Cefprozil: Difference between revisions
Content deleted Content added
Script assisted update of chemical identifiers from ChemSpider for the Chem/Drugbox validation project. |
Updating {{drugbox}} (no changed fields - added verified revid - updated 'CASNo_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBo |
||
| Line 1: | Line 1: | ||
{{drugbox |
{{drugbox |
||
| verifiedrevid = 327652774 |
|||
| IUPAC_name = 8-[2-amino-2-(4-hydroxyphenyl)-acetyl] amino-7-oxo-4-prop-1-enyl-2-thia-6- azabicyclo [ 4.2.0]oct-4-ene-5-carboxylic acid |
| IUPAC_name = 8-[2-amino-2-(4-hydroxyphenyl)-acetyl] amino-7-oxo-4-prop-1-enyl-2-thia-6- azabicyclo [ 4.2.0]oct-4-ene-5-carboxylic acid |
||
| image = Cefprozil.svg |
| image = Cefprozil.svg |
||
| Line 5: | Line 6: | ||
| smiles = O=C2N1/C(=C(/C=C/C)CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccc(O)cc3)N)C(=O)O.O |
| smiles = O=C2N1/C(=C(/C=C/C)CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccc(O)cc3)N)C(=O)O.O |
||
| InChIKey = ALYUMNAHLSSTOU-CIRGZYLNBD |
| InChIKey = ALYUMNAHLSSTOU-CIRGZYLNBD |
||
| CASNo_Ref = {{cascite}} |
|||
| CAS_number = 92665-29-7 |
| CAS_number = 92665-29-7 |
||
| ATC_prefix = J01 |
| ATC_prefix = J01 |
||
Revision as of 12:22, 24 November 2009
 | |
| Clinical data | |
|---|---|
| Pregnancy category |
|
| Routes of administration | ORAL |
| ATC code | |
| Pharmacokinetic data | |
| Bioavailability | 95% |
| Protein binding | 36% |
| Elimination half-life | 1.3 hours |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| DrugBank | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| Chemical and physical data | |
| Formula | C18H19N3O5S |
| Molar mass | 389.427 g/mol g·mol−1 |
| 3D model (JSmol) | |
| |
| (verify) | |
Cefprozil, sometimes spelled cefproxil and sold under the brand name Cefzil, is a cephalosporin type antibiotic. In Europe, it is sold by the name Procef. It can be used to treat bronchitis, ear infections, skin infections, and other bacterial infections. It comes as a tablet and as a liquid suspension.
Although there is a widely quoted cross-allergy risk of 10% between cephalosporins and penicillin, an article in the Journal of Family Practice (February 2006)[1] has shown no increased risk for cross-allergy for cefprozil and several other 2nd generation or later cephalosporins.
References
External links
 | This systemic antibiotic-related article is a stub. You can help Wikipedia by expanding it. |