Buphenine: Difference between revisions
No edit summary |
No edit summary |
||
| Line 1: | Line 1: | ||
{{ |
{{drugbox |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 695DKH33EI |
|||
| IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol |
| IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol |
||
| image = Buphenine.png |
| image = Buphenine.png |
||
Revision as of 00:23, 1 July 2011
{{drugbox
| UNII_Ref = 
| UNII = 695DKH33EI
| IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol
| image = Buphenine.png
| ChemSpiderID = 4407
| InChI = 1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3
| InChIKey = PTGXAUBQBSGPKF-UHFFFAOYAE
| CAS_number = 447-41-6
| ATC_prefix = G02
| ATC_suffix = CA02
| PubChem = 4567
| ChEMBL_Ref =
| ChEMBL = 114655
| DrugBank =
|smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C
| C=19 | H=25 | N=1 | O=2
| molecular_weight = 299.41 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category=
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
}}
Buphenine (or nylidrin) is a sympathomimetic[1] and beta-adrenergic agonist.
References
- ^ Mittag TW, Tormay A, Messenger M, Podos SM (1985). "Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin". Invest. Ophthalmol. Vis. Sci. 26 (2): 163–9. PMID 2857689.
{{cite journal}}: Unknown parameter|month=ignored (help)CS1 maint: multiple names: authors list (link)
 | This drug article relating to the cardiovascular system is a stub. You can help Wikipedia by expanding it. |
 | This drug article relating to the genito-urinary system is a stub. You can help Wikipedia by expanding it. |