Cefprozil: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID PubChem InChI1 InChIKey1 SMILES1. |
||
| Line 3: | Line 3: | ||
| IUPAC_name = 7-[2-amino-2-(4-hydroxyphenyl)-acetyl]amino-8-oxo-3-prop-1-enyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| IUPAC_name = 7-[2-amino-2-(4-hydroxyphenyl)-acetyl]amino-8-oxo-3-prop-1-enyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
||
| image = Cefprozil.svg |
| image = Cefprozil.svg |
||
| UNII_Ref = {{fdacite}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 1M698F4H4E |
| UNII = 1M698F4H4E |
||
| InChI = 1/C18H19N3O5S.H2O/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9;/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26);1H2/b3-2+;/t12-,13-,17-;/m1./s1 |
| InChI = 1/C18H19N3O5S.H2O/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9;/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26);1H2/b3-2+;/t12-,13-,17-;/m1./s1 |
||
| smiles = O=C2N1/C(=C(/C=C/C)CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccc(O)cc3)N)C(=O)O.O |
| smiles = O=C2N1/C(=C(/C=C/C)CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccc(O)cc3)N)C(=O)O.O |
||
| InChIKey = ALYUMNAHLSSTOU-CIRGZYLNBD |
| InChIKey = ALYUMNAHLSSTOU-CIRGZYLNBD |
||
| CASNo_Ref = {{cascite}} |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| InChI1 = 1/C18H19N3O5S.H2O/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9;/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26);1H2/b3-2-;/t12-,13-,17-;/m1./s1 |
|||
| smiles1 = O=C2N1/C(=C(/C=C\C)CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccc(O)cc3)N)C(=O)O.O |
|||
| CAS_number = 92665-29-7 |
| CAS_number = 92665-29-7 |
||
| ATC_prefix = J01 |
| ATC_prefix = J01 |
||
| ATC_suffix = DC10 |
| ATC_suffix = DC10 |
||
| ATC_supplemental = |
| ATC_supplemental = |
||
| PubChem = |
| PubChem = 9887643 |
||
| DrugBank = APRD00461 |
| DrugBank = APRD00461 |
||
| ChemSpiderID = |
| ChemSpiderID = 8063315 |
||
| C=18 | H=19 | N=3 | O=5 | S=1 |
| C=18 | H=19 | N=3 | O=5 | S=1 |
||
| molecular_weight = 389.427 g/mol |
| molecular_weight = 389.427 g/mol |
||
Revision as of 11:34, 29 October 2010
 | |
| Clinical data | |
|---|---|
| Pregnancy category |
|
| Routes of administration | ORAL |
| ATC code | |
| Pharmacokinetic data | |
| Bioavailability | 95% |
| Protein binding | 36% |
| Elimination half-life | 1.3 hours |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| DrugBank | |
| ChemSpider | |
| UNII | |
| CompTox Dashboard (EPA) | |
| Chemical and physical data | |
| Formula | C18H19N3O5S |
| Molar mass | 389.427 g/mol g·mol−1 |
| 3D model (JSmol) | |
| |
| (verify) | |
Cefprozil, sometimes spelled cefproxil and sold under the brand name Cefzil, is a second-generation cephalosporin type antibiotic. In Europe, it is sold by the name Procef and Cronocef. It can be used to treat bronchitis, ear infections, skin infections, and other bacterial infections. It comes as a tablet and as a liquid suspension.
Although there is a widely quoted cross-allergy risk of 10% between cephalosporins and penicillin, an article in the Journal of Family Practice (February 2006)[1] has shown no increased risk for cross-allergy for cefprozil and several other 2nd generation or later cephalosporins.
References
External links
 | This systemic antibiotic-related article is a stub. You can help Wikipedia by expanding it. |