Jump to content

Buphenine: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
m CS1 maintenance: vauthors/veditors or enumerate multiple authors/editors; WP:GenFixes on using AWB
Bufeniode
Line 43: Line 43:


'''Buphenine''' (or '''nylidrin''') is a [[Beta2-adrenergic agonist|β<sub>2</sub> adrenoreceptor agonist]]<ref name="pmid2857689">{{cite journal |vauthors=Mittag TW, Tormay A, Messenger M, Podos SM |title=Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin |journal=Invest. Ophthalmol. Vis. Sci. |volume=26 |issue=2 |pages=163–9 |date=February 1985 |pmid=2857689 |doi= |url=http://www.iovs.org/cgi/pmidlookup?view=long&pmid=2857689}}</ref> that acts as a [[vasodilator]].
'''Buphenine''' (or '''nylidrin''') is a [[Beta2-adrenergic agonist|β<sub>2</sub> adrenoreceptor agonist]]<ref name="pmid2857689">{{cite journal |vauthors=Mittag TW, Tormay A, Messenger M, Podos SM |title=Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin |journal=Invest. Ophthalmol. Vis. Sci. |volume=26 |issue=2 |pages=163–9 |date=February 1985 |pmid=2857689 |doi= |url=http://www.iovs.org/cgi/pmidlookup?view=long&pmid=2857689}}</ref> that acts as a [[vasodilator]].
==See also==

*[[Bufeniode]] is where there is iodination at both of positions ''ortho'' to the phenol hydroxy.
*[[Isoxsuprine]]
==References==
==References==
{{reflist}}
{{reflist}}

Revision as of 12:38, 21 June 2016

{{Drugbox | IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol | image = Buphenine.svg

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 447-41-6 | ATC_prefix = C04 | ATC_suffix = AA02 | ATC_supplemental = G02CA02 (WHO) | PubChem = 4567 | DrugBank = | ChemSpiderID = 4407 | UNII_Ref =  checkY | UNII = 695DKH33EI | ChEMBL_Ref =  checkY | ChEMBL = 114655

| C=19 | H=25 | N=1 | O=2 | molecular_weight = 299.41 g/mol | smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C }}

Buphenine (or nylidrin) is a β2 adrenoreceptor agonist[1] that acts as a vasodilator.

See also

  • Bufeniode is where there is iodination at both of positions ortho to the phenol hydroxy.
  • Isoxsuprine

References

  1. ^ Mittag TW, Tormay A, Messenger M, Podos SM (February 1985). "Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin". Invest. Ophthalmol. Vis. Sci. 26 (2): 163–9. PMID 2857689.