Trinitrotriazine: Difference between revisions
Content deleted Content added
m remove Erik9bot category,outdated, tag and general fixes |
|||
| Line 1: | Line 1: | ||
#REDIRECT [[RDX]] |
|||
{{Unreferenced stub|auto=yes|date=December 2009}} |
|||
{{Orphan|date=February 2009}} |
|||
{{Chembox |
|||
| ImageFile = Trinitrotriazine.png |
|||
| ImageSize = 150px |
|||
| IUPACName = 2,4,6-Trinitro-1,3,5-triazine |
|||
| OtherNames = |
|||
| Section1 = {{Chembox Identifiers |
|||
| CASNo = 140218-59-3 |
|||
| PubChem = |
|||
| SMILES = O=[N+]([O-])C1=NC([N+]([O-])=O)=NC([N+]([O-])=O)=N1 |
|||
}} |
|||
| Section2 = {{Chembox Properties |
|||
| Formula = C<sub>3</sub>N<sub>6</sub>O<sub>6</sub> |
|||
| MolarMass = 216.07 |
|||
| Appearance = |
|||
| Density = |
|||
| MeltingPt = |
|||
| BoilingPt = |
|||
| Solubility = |
|||
}} |
|||
| Section3 = {{Chembox Hazards |
|||
| MainHazards = |
|||
| FlashPt = |
|||
| Autoignition = |
|||
}} |
|||
| Section6 = {{Chembox Explosive |
|||
| ShockSens = |
|||
| FrictionSens = |
|||
| ExplosiveV = |
|||
}} |
|||
}} |
|||
'''Trinitrotriazine''', or '''2,4,6-trinitro-1,3,5-triazine''', is a potential [[explosive]]. It can be made by reacting 1,3,5-[[triazine]] (or s-triazine) with [[nitric acid]] and a [[sulfuric acid]] [[catalyst]]: |
|||
:C<sub>3</sub>H<sub>3</sub>N<sub>3</sub> + 3 HNO<sub>3</sub> → C<sub>3</sub>N<sub>3</sub>(NO<sub>2</sub>)<sub>3</sub> + 3 H<sub>2</sub>O |
|||
It has a perfect oxygen balance, potentially making it a very powerful explosive: |
|||
:C<sub>3</sub>N<sub>3</sub>(NO<sub>2</sub>)<sub>3</sub> → 3 CO<sub>2</sub> + 3 N<sub>2</sub> |
|||
[[Category:Explosive chemicals]] |
|||
[[Category:Triazines]] |
|||
[[Category:Nitro compounds]] |
|||
{{Explosive-stub}} |
|||
Revision as of 18:19, 17 March 2010
Redirect to: