Trinitrotriazine: Difference between revisions

Content deleted Content added

Inline

Revision as of 15:01, 14 February 2007

Trinitrotriazine, or 2,4,6-trinitro-1,3,5-triazine, is a potential explosive. It can be made by reacting triazine with nitric acid and a sulfuric acid catalyst:

C₃H₃N₃ + 3 HNO₃ → C₃N₃(NO₂)₃ + 3 H₂O

It may explode without the addition of oxygen or any other reactant:

C₃N₃(NO₂)₃ → 3 CO₂ + 3 N₂

This explosives-related article is a stub. You can help Wikipedia by expanding it.

@@ Line 1: / Line 1: @@
+{{Chembox new
-[[Image:Trinitrotriazine.PNG|thumb|right|Chemical structure of trinitrotriazine]]
+| ImageFile = Trinitrotriazine.png
-'''2,4,6-trinitro-1,3,5-triazine''' or '''trinitrotriazine'''  is a potential [[explosive]]. It can be made by reacting [[triazine]] with [[nitric acid]]. It could be formed in the reaction (with a [[sulfuric acid]] [[catalyst]]):<br>
+| ImageSize = 150px
-:C<sub>3</sub>H<sub>3</sub>N<sub>3</sub> + HNO<sub>3</sub> → C<sub>3</sub>N<sub>3</sub>(NO<sub>2</sub>)<sub>3</sub> + 3H<sub>2</sub>O
+| IUPACName = 2,4,6-Trinitro-1,3,5-triazine
+| OtherNames =
+| Section1 = {{Chembox Identifiers
+|   CASNo = 140218-59-3
+|   PubChem =
+|   SMILES = O=[N+]([O-])C1=NC([N+]([O-])=O)=NC([N+]([O-])=O)=N1
+  }}
+| Section2 = {{Chembox Properties
+|   Formula = C<sub>3</sub>N<sub>3</sub>O<sub>6</sub>
+|   MolarMass = 216.07
+|   Appearance =
+|   Density =
+|   MeltingPt =
+|   BoilingPt =
+|   Solubility =
+  }}
+| Section3 = {{Chembox Hazards
+|   MainHazards =
+|   FlashPt =
+|   Autoignition =
+  }}
+| Section6 = {{Chembox Explosive
+| ShockSens =
+| FrictionSens =
+| ExplosiveV =
+  }}
+}}
+'''Trinitrotriazine''', or '''2,4,6-trinitro-1,3,5-triazine''', is a potential [[explosive]]. It can be made by reacting [[triazine]] with [[nitric acid]] and a [[sulfuric acid]] [[catalyst]]:
-It can explode with the reaction:<br>
-:C<sub>3</sub>N<sub>3</sub>(NO<sub>2</sub>)<sub>3</sub> → 3CO<sub>2</sub> + 3N<sub>2</sub> <br>
+:C<sub>3</sub>H<sub>3</sub>N<sub>3</sub> + 3 HNO<sub>3</sub> → C<sub>3</sub>N<sub>3</sub>(NO<sub>2</sub>)<sub>3</sub> + 3 H<sub>2</sub>O
-Notice that the explosion reaction needs only one molecule of explosive, and that the reaction needs only this material as a reactant. Therefore, it can be used as an explosive by itself.
+It may explode without the addition of oxygen or any other reactant:
+:C<sub>3</sub>N<sub>3</sub>(NO<sub>2</sub>)<sub>3</sub> → 3 CO<sub>2</sub> + 3 N<sub>2</sub>
@@ Line 12: / Line 43: @@
 [[Category:Explosive chemicals]]
 [[Category:Triazines]]
+[[Category:Nitro compounds]]