Magnesium pidolate: Difference between revisions
Content deleted Content added
m Stub sorting and placement of stub template(s) |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID PubChem InChI1 InChIKey1 SMILES. |
||
| Line 2: | Line 2: | ||
| IUPAC_name = Magnesium 5-oxopyrrolidine-2-carboxylate |
| IUPAC_name = Magnesium 5-oxopyrrolidine-2-carboxylate |
||
| image = magnesium pidolate.png |
| image = magnesium pidolate.png |
||
| ChemSpiderID = 8014340 |
|||
| InChI1 = 1/2C5H7NO3.Mg/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/q;;+2/p-2 |
|||
| InChIKey1 = JQAACYUZYRBHGG-NUQVWONBAS |
|||
| smiles = [Mg+2].[O-]C(=O)C1NC(=O)CC1.[O-]C(=O)C1NC(=O)CC1 |
|||
| CAS_number = |
| CAS_number = |
||
| ATC_prefix = A12 |
| ATC_prefix = A12 |
||
| ATC_suffix = CC08 |
| ATC_suffix = CC08 |
||
| PubChem |
| PubChem = 9838620 |
||
| DrugBank = |
| DrugBank = |
||
| chemical_formula = C<sub>10</sub>H<sub>12</sub>N<sub>2</sub>MgO<sub>6</sub> |
| chemical_formula = C<sub>10</sub>H<sub>12</sub>N<sub>2</sub>MgO<sub>6</sub> |
||
Revision as of 16:45, 1 November 2010
 | |
| Clinical data | |
|---|---|
| ATC code | |
| Identifiers | |
| |
| PubChem CID | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.080.955 |
| Chemical and physical data | |
| Formula | C10H12N2MgO6 |
| 3D model (JSmol) | |
| |
Magnesium pidolate, the magnesium salt of pidolic acid (pyroglutamic acid), is a mineral supplement.
External links
- De Franceschi L, Bachir D, Galacteros F; et al. (2000). "Oral magnesium pidolate: effects of long-term administration in patients with sickle cell disease". Br. J. Haematol. 108 (2): 284–9. doi:10.1046/j.1365-2141.2000.01861.x. PMID 10691856.
{{cite journal}}: Explicit use of et al. in:|author=(help)CS1 maint: multiple names: authors list (link)
 | This drug article relating to the gastrointestinal system is a stub. You can help Wikipedia by expanding it. |