Rubrocurcumin: Difference between revisions
Content deleted Content added
Tom.Reding (talk | contribs) m WP:GenFixes, WP:AWB/Typos, ref cleanup, parse authN/edN, cmn/reflist|2/3 (depr.)->30/20em, LMR☉⊕J/up using AWB |
m Chembox: rm/replace deprecated params. Fix unknown parameters (via AWB script) |
||
| Line 5: | Line 5: | ||
| IUPACName = |
| IUPACName = |
||
| OtherNames = Rubrocurcumin |
| OtherNames = Rubrocurcumin |
||
| |
|Section1={{Chembox Identifiers |
||
| |
| CASNo = 12098-66-7 |
||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 24751750 |
| ChemSpiderID = 24751750 |
||
| |
| ChemSpiderID_Comment = Non-charged form |
||
| |
| ChemSpiderID1 = 24751749 |
||
| |
| ChemSpiderID1_Comment = Charged form |
||
| |
| SMILES = B1(OC(=O)C(=O)O1)O/C(=C\C(=O)/C=C/c2ccc(c(c2)OC)O)/C=C/c3ccc(c(c3)OC)O |
||
| |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C23H19BO10/c1-30-20-11-14(5-9-18(20)26)3-7-16(25)13-17(32-24-33-22(28)23(29)34-24)8-4-15-6-10-19(27)21(12-15)31-2/h3-13,26-27H,1-2H3/b7-3+,8-4+,17-13- |
| StdInChI = 1S/C23H19BO10/c1-30-20-11-14(5-9-18(20)26)3-7-16(25)13-17(32-24-33-22(28)23(29)34-24)8-4-15-6-10-19(27)21(12-15)31-2/h3-13,26-27H,1-2H3/b7-3+,8-4+,17-13- |
||
| |
| StdInChI_Comment = Non-charged form |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey =CSMMVHRUFPYHCS-YRLHZMKXSA-N |
| StdInChIKey =CSMMVHRUFPYHCS-YRLHZMKXSA-N |
||
| |
| StdInChIKey_Comment = Non-charged form |
||
| |
| StdInChI1 = 1S/C23H19BO10/c1-29-20-11-14(5-9-18(20)25)3-7-16-13-17(32-24(31-16)33-22(27)23(28)34-24)8-4-15-6-10-19(26)21(12-15)30-2/h3-13,25-26H,1-2H3/b7-3+,8-4+ |
||
| |
| StdInChI1_Comment = Charged form |
||
| |
| StdInChIKey1 = YIFZXJZUXMHJJG-FCXRPNKRSA-N |
||
| |
| StdInChIKey1_Comment = Charged form |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| |
| Formula = C<sub>23</sub>H<sub>19</sub>BO<sub>10</sub> |
||
| |
| MolarMass = 466.19 g/mol |
||
| |
| Appearance = red solid |
||
| |
| Density = |
||
| |
| MeltingPt = |
||
| |
| BoilingPt = |
||
| |
| Solubility = |
||
}} |
}} |
||
| |
|Section3={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| FlashPt = |
||
| |
| AutoignitionPt = |
||
}} |
}} |
||
}} |
}} |
||
Revision as of 18:29, 7 July 2015
| |
| Names | |
|---|---|
| Other names
Rubrocurcumin
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C23H19BO10 | |
| Molar mass | 466.19 g/mol |
| Appearance | red solid |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Rubrocurcumin is a red colored dye that is formed by the reaction of curcumin and borates.
Synthesis
The reaction of curcumin with borates in presence of oxalic acid produces rubrocurcumin.[1]
Characteristics
Rubrocurcumin produces a red colored solution.
Rubrocurcumin is a neutrally charged composition, while rosocyanine is build from ions. In rubrocurcumin, one molecule curcumin is replaced with oxalate compared to rosocyanine.
Complexes with boron such as rubrocurcumin are called 1,3,2-dioxaborines.[1]
Literature
- Spicer, G. S.; Strickland, J. D. H. (1952). "Compounds of Curcumin and Boric Acid. Part II. The Structure of Rubrocurcumin". Journal of the Chemical Society. 1952 (article 907). London: 4650–4653. doi:10.1039/JR9520004650.
References
- ^ a b Rohde, D. (2002). "Darstellung und Eigenschaftsuntersuchungen an 1,3,2-Dioxaborinen mit variablen Coliganden am Boratom (Dissertation)". University Halle.