D-Galacturonic acid: Difference between revisions
Content deleted Content added
Luckas-bot (talk | contribs) m robot Adding: az:Qalakturon turşusu |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID InChI1 InChIKey1 SMILES1. |
||
| Line 7: | Line 7: | ||
|OtherNames= |
|OtherNames= |
||
|Section1= {{Chembox Identifiers |
|Section1= {{Chembox Identifiers |
||
| ChemSpiderID = |
| ChemSpiderID = 76444 |
||
| InChI = 1/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6?/m0/s1 |
| InChI = 1/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6?/m0/s1 |
||
| InChIKey = AEMOLEFTQBMNLQ-YMDCURPLBW |
| InChIKey = AEMOLEFTQBMNLQ-YMDCURPLBW |
||
| InChI1 = 1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1 |
|||
| InChIKey1 = IAJILQKETJEXLJ-RSJOWCBRBL |
|||
| SMILES1 = O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O |
|||
| CASNo=685-73-4 |
| CASNo=685-73-4 |
||
| EINECS=211-682-6 |
| EINECS=211-682-6 |
||
Revision as of 13:45, 29 October 2010
| |
| Names | |
|---|---|
| IUPAC name
(2S,3R,4S,5R)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
| ECHA InfoCard | 100.035.495 |
| EC Number |
|
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C6H10O7 | |
| Molar mass | 194.139 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
D-Galacturonic acid is a sugar acid, an oxidized form of D-galactose. It is the main component of pectin, in which it exists as the polymer polygalacturonic acid. It has an aldehyde group at C1 and a carboxylic acid group at C6. Other oxidized forms of D-galactose are D-galactonic acid (carboxylic group at C1) and meso-galactaric acid (mucic acid) (carboxylic groups at C1 and C6). It is also a uronic acid or hexuronic acid. Naturally occurring uronic acids are D-glucuronic acid, D-galacturonic acid, L-iduronic acid and D-mannuronic acid.