benzoate has a nutty odor and sweet fruity or nut-like taste, and as such, it is used as a synthetic flavoring agent in foods. It also has antimicrobial properties and is used as a preservative in cosmetics. It occurs naturally in the sweet cherry and in clove stems, as well as in butter.[2][3]

Reactions

[edit]

Propyl benzoate can be synthesized by the transesterification of methyl benzoate with propanol.[3] Propyl benzoate can also be synthesized by means of Fischer esterification of benzoic acid with propanol.

References

[edit]
  1. ^ Lide, David R. (1998). Handbook of Chemistry and Physics (87 ed.). Boca Raton, Florida: CRC Press. pp. 3–484. ISBN 0-8493-0594-2.
  2. ^ a b c Ash, Michael; Ash, Irene (2004). Handbook of Preservatives. Synapse Information Resources. p. 508. ISBN 1-890595-66-7. Retrieved 2009-05-04.
  3. ^ a b Burdock, George A. (1997). Encyclopedia of Food and Color Additives. CRC Press. p. 2340. ISBN 978-0-8493-9416-4.


Stub icon

This article about an ester is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/enwiki/w/index.php?title=Propyl_benzoate&oldid=1250800701"