Buphenine: Difference between revisions
m Remove redundant parameters InChI, InChIKey (StdInChI, StdInChIKey are used). See Talk (via AWB script) |
Tom.Reding (talk | contribs) m CS1 maintenance: vauthors/veditors or enumerate multiple authors/editors; WP:GenFixes on using AWB |
||
| Line 42: | Line 42: | ||
}} |
}} |
||
'''Buphenine''' (or '''nylidrin''') is a [[Beta2-adrenergic agonist|β<sub>2</sub> adrenoreceptor agonist]]<ref name="pmid2857689">{{cite journal | |
'''Buphenine''' (or '''nylidrin''') is a [[Beta2-adrenergic agonist|β<sub>2</sub> adrenoreceptor agonist]]<ref name="pmid2857689">{{cite journal |vauthors=Mittag TW, Tormay A, Messenger M, Podos SM |title=Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin |journal=Invest. Ophthalmol. Vis. Sci. |volume=26 |issue=2 |pages=163–9 |date=February 1985 |pmid=2857689 |doi= |url=http://www.iovs.org/cgi/pmidlookup?view=long&pmid=2857689}}</ref> that acts as a [[vasodilator]]. |
||
==References== |
==References== |
||
| Line 55: | Line 55: | ||
[[Category:Phenethylamines]] |
[[Category:Phenethylamines]] |
||
[[Category:Phenols]] |
[[Category:Phenols]] |
||
{{cardiovascular-drug-stub}} |
{{cardiovascular-drug-stub}} |
||
Revision as of 19:34, 25 May 2016
{{Drugbox | IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol | image = Buphenine.svg
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 447-41-6
| ATC_prefix = C04
| ATC_suffix = AA02
| ATC_supplemental = G02CA02 (WHO)
| PubChem = 4567
| DrugBank =
| ChemSpiderID = 4407
| UNII_Ref = 
| UNII = 695DKH33EI
| ChEMBL_Ref =
| ChEMBL = 114655
| C=19 | H=25 | N=1 | O=2 | molecular_weight = 299.41 g/mol | smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C }}
Buphenine (or nylidrin) is a β2 adrenoreceptor agonist[1] that acts as a vasodilator.
References
- ^ Mittag TW, Tormay A, Messenger M, Podos SM (February 1985). "Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin". Invest. Ophthalmol. Vis. Sci. 26 (2): 163–9. PMID 2857689.
 | This drug article relating to the cardiovascular system is a stub. You can help Wikipedia by expanding it. |
 | This drug article relating to the genito-urinary system is a stub. You can help Wikipedia by expanding it. |