Vomilenine: Difference between revisions
Content deleted Content added
m General Fixes, added uncategorised tag using AWB |
m Added UNII |
||
| (11 intermediate revisions by 9 users not shown) | |||
| Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| ImageFile = Vomilenine. |
| ImageFile = Vomilenine.svg |
||
| |
| ImageSize = 200px |
||
| |
| ImageAlt = |
||
| IUPACName = [(1''R'',10''S'',12''R'',13''E'',14''R'',16''S'',18''R'')-13-Ethylidene-14-hydroxy-8,15-diazahexacyclo[14.2.1.0<sup>1,9</sup>.0<sup>2,7</sup>.0<sup>10,15</sup>.0<sup>12,17</sup>]nonadeca-2,4,6,8-tetraen-18-yl] acetate |
|||
| IUPACName = |
|||
| OtherNames = |
| OtherNames = 21α-Hydroxy-22-norajmala-1,19-dien-17α-yl acetate |
||
| |
|Section1={{Chembox Identifiers |
||
| |
| CASNo = 6880-50-8 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| ⚫ | |||
| |
| UNII = C9L2GUG8W2 |
||
| ⚫ | |||
| ⚫ | |||
| ChemSpiderID = 10128107 |
|||
| Formula = |
|||
| SMILES = C/C=C/1\[C@@H]2C[C@H]3C4=NC5=CC=CC=C5[C@]46C[C@@H](C2[C@H]6OC(=O)C)N3[C@@H]1O}} |
|||
| MolarMass = |
|||
| ⚫ | |||
| Appearance = |
|||
| C=21 | H=22 | N=2 | O=3 |
|||
| Density = |
|||
| |
| Appearance = |
||
| |
| Density = |
||
| |
| MeltingPt = |
||
| BoilingPt = |
|||
| ⚫ | |||
| |
| Solubility = }} |
||
| ⚫ | |||
| ⚫ | |||
| |
| MainHazards = |
||
| ⚫ | |||
| AutoignitionPt = }} |
|||
}} |
}} |
||
'''Vomilenine''' is an [[alkaloid]] that is an intermediate chemical in the biosynthesis of [[ajmaline]].<ref>{{cite journal |last1=von Schumann |first1=Gerald |last2=Gao |first2=Shujuan |last3=Stöckigt |first3=Joachim |date=2002 |title=Vomilenine reductase--a novel enzyme catalyzing a crucial step in the biosynthesis of the therapeutically applied antiarrhythmic alkaloid ajmaline |journal=Bioorg Med Chem |volume=10 |issue=6 |pages=1913–1918 |doi=10.1016/s0968-0896(01)00435-7 |pmid=11937349}}</ref> |
|||
'''Vomilenine''' is an intermediate chemical in the biosynthesis of [[ajmaline]]. |
|||
== |
==References== |
||
{{reflist}} |
|||
* [http://www.ncbi.nlm.nih.gov/pubmed/11937349 Vomilenine reductase--a novel enzyme catalyzing a crucial step in the biosynthesis of the therapeutically applied antiarrhythmic alkaloid ajmaline] |
|||
[[Category:Tryptamine alkaloids]] |
|||
[[Category:Quinolizidine alkaloids]] |
|||
{{ |
{{alkaloid-stub}} |
||
{{Uncategorized stub|date=October 2013}} |
|||
Latest revision as of 18:01, 18 August 2022
| |
| Names | |
|---|---|
| IUPAC name
[(1R,10S,12R,13E,14R,16S,18R)-13-Ethylidene-14-hydroxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6,8-tetraen-18-yl] acetate
| |
| Other names
21α-Hydroxy-22-norajmala-1,19-dien-17α-yl acetate
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
PubChem CID
|
|
| UNII | |
CompTox Dashboard (EPA)
|
|
| |
| Properties | |
| C21H22N2O3 | |
| Molar mass | 350.418 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Vomilenine is an alkaloid that is an intermediate chemical in the biosynthesis of ajmaline.[1]
References
[edit]- ^ von Schumann, Gerald; Gao, Shujuan; Stöckigt, Joachim (2002). "Vomilenine reductase--a novel enzyme catalyzing a crucial step in the biosynthesis of the therapeutically applied antiarrhythmic alkaloid ajmaline". Bioorg Med Chem. 10 (6): 1913–1918. doi:10.1016/s0968-0896(01)00435-7. PMID 11937349.
 | This article about an alkaloid is a stub. You can help Wikipedia by expanding it. |