Proxibarbital: Difference between revisions
Content deleted Content added
حسن علي البط (talk | contribs) m Removed Category:Sedatives; Adding category Category:Alkenes (using HotCat) |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID InChI1 InChIKey1 SMILES. |
||
| Line 3: | Line 3: | ||
| image = Proxibarbital.svg |
| image = Proxibarbital.svg |
||
| width = 120 |
| width = 120 |
||
| ChemSpiderID = 16406 |
|||
| InChI1 = 1/C10H14N2O4/c1-3-4-10(5-6(2)13)7(14)11-9(16)12-8(10)15/h3,6,13H,1,4-5H2,2H3,(H2,11,12,14,15,16) |
|||
| InChIKey1 = VNLMRPAWAMPLNZ-UHFFFAOYAU |
|||
| smiles = O=C1NC(=O)NC(=O)C1(CC(O)C)C\C=C |
|||
| CAS_number = 2537-29-3 |
| CAS_number = 2537-29-3 |
||
| synonyms = Proxibarbital, Centralgol, Ipronal, 5-Allyl-5-(β-hydroxypropyl)barbituric acid |
| synonyms = Proxibarbital, Centralgol, Ipronal, 5-Allyl-5-(β-hydroxypropyl)barbituric acid |
||
Revision as of 13:41, 6 November 2010
 | |
| Clinical data | |
|---|---|
| Other names | Proxibarbital, Centralgol, Ipronal, 5-Allyl-5-(β-hydroxypropyl)barbituric acid |
| ATC code | |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.018.004 |
| Chemical and physical data | |
| Formula | C10H14N2O4 |
| Molar mass | 226.229 g/mol g·mol−1 |
| 3D model (JSmol) | |
| |
Proxibarbital (Ipronal) is a barbiturate derivative invented in the 1970s. It has sedative, hypnotic and anticonvulsant properties, and was used in the treatment of migraine headaches in a similar manner to butalbital.[1]
References
- ^ Sulman FG, Pfeifer Y, Tal E. Migraine therapy by enzyme induction with proxibarbital (German). Therapie die Gegenwart. 1976 Dec;115(12):2088-103.
 | This sedative-related article is a stub. You can help Wikipedia by expanding it. |