Aldesulfone sodium: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'CASNo_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBo |
Script assisted update of chemical identifiers from ChemSpider for the Chem/Drugbox validation project. |
||
| Line 4: | Line 4: | ||
| image = Aldesulfone.svg |
| image = Aldesulfone.svg |
||
| CASNo_Ref = {{cascite}} |
| CASNo_Ref = {{cascite}} |
||
| InChI = 1/C14H16N2O6S3.2Na/c17-23(18)9-15-11-1-5-13(6-2-11)25(21,22)14-7-3-12(4-8-14)16-10-24(19)20;;/h1-8,15-16H,9-10H2,(H,17,18)(H,19,20);;/q;2*+1/p-2 |
|||
| smiles = [Na+].[Na+].[O-]S(=O)CNc1ccc(cc1)S(=O)(=O)c2ccc(NCS([O-])=O)cc2 |
|||
| InChIKey = AZBNFLZFSZDPQF-NUQVWONBAG |
|||
| CAS_number = 144-75-2 |
| CAS_number = 144-75-2 |
||
| ATC_prefix = J04 |
| ATC_prefix = J04 |
||
Revision as of 17:27, 24 October 2009
 | |
| Clinical data | |
|---|---|
| Routes of administration | Oral |
| ATC code | |
| Pharmacokinetic data | |
| Protein binding | 69% |
| Metabolism | Hepatic |
| Elimination half-life | 3 to 8 hours |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| DrugBank | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| Chemical and physical data | |
| Formula | C14H16N2O6S3 |
| Molar mass | 404.485 g/mol g·mol−1 |
| 3D model (JSmol) | |
| |
| (verify) | |
Aldesulfone sodium (or sulfoxone) is an antibiotic used in the treatment of leprosy.
Sulfoxone sodium was introduced in Japan in 1948.[1]
References
- ^ PMID 12412600
 | This systemic antibiotic-related article is a stub. You can help Wikipedia by expanding it. |