Acetylglycinamide chloral hydrate: Difference between revisions
Content deleted Content added
m Infobox drug for type=combo: rm input for single-chemical. talk (via JWB) |
|||
| Line 3: | Line 3: | ||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = 447909838 |
| verifiedrevid = 447909838 |
||
<!--Combo data--> |
<!--Combo data--> |
||
| type = combo |
| type = combo |
||
| Line 10: | Line 9: | ||
| component2 = Chloral hydrate |
| component2 = Chloral hydrate |
||
| class2 = [[sedative]]/[[hypnotic]] |
| class2 = [[sedative]]/[[hypnotic]] |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Line 22: | Line 20: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| Line 33: | Line 30: | ||
| DrugBank = |
| DrugBank = |
||
| ChemSpiderID = |
| ChemSpiderID = |
||
<!-- Chemical data --> |
<!-- Chemical data --> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=6 | H=10 | Ag= | Al= | As= | Au= | B= | Bi= | Br= | Ca= | Cl=1 | Co= | F= | Fe= | Gd= | I= |
|||
| K= | Li= | Mg= | Mn= | N=1 | Na= | O=5 | P= | Pt= | S= | Sb= | Se= | Sr= | Tc= | Zn= | charge= |
|||
| molecular_weight = 282.5063 |
|||
| smiles = CC(=O)NCC(=O)O.C(C(Cl)(Cl)Cl)(O)O |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C4H7NO3.C2H3Cl3O2/c1-3(6)5-2-4(7)8;3-2(4,5)1(6)7/h2H2,1H3,(H,5,6)(H,7,8);1,6-7H |
|||
| StdInChI_comment = |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = SULCNWZLMZPENK-UHFFFAOYSA-N |
|||
| density = |
|||
| melting_point = |
|||
| melting_high = |
|||
| melting_notes = |
|||
| boiling_point = |
|||
| boiling_notes = |
|||
| solubility = |
|||
| specific_rotation = |
|||
| sec_combustion = |
|||
}} |
}} |
||
Revision as of 12:41, 21 November 2016
| Combination of | |
|---|---|
| N-Acetylglycinamide | glycine derivative |
| Chloral hydrate | sedative/hypnotic |
| Clinical data | |
| ATC code | |
| Identifiers | |
| CAS Number | |
| PubChem CID | |
| CompTox Dashboard (EPA) | |
  (what is this?) (verify) | |
Acetylglycinamide chloral hydrate is a hypnotic/sedative. It is a combination of acetylglycinamide and chloral hydrate.[1]
References
- ^ Degerholm, E.; Harison, A.; Leideman, T.; Sterner, N. (1963). "Acetylglycinamide chloral hydrate, a new compound". Farmacevtisk Revy. 62 (29): 601–611.
 | This sedative-related article is a stub. You can help Wikipedia by expanding it. |