Buphenine: Difference between revisions
m corrected IUPAC name, added SMILES |
Script assisted update of chemical identifiers from ChemSpider for the Chem/Drugbox validation project. |
||
| Line 2: | Line 2: | ||
| IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol |
| IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol |
||
| image = Buphenine.png |
| image = Buphenine.png |
||
| ChemSpiderID = 4407 |
|||
| InChI = 1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3 |
|||
| InChIKey = PTGXAUBQBSGPKF-UHFFFAOYAE |
|||
| CAS_number = 447-41-6 |
| CAS_number = 447-41-6 |
||
| ATC_prefix = G02 |
| ATC_prefix = G02 |
||
| Line 7: | Line 10: | ||
| PubChem = 4567 |
| PubChem = 4567 |
||
| DrugBank = |
| DrugBank = |
||
|smiles = OC(c1ccc(O)cc1)C( |
|smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C |
||
| C=19 | H=25 | N=1 | O=2 |
| C=19 | H=25 | N=1 | O=2 |
||
| molecular_weight = 299.41 g/mol |
| molecular_weight = 299.41 g/mol |
||
Revision as of 10:38, 12 January 2010
{{Drugbox | IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol | image = Buphenine.png | ChemSpiderID = 4407 | InChI = 1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3 | InChIKey = PTGXAUBQBSGPKF-UHFFFAOYAE | CAS_number = 447-41-6 | ATC_prefix = G02 | ATC_suffix = CA02 | PubChem = 4567 | DrugBank = |smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C | C=19 | H=25 | N=1 | O=2 | molecular_weight = 299.41 g/mol | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = }}
Buphenine (or nylidrin) is a sympathomimetic[1] and beta-adrenergic agonist.
References
- ^ Mittag TW, Tormay A, Messenger M, Podos SM (1985). "Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin". Invest. Ophthalmol. Vis. Sci. 26 (2): 163–9. PMID 2857689.
{{cite journal}}: Unknown parameter|month=ignored (help)CS1 maint: multiple names: authors list (link)
 | This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |