Thyronamine: Difference between revisions
Content deleted Content added
nav |
removed Category:Phenols; added Category:4-Hydroxyphenyl compounds using HotCat |
||
| (36 intermediate revisions by 27 users not shown) | |||
| Line 1: | Line 1: | ||
{{ |
{{Chembox |
||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 470609845 |
|||
| ImageFile = Thyronamine.svg |
| ImageFile = Thyronamine.svg |
||
| ImageSize = |
| ImageSize = 200px |
||
| ImageFile2 = Thyronamine3d.png |
| ImageFile2 = Thyronamine3d.png |
||
| ImageSize2 = |
| ImageSize2 = 200px |
||
| PIN = 4-[4-(2-Aminoethyl)phenoxy]phenol |
|||
| IUPACName = |
|||
| OtherNames = |
| OtherNames = |
||
| |
|Section1={{Chembox Identifiers |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ⚫ | |||
| |
| ChemSpiderID = 2340781 |
||
| InChI = 1/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2 |
|||
| SMILES = |
|||
| InChIKey = OVUVNKDANCKDCK-UHFFFAOYAP |
|||
| ⚫ | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 201896 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = OVUVNKDANCKDCK-UHFFFAOYSA-N |
|||
| CASNo_Ref = {{cascite|changed|??}} |
|||
| ⚫ | |||
| PubChem = 3083601 |
|||
| SMILES = O(c1ccc(cc1)CCN)c2ccc(O)cc2 |
|||
| ⚫ | |||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=14 | H=15 | N=1 | O=2 |
|||
| Formula = C<sub>14</sub>H<sub>15</sub>NO<sub>2</sub> |
|||
| Appearance = |
|||
| MolarMass = 229.274 g mol<sup>−1</sup> |
|||
| |
| Density = |
||
| |
| MeltingPt = |
||
| |
| BoilingPt = |
||
| BoilingPt = |
|||
}} |
}} |
||
| |
|Section3={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| FlashPt = |
||
| |
| AutoignitionPt = |
||
| Autoignition = |
|||
}} |
}} |
||
}} |
}} |
||
| Line 30: | Line 42: | ||
'''Thyronamine''' refers both to a molecule, and to derivatives of that molecule: a family of [[decarboxylation|decarboxylated]] and [[iodine|deiodinated]] [[metabolite]]s of the [[thyroid hormone]]s [[thyroxine]] (T4) and [[triiodothyronine|3,5,3'-triiodothyronine]] (T3). |
'''Thyronamine''' refers both to a molecule, and to derivatives of that molecule: a family of [[decarboxylation|decarboxylated]] and [[iodine|deiodinated]] [[metabolite]]s of the [[thyroid hormone]]s [[thyroxine]] (T4) and [[triiodothyronine|3,5,3'-triiodothyronine]] (T3). |
||
==Types== |
|||
The group includes: |
The group includes: |
||
* Thyronamine (T0AM) |
* Thyronamine (T0AM) |
||
* [[3-Iodothyronamine]] (T1AM), which is the most notable one as it is a [[trace amine]] found in the [[nervous system]]. It is a possible candidate for the natural ligand of the [[trace amine-associated receptor]] TAAR1 (TAR1), |
* [[3-Iodothyronamine]] (T1AM), which is the most notable one as it is a [[trace amine]] found in the [[nervous system]]. It is a possible candidate for the natural ligand of the [[trace amine-associated receptor]] TAAR1 (TAR1), an intracellular [[G protein-coupled receptor]]<ref>{{cite journal | vauthors = Piehl S, Hoefig CS, Scanlan TS, Köhrle J | year = 2011 | title = Thyronamines - Past, Present, and Future | journal = Endocrine Reviews | volume = 32 | pages = 64–80 | doi = 10.1210/er.2009-0040 | pmid = 20880963 | issue = 1| doi-access = free }}</ref> |
||
* 3,5-Diiodothyronamine (T2AM) |
* 3,5-Diiodothyronamine (T2AM) |
||
* 3,5,3'-Triiodothyronamine (T3AM) |
* [[3,5,3'-Triiodothyronamine]] (T3AM) |
||
| ⚫ | |||
| ⚫ | |||
* [[Trace amine]]s |
|||
* [[Thyroid hormone]] |
* [[Thyroid hormone]] |
||
==References== |
|||
{{Reflist}} |
|||
{{Thyroid hormone intermediates}} |
{{Thyroid hormone intermediates}} |
||
{{TAAR ligands}} |
|||
{{Phenethylamines}} |
|||
[[Category:Biogenic amines]] |
[[Category:Biogenic amines]] |
||
[[Category:Phenethylamines]] |
[[Category:Phenethylamines]] |
||
[[Category: |
[[Category:4-Hydroxyphenyl compounds]] |
||
[[Category:Thyroid]] |
|||
[[Category:TAAR1 agonists]] |
|||
[[de:Thyronamine]] |
|||
Latest revision as of 18:26, 21 October 2024
| |
| |
| Names | |
|---|---|
| Preferred IUPAC name
4-[4-(2-Aminoethyl)phenoxy]phenol | |
| Identifiers | |
3D model (JSmol)
|
|
| ChEMBL | |
| ChemSpider | |
| MeSH | thyronamine |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C14H15NO2 | |
| Molar mass | 229.279 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Thyronamine refers both to a molecule, and to derivatives of that molecule: a family of decarboxylated and deiodinated metabolites of the thyroid hormones thyroxine (T4) and 3,5,3'-triiodothyronine (T3).
Types
[edit]The group includes:
- Thyronamine (T0AM)
- 3-Iodothyronamine (T1AM), which is the most notable one as it is a trace amine found in the nervous system. It is a possible candidate for the natural ligand of the trace amine-associated receptor TAAR1 (TAR1), an intracellular G protein-coupled receptor[1]
- 3,5-Diiodothyronamine (T2AM)
- 3,5,3'-Triiodothyronamine (T3AM)
See also
[edit]References
[edit]- ^ Piehl S, Hoefig CS, Scanlan TS, Köhrle J (2011). "Thyronamines - Past, Present, and Future". Endocrine Reviews. 32 (1): 64–80. doi:10.1210/er.2009-0040. PMID 20880963.