Calcium glucoheptonate: Difference between revisions
Content deleted Content added
m Remove redundant parameters InChI, InChIKey (StdInChI, StdInChIKey are used). See Talk (via AWB script) |
Remove malformatted |molecular_weight= when infobox can autocalculate it, per Wikipedia talk:WikiProject Pharmacology#Molecular weights in drugboxes (via WP:JWB) |
||
| Line 37: | Line 37: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=14 | H=26 | Ca=1 | O=16 |
| C=14 | H=26 | Ca=1 | O=16 |
||
| molecular_weight = 490.425 g/mol |
|||
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
Revision as of 15:00, 21 June 2020
 | |
| Clinical data | |
|---|---|
| AHFS/Drugs.com | International Drug Names |
| ATC code | |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| DrugBank | |
| ChemSpider | |
| UNII | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.044.880 |
| Chemical and physical data | |
| Formula | C14H26CaO16 |
| Molar mass | 490.424 g·mol−1 |
| 3D model (JSmol) | |
| |
| |
  (what is this?) (verify) | |
Calcium glucoheptonate is a mineral supplement.
 | This drug article relating to the gastrointestinal system is a stub. You can help Wikipedia by expanding it. |