Jump to content

Thyronamine: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (no changed fields - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'CASNo_Ref') per Chem/Drugbox validation (report errors or bugs)
 
(23 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{Unreferenced|date=December 2009}}
{{Chembox
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 418302300
| Watchedfields = changed
| verifiedrevid = 470609845
| ImageFile = Thyronamine.svg
| ImageFile = Thyronamine.svg
| ImageSize = 300px
| ImageSize = 200px
| ImageFile2 = Thyronamine3d.png
| ImageFile2 = Thyronamine3d.png
| ImageSize2 = 300px
| ImageSize2 = 200px
| PIN = 4-[4-(2-Aminoethyl)phenoxy]phenol
| IUPACName =
| OtherNames =
| OtherNames =
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2340781
| ChemSpiderID = 2340781
| InChI = 1/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2
| InChI = 1/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2
Line 19: Line 20:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OVUVNKDANCKDCK-UHFFFAOYSA-N
| StdInChIKey = OVUVNKDANCKDCK-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 500-78-7
| CASNo = 500-78-7
| PubChem = 3083601
| PubChem = 3083601
| SMILES = O(c1ccc(cc1)CCN)c2ccc(O)cc2
| SMILES = O(c1ccc(cc1)CCN)c2ccc(O)cc2
| MeSHName = thyronamine
| MeSHName = thyronamine
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=14 | H=15 | N=1 | O=2
| Formula = C<sub>14</sub>H<sub>15</sub>NO<sub>2</sub>
| Appearance =
| MolarMass = 229.274 g mol<sup>−1</sup>
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| Solubility =
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| AutoignitionPt =
| Autoignition =
}}
}}
}}
}}
Line 47: Line 46:


* Thyronamine (T0AM)
* Thyronamine (T0AM)
* [[3-Iodothyronamine]] (T1AM), which is the most notable one as it is a [[trace amine]] found in the [[nervous system]]. It is a possible candidate for the natural ligand of the [[trace amine-associated receptor]] TAAR1 (TAR1), a [[G protein-coupled receptor]] located in the [[cell membrane]].
* [[3-Iodothyronamine]] (T1AM), which is the most notable one as it is a [[trace amine]] found in the [[nervous system]]. It is a possible candidate for the natural ligand of the [[trace amine-associated receptor]] TAAR1 (TAR1), an intracellular [[G protein-coupled receptor]]<ref>{{cite journal | vauthors = Piehl S, Hoefig CS, Scanlan TS, Köhrle J | year = 2011 | title = Thyronamines - Past, Present, and Future | journal = Endocrine Reviews | volume = 32 | pages = 64–80 | doi = 10.1210/er.2009-0040 | pmid = 20880963 | issue = 1| doi-access = free }}</ref>
* 3,5-Diiodothyronamine (T2AM)
* 3,5-Diiodothyronamine (T2AM)
* [[3,5,3'-Triiodothyronamine]] (T3AM)
* [[3,5,3'-Triiodothyronamine]] (T3AM)
Line 54: Line 53:
* [[Trace amine]]s
* [[Trace amine]]s
* [[Thyroid hormone]]
* [[Thyroid hormone]]

==References==
{{Reflist}}


{{Thyroid hormone intermediates}}
{{Thyroid hormone intermediates}}
{{TAAR ligands}}
{{Phenethylamines}}


[[Category:Biogenic amines]]
[[Category:Biogenic amines]]
[[Category:Phenethylamines]]
[[Category:Phenethylamines]]
[[Category:Phenols]]
[[Category:4-Hydroxyphenyl compounds]]
[[Category:Thyroid]]

[[Category:TAAR1 agonists]]
[[de:Thyronamine]]
[[fr:Thyronamine]]
[[ja:チロナミン]]
[[zh:类甲腺质]]

Latest revision as of 18:26, 21 October 2024

Thyronamine
Names
Preferred IUPAC name
4-[4-(2-Aminoethyl)phenoxy]phenol
Identifiers
3D model (JSmol)
ChEMBL
ChemSpider
MeSH thyronamine
  • InChI=1S/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2 checkY
    Key: OVUVNKDANCKDCK-UHFFFAOYSA-N checkY
  • InChI=1/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2
    Key: OVUVNKDANCKDCK-UHFFFAOYAP
  • O(c1ccc(cc1)CCN)c2ccc(O)cc2
Properties
C14H15NO2
Molar mass 229.279 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is checkY☒N ?)

Thyronamine refers both to a molecule, and to derivatives of that molecule: a family of decarboxylated and deiodinated metabolites of the thyroid hormones thyroxine (T4) and 3,5,3'-triiodothyronine (T3).

Types

[edit]

The group includes:

See also

[edit]

References

[edit]
  1. ^ Piehl S, Hoefig CS, Scanlan TS, Köhrle J (2011). "Thyronamines - Past, Present, and Future". Endocrine Reviews. 32 (1): 64–80. doi:10.1210/er.2009-0040. PMID 20880963.