Glycyrrhizol: Difference between revisions
Content deleted Content added
m cat |
removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
||
| (48 intermediate revisions by 25 users not shown) | |||
| Line 1: | Line 1: | ||
{{chembox |
|||
Glycyrrhizol A is a [[flavonoid]] compound isolated from the root of the Chinese [[Licorice]] plant (''[[Glycyrrhiza]] uralensis''). |
|||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 408565402 |
|||
| Name=Glycyrrhizol A |
|||
| ImageFile = Glycyrrhizol A.png |
|||
| ImageSize = 200px |
|||
| PIN = 1-Methoxy-2,8-bis(3-methylbut-2-en-1-yl)-6''H''-[1]benzofuro[3,2-''c''] [1]benzopyran-3,9-diol |
|||
| OtherNames = |
|||
|Section1={{Chembox Identifiers |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 9721048 |
|||
| InChI = 1/C26H28O5/c1-14(2)6-8-16-10-18-19-13-30-23-12-21(28)17(9-7-15(3)4)25(29-5)24(23)26(19)31-22(18)11-20(16)27/h6-7,10-12,27-28H,8-9,13H2,1-5H3 |
|||
| InChIKey = CBPFOSMNDISZLV-UHFFFAOYAJ |
|||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 65976 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 522282 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C26H28O5/c1-14(2)6-8-16-10-18-19-13-30-23-12-21(28)17(9-7-15(3)4)25(29-5)24(23)26(19)31-22(18)11-20(16)27/h6-7,10-12,27-28H,8-9,13H2,1-5H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = CBPFOSMNDISZLV-UHFFFAOYSA-N |
|||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 877373-00-7 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 84L7S5MVN5 |
|||
| PubChem = 11546269 |
|||
| SMILES = o2c1c(cc(c(O)c1)C\C=C(/C)C)c3c2c4c(OC)c(c(O)cc4OC3)C\C=C(/C)C |
|||
}} |
|||
|Section2={{Chembox Properties |
|||
| Formula = C<sub>26</sub>H<sub>28</sub>O<sub>5</sub> |
|||
| MolarMass = 420.50 g/mol |
|||
| Appearance = |
|||
| Density = |
|||
| MeltingPt = |
|||
| BoilingPt = |
|||
| Solubility = }} |
|||
|Section3={{Chembox Hazards |
|||
| MainHazards = |
|||
| FlashPt = |
|||
| AutoignitionPt = }} |
|||
}} |
|||
'''Glycyrrhizol A''' is a [[prenylated]] [[pterocarpan]] and an [[isoflavonoid]] derivative. It is a compound isolated from the root of the [[Glycyrrhiza uralensis|Chinese licorice plant]] (''Glycyrrhiza uralensis'').{{cn|date=February 2023}} |
|||
Recent studies have suggested that these compounds have [[antibacterial]] properties.<sup>[1]</sup> The strongest antibacterial activity was observed against ''[[Streptococcus mutans]]'', an organism known to cause tooth decay in humans. |
|||
[[image:Glycyrrhizol-structure.gif|center|Structure of Glycyrrhizol A]] |
|||
It may has ''[[in vitro]]'' [[antibacterial]] properties.<ref name = He>{{cite journal | vauthors= He J, Chen L, Shi W, ((Lu Q-Y)) | title=Antibacterial Compounds from ''Glycyrrhiza uralensis'' | journal= Journal of Natural Products | volume=69| issue=1 | year=2006 | pages=121–124 | doi=10.1021/np058069d | pmid= 16441081| citeseerx=10.1.1.552.7335 }}</ref> In one study, the strongest antibacterial activity was observed against ''[[Streptococcus mutans]]'', an organism known to cause tooth decay in humans.<ref name = He/> |
|||
==References== |
==References== |
||
{{reflist}} |
|||
* <sup>[1]</sup> {{cite journal | author= He J, Chen L, Shi W, Lu, Q-Y | title=Antibacterial Compounds from ''Glycyrrhiza uralensis'' | journal=[[Journal of Natural Products]] | volume=69| issue=1 | year=2006 | pages=121-124 | id=}} |
|||
{{Pterocarpan}} |
|||
[[Category:Pterocarpans]] |
|||
[[Category:Antibiotics]] |
|||
[[Category:Hydroxyarenes]] |
|||
[[Category:Methoxy compounds]] |
|||
| ⚫ | |||
| ⚫ | |||
{{Category:Medicinal plants}} |
|||
Latest revision as of 12:01, 21 October 2024
| |
| Names | |
|---|---|
| Preferred IUPAC name
1-Methoxy-2,8-bis(3-methylbut-2-en-1-yl)-6H-[1]benzofuro[3,2-c] [1]benzopyran-3,9-diol | |
| Identifiers | |
3D model (JSmol)
|
|
| ChEBI | |
| ChEMBL | |
| ChemSpider | |
PubChem CID
|
|
| UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C26H28O5 | |
| Molar mass | 420.50 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Glycyrrhizol A is a prenylated pterocarpan and an isoflavonoid derivative. It is a compound isolated from the root of the Chinese licorice plant (Glycyrrhiza uralensis).[citation needed]
It may has in vitro antibacterial properties.[1] In one study, the strongest antibacterial activity was observed against Streptococcus mutans, an organism known to cause tooth decay in humans.[1]
References
[edit]- ^ a b He J, Chen L, Shi W, Lu Q-Y (2006). "Antibacterial Compounds from Glycyrrhiza uralensis". Journal of Natural Products. 69 (1): 121–124. CiteSeerX 10.1.1.552.7335. doi:10.1021/np058069d. PMID 16441081.
 | This article about an aromatic compound is a stub. You can help Wikipedia by expanding it. |