Rubrocurcumin: Difference between revisions
Content deleted Content added
Added CSID, (std)InChI, and (std)InChIkey for two forms |
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi |
||
| Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| verifiedrevid = 403197803 |
|||
| ImageFile = Rubrocurcumin.png |
| ImageFile = Rubrocurcumin.png |
||
| ImageSize = 300px |
| ImageSize = 300px |
||
| Line 6: | Line 7: | ||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| CASNo = 12098-66-7 |
| CASNo = 12098-66-7 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| |
| ChemSpiderID = 24751750 |
||
| ChemSpiderID_Comment = Non-charged form |
| ChemSpiderID_Comment = Non-charged form |
||
| ChemSpiderID1 = 24751749 |
| ChemSpiderID1 = 24751749 |
||
| ChemSpiderID1_Comment = Charged form |
| ChemSpiderID1_Comment = Charged form |
||
| SMILES = B1(OC(=O)C(=O)O1)O/C(=C\C(=O)/C=C/c2ccc(c(c2)OC)O)/C=C/c3ccc(c(c3)OC)O |
| SMILES = B1(OC(=O)C(=O)O1)O/C(=C\C(=O)/C=C/c2ccc(c(c2)OC)O)/C=C/c3ccc(c(c3)OC)O |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| |
| StdInChI = 1S/C23H19BO10/c1-30-20-11-14(5-9-18(20)26)3-7-16(25)13-17(32-24-33-22(28)23(29)34-24)8-4-15-6-10-19(27)21(12-15)31-2/h3-13,26-27H,1-2H3/b7-3+,8-4+,17-13- |
||
| StdInChI_Comment = Non-charged form |
| StdInChI_Comment = Non-charged form |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey =CSMMVHRUFPYHCS-YRLHZMKXSA-N |
| StdInChIKey =CSMMVHRUFPYHCS-YRLHZMKXSA-N |
||
| StdInChIKey_Comment = Non-charged form |
| StdInChIKey_Comment = Non-charged form |
||
Revision as of 17:09, 19 December 2010
| |
| Names | |
|---|---|
| Other names
Rubrocurcumin
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C23H19BO10 | |
| Molar mass | 466.19 g/mol |
| Appearance | red solid |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Rubrocurcumin is a red colored dye that is formed by the reaction of curcumin and borates.
Synthesis
The reaction of curcumin with borates in presence of oxalic acid produces rubrocurcumin.[1]
Characteristics
Rubrocurcumin produces a red colored solution.
Rubrocurcumin is a neutrally charged composition, while rosocyanine is build from ions. In rubrocurcumin, one molecule curcumin is replaced with oxalate compared to rosocyanine.
Complexes with boron such as rubrocurcumin are called 1,3,2-dioxaborines.[1]
Literature
- G. S. Spicer, J. D. H. Strickland: Compounds of curcumin and boric acid. Part II. The structure of rubrocurcumin. Journal of the Chemical Society, London 1952, p. 4650–4653
References
- ^ a b Dirk Rohde: Darstellung und Eigenschaftsuntersuchungen an 1,3,2-Dioxaborinen mit variablen Coliganden am Boratom. Dissertation, 2002