Jump to content

Oligomycin: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous editNext edit →
Content deleted Content added
VisualWikitext
m Bot: Migrating 1 interwiki links, now provided by Wikidata on d:Q1076381
fix double parameter in Chembox, per CAT:DUPARG. (Use temperature conversion calc. m: check symbol formatting; regular ws; rm setting image dflt) using AWB
Line 1: Line 1:
{{chembox
{{Chembox
| verifiedrevid = 432936619
| verifiedrevid = 432936619
| Name = Oligomycin A
| Name = Oligomycin A
Line 6: Line 6:
| IUPACName_hidden = yes
| IUPACName_hidden = yes
| OtherNames = Oligomycin
| OtherNames = Oligomycin
|C=45|H=74|O=11
| C=45|H=74|O=11
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| Abbreviations =
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 23: Line 23:
| PubChem = 6450197
| PubChem = 6450197
| SMILES = C[C@](C)(O)C[C@H]1O[C@@]2(CC[C@H]1C)O[C@H]3CC[C@@H](CC)/C=C\C=C\C[C@H](C)[C@H](O)[C@](C)(O)C(=O)[C@H](C)[C@@H](O)[C@H](C)C(=O)[C@@H](C)[C@H](O)[C@H](C)/C=C/C(=O)O[C@H]([C@H]2C)[C@H]3C
| SMILES = C[C@](C)(O)C[C@H]1O[C@@]2(CC[C@H]1C)O[C@H]3CC[C@@H](CC)/C=C\C=C\C[C@H](C)[C@H](O)[C@](C)(O)C(=O)[C@H](C)[C@@H](O)[C@H](C)C(=O)[C@@H](C)[C@H](O)[C@H](C)/C=C/C(=O)O[C@H]([C@H]2C)[C@H]3C
| InChI =
| InChISECOND =
| RTECS = RK3325000
| RTECS = RK3325000
| ChEBI =
| ChEBI =
| MeSHName = Oligomycins
| MeSHName = Oligomycins
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = }}
| KEGG =
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| MolarMass = 791.062 g/mol
| MolarMass = 791.062 g/mol
| Appearance =
| Appearance =
Line 44: Line 45:
| RefractIndex =
| RefractIndex =
| Viscosity =
| Viscosity =
}}
| Dipole = }}
| Section3 = {{Chembox Structure
|Section3={{Chembox Structure
| CrystalStruct =
| CrystalStruct =
| Coordination =
| Coordination =
| MolShape =
| MolShape =
| Dipole = }}
| Dipole =
}}
| Section4 = {{Chembox Thermochemistry
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHf =
| DeltaHc =
| DeltaHc =
| Entropy =
| Entropy =
| HeatCapacity = }}
| HeatCapacity =
}}
| Section5 = {{Chembox Pharmacology
|Section5={{Chembox Pharmacology
| ATCCode =
| ATCCode =
| Bioavail =
| Bioavail =
Line 62: Line 65:
| Excretion =
| Excretion =
| PregCat =
| PregCat =
| AdminRoutes = }}
| AdminRoutes =
}}
| Section6 = {{Chembox Explosive
|Section6={{Chembox Explosive
| ShockSens =
| ShockSens =
| FrictionSens =
| FrictionSens =
| ExplosiveV =
| ExplosiveV =
| REFactor = }}
| REFactor =
}}
| Section7 = {{Chembox Hazards
|Section7={{Chembox Hazards
| ExternalMSDS = [http://www.fermentek.co.il/MSDS/oligomycin-MSDS.htm MSDS at Fermentek]
| ExternalMSDS = [http://www.fermentek.co.il/MSDS/oligomycin-MSDS.htm MSDS at Fermentek]
| EUClass =
| EUClass =
Line 75: Line 80:
| NFPA-F =
| NFPA-F =
| NFPA-R =
| NFPA-R =
| NFPA-O =
| NFPA-O =
| RPhrases =
| RPhrases =
| SPhrases =
| SPhrases =
| RSPhrases =
| RSPhrases =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
| ExploLimits =
| ExploLimits =
| PEL = }}
| PEL =
}}
| Section8 = {{Chembox Supplement}}
|Section9={{Chembox Related
| Section9 = {{Chembox Related
| OtherAnions =
| OtherAnions =
| OtherCations =
| OtherCations =
| OtherFunctn =
| OtherFunctn =
| Function =
| Function =
| OtherCpds = }}
| OtherCpds =
}}
}}
}}


Revision as of 18:02, 26 November 2014

Oligomycin A
Names
IUPAC name
(1R,4E,5'S,6S,6'S,7R,8S,10R,11R,12S,14R,15S,16R,18E,20E,22R,25S,27R,28S,29R)-22-ethyl-7,11,14,15-tetrahydroxy-6'-[(2R)-2-hydroxypropyl]-5',6,8,10,12,14,16,28,29-nonamethyl-3',4',5',6'-tetrahydro-3H,9H,13H-spiro[2,26-dioxabicyclo[23.3.1]nonacosa-4,18,20-triene-27,2'-pyran]-3,9,13-trione
Other names
Oligomycin
Identifiers
3D model (JSmol)
ChemSpider
ECHA InfoCard 100.014.334 Edit this at Wikidata
EC Number
  • 215-767-9
MeSH Oligomycins
RTECS number
  • RK3325000
  • InChI=1S/C46H76O11/c1-13-34-18-16-14-15-17-28(4)42(51)45(12,54)43(52)32(8)40(50)31(7)39(49)30(6)38(48)27(3)19-22-37(47)55-41-29(5)35(21-20-34)56-46(33(41)9)24-23-26(2)36(57-46)25-44(10,11)53/h14-16,18-19,22,26-36,38,40-42,48,50-51,53-54H,13,17,20-21,23-25H2,1-12H3/b15-14+,18-16-,22-19+/t26-,27-,28+,29+,30+,31-,32-,33-,34+,35?,36-,38-,40+,41+,42+,45+,46-/m1/s1 checkY
    Key: QBAMBSAJEFIQBK-GJHUHQBXSA-N checkY
  • InChI=1S/C46H76O11/c1-13-34-18-16-14-15-17-28(4)42(51)45(12,54)43(52)32(8)40(50)31(7)39(49)30(6)38(48)27(3)19-22-37(47)55-41-29(5)35(21-20-34)56-46(33(41)9)24-23-26(2)36(57-46)25-44(10,11)53/h14-16,18-19,22,26-36,38,40-42,48,50-51,53-54H,13,17,20-21,23-25H2,1-12H3/b15-14+,18-16-,22-19+/t26-,27-,28+,29+,30+,31-,32-,33-,34+,35?,36-,38-,40+,41+,42+,45+,46-/m1/s1
    Key: QBAMBSAJEFIQBK-GJHUHQBXBC
  • Key: QBAMBSAJEFIQBK-GJHUHQBXSA-N
  • C[C@](C)(O)C[C@H]1O[C@@]2(CC[C@H]1C)O[C@H]3CC[C@@H](CC)/C=C\C=C\C[C@H](C)[C@H](O)[C@](C)(O)C(=O)[C@H](C)[C@@H](O)[C@H](C)C(=O)[C@@H](C)[C@H](O)[C@H](C)/C=C/C(=O)O[C@H]([C@H]2C)[C@H]3C
Properties
Molar mass 791.062 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
checkY verify (what is checkY☒N ?)

Oligomycins are macrolides created by Streptomyces that can be poisonous to other organisms.

Function

They have use as antibiotics.

Oligomycin A is an inhibitor of ATP synthase. In oxidative phosphorylation research, it is used to prevent state 3 (phosphorylating) respiration. Oligomycin A inhibits ATP synthase by blocking its proton channel (Fo subunit), which is necessary for oxidative phosphorylation of ADP to ATP (energy production). The inhibition of ATP synthesis by oligomycin A will significantly reduce electron flow through the electron transport chain; however, electron flow is not stopped completely due to a process known as proton leak or mitochondrial uncoupling.[1] This process is due to the facilitated diffusion of protons into the mitochondrial matrix through an uncoupling protein such as thermogenin, or UCP1.

Administering oligomycin to an individual can result in very high levels of lactate accumulating in the blood and urine.[citation needed]

Oligomycins[2]
  R1 R2 R3 R4 R5
Oligomycin A CH3 H OH H,H CH3
Oligomycin B CH3 H OH O CH3
Oligomycin C CH3 H H H,H CH3
Oligomycin D
(Rutamycin A) 		H H OH H,H CH3
Oligomycin E CH3 OH OH O CH3
Oligomycin F CH3 H OH H,H CH2CH3
Rutamycin B H H H H,H CH3
44-Homooligomycin A CH2CH3 H OH H,H CH3
44-Homooligomycin B CH2CH3 H OH O CH3

References

  1. ^ Jastroch M, Divakaruni AS, Mookerjee S, Treberg JR, Brand MD (2010). "Mitochondrial proton and electron leaks". Essays in biochemistry (47): 53–67. doi:10.1042/bse0470053. PMID 20533900.{{cite journal}}: CS1 maint: multiple names: authors list (link)
  2. ^ Nakata, Masaya; Ishiyama, Takashi; Akamatsu, Shinichi; Hirose, Youichi; Maruoka, Hiroshi; Suzuki, Rika; Tatsuta, Kuniaki (1995). "Synthetic studies on oligomycins. Synthesis of the oligomycin B spiroketal and polypropionate portions". Bulletin of the Chemical Society of Japan. 68 (3): 967–89. doi:10.1246/bcsj.68.967.{{cite journal}}: CS1 maint: multiple names: authors list (link)
Retrieved from "https://en.wikipedia.org/enwiki/w/index.php?title=Oligomycin&oldid=635537825"