Vomilenine: Difference between revisions
Content deleted Content added
No edit summary |
Innerstream (talk | contribs) No edit summary |
||
| Line 1: | Line 1: | ||
{{unreferenced|date=September 2015}} |
|||
{{Chembox |
{{Chembox |
||
| ImageFile = Vomilenine. |
| ImageFile = Vomilenine.svg |
||
| ImageSize = |
| ImageSize = 200px |
||
| ImageAlt = |
| ImageAlt = |
||
| IUPACName = [(1''R'',10''S'',12''R'',13''E'',14''R'',16''S'',18''R'')-13-Ethylidene-14-hydroxy-8,15-diazahexacyclo[14.2.1.0<sup>1,9</sup>.0<sup>2,7</sup>.0<sup>10,15</sup>.0<sup>12,17</sup>]nonadeca-2,4,6,8-tetraen-18-yl] acetate |
|||
| IUPACName = |
|||
| OtherNames = |
| OtherNames = 21α-Hydroxy-22-norajmala-1,19-dien-17α-yl acetate |
||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| CASNo = 6880-50-8 |
| CASNo = 6880-50-8 |
||
| PubChem = 11953806 |
| PubChem = 11953806 |
||
| ChemSpiderID = 10128107 |
| ChemSpiderID = 10128107 |
||
| SMILES = C/C=C/1\[C@@H]2C[C@H]3C4=NC5=CC=CC=C5[C@]46C[C@@H](C2[C@H]6OC(=O)C)N3[C@@H]1O}} |
|||
| SMILES = }} |
|||
|Section2={{Chembox Properties |
|Section2={{Chembox Properties |
||
| C=21 | H=22 | N=2 | O=3 |
| C=21 | H=22 | N=2 | O=3 |
||
| Formula = |
|||
| MolarMass = |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
| Line 26: | Line 23: | ||
}} |
}} |
||
'''Vomilenine''' is an [[alkaoid]] that is an intermediate chemical in the biosynthesis of [[ajmaline]].<ref>{{cite journal | pmid = 11937349 | title = Vomilenine reductase--a novel enzyme catalyzing a crucial step in the biosynthesis of the therapeutically applied antiarrhythmic alkaloid ajmaline | author = Gerald von Schumann, Shujuan Gao, Joachim Stöckigt | doi = 10.1016/s0968-0896(01)00435-7 | journal = Bioorg Med Chem | date = 2002 | volume = 10 | issue = 6 | pages = 1913-1918 }}</ref> |
|||
'''Vomilenine''' is an intermediate chemical in the biosynthesis of [[ajmaline]]. |
|||
== |
==References== |
||
{{reflist}} |
|||
* [https://www.ncbi.nlm.nih.gov/pubmed/11937349 Vomilenine reductase--a novel enzyme catalyzing a crucial step in the biosynthesis of the therapeutically applied antiarrhythmic alkaloid ajmaline] |
|||
[[Category:Alkaloids]] |
[[Category:Alkaloids]] |
||
[[Category:Antiarrhythmic agents]] |
|||
[[Category:Biosynthesis]] |
|||
{{ |
{{alkaloid-stub}} |
||
Revision as of 16:19, 31 July 2021
| |
| Names | |
|---|---|
| IUPAC name
[(1R,10S,12R,13E,14R,16S,18R)-13-Ethylidene-14-hydroxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6,8-tetraen-18-yl] acetate
| |
| Other names
21α-Hydroxy-22-norajmala-1,19-dien-17α-yl acetate
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| Properties | |
| C21H22N2O3 | |
| Molar mass | 350.418 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Vomilenine is an alkaoid that is an intermediate chemical in the biosynthesis of ajmaline.[1]
References
- ^ Gerald von Schumann, Shujuan Gao, Joachim Stöckigt (2002). "Vomilenine reductase--a novel enzyme catalyzing a crucial step in the biosynthesis of the therapeutically applied antiarrhythmic alkaloid ajmaline". Bioorg Med Chem. 10 (6): 1913–1918. doi:10.1016/s0968-0896(01)00435-7. PMID 11937349.
{{cite journal}}: CS1 maint: multiple names: authors list (link)
 | This article about an alkaloid is a stub. You can help Wikipedia by expanding it. |