Calcium glucoheptonate: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'CASNo_Ref', 'UNII_Ref') per Chem/Drugbox validation (report errors or [[user |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID InChI1 InChIKey1 SMILES. |
||
| Line 3: | Line 3: | ||
| IUPAC_name = calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| IUPAC_name = calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
||
| image = calcium glucoheptonate.png |
| image = calcium glucoheptonate.png |
||
| CASNo_Ref = {{cascite}} |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| ChemSpiderID = 16741933 |
|||
| InChI1 = 1/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 |
|||
| InChIKey1 = FATUQANACHZLRT-DKUZMZKCBH |
|||
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
|||
| CAS_number = 29039-00-7 |
| CAS_number = 29039-00-7 |
||
| ATC_prefix = A12 |
| ATC_prefix = A12 |
||
Revision as of 10:58, 29 October 2010
 | |
| Clinical data | |
|---|---|
| ATC code | |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.044.880 |
| Chemical and physical data | |
| Formula | C14H26CaO16 |
| Molar mass | 490.425 g/mol |
| 3D model (JSmol) | |
| |
| (verify) | |
Calcium glucoheptonate is a mineral supplement.
 | This drug article relating to the gastrointestinal system is a stub. You can help Wikipedia by expanding it. |