Jump to content

Buphenine: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
m Quick-adding category Phenols (using HotCat)
PotatoBot (talk | contribs)
m Stub sorting and placement of stub template(s)
Line 34: Line 34:
{{reflist}}
{{reflist}}


{{pharma-stub}}


{{Other gynecologicals}}
{{Other gynecologicals}}
Line 41: Line 40:
[[Category:Phenethylamines]]
[[Category:Phenethylamines]]
[[Category:Phenols]]
[[Category:Phenols]]


{{cardiovascular-drug-stub}}

Revision as of 13:25, 29 July 2010

{{Drugbox | IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol | image = Buphenine.png | ChemSpiderID = 4407 | InChI = 1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3 | InChIKey = PTGXAUBQBSGPKF-UHFFFAOYAE | CAS_number = 447-41-6 | ATC_prefix = G02 | ATC_suffix = CA02 | PubChem = 4567 | DrugBank = |smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C | C=19 | H=25 | N=1 | O=2 | molecular_weight = 299.41 g/mol | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = }}

Buphenine (or nylidrin) is a sympathomimetic[1] and beta-adrenergic agonist.

References

  1. ^ Mittag TW, Tormay A, Messenger M, Podos SM (1985). "Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin". Invest. Ophthalmol. Vis. Sci. 26 (2): 163–9. PMID 2857689. {{cite journal}}: Unknown parameter |month= ignored (help)CS1 maint: multiple names: authors list (link)