Odanacatib
{{Drugbox | Verifiedfields = changed | verifiedrevid = 443444475 | IUPAC_name = N-(1-cyanocyclopropyl)-4-fluoro-N2-{(1S)-2,2,2-trifluoro-1-[4'-(methylsulfonyl)biphenyl-4-yl]ethyl}-L-leucinamide | image = Odanacatib Structural Formulae V.1.svg
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = oral
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = 
| CAS_number = 603139-19-1
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 10152654
| DrugBank_Ref =
| DrugBank =
| UNII_Ref =
| UNII = N673F6W2VH
| ChEMBL_Ref = 
| ChEMBL = 481611
| ChemSpiderID_Ref =
| ChemSpiderID = 8328162
| chemical_formula =
| C=25 | H=27 | F=4 | N=3 | O=3 | S=1
| molecular_weight = 525.56 g/mol
| smiles = CC(C)(CC(C(=O)NC1(CC1)C#N)NC(C2=CC=C(C=C2)C3=CC=C(C=C3)S(=O)(=O)C)C(F)(F)F)F
| InChI = 1/C25H27F4N3O3S/c1-23(2,26)14-20(22(33)32-24(15-30)12-13-24)31-21(25(27,28)29)18-6-4-16(5-7-18)17-8-10-19(11-9-17)36(3,34)35/h4-11,20-21,31H,12-14H2,1-3H3,(H,32,33)/t20-,21-/m0/s1
| InChIKey = FWIVDMJALNEADT-SFTDATJTBA
| StdInChI_Ref =
| StdInChI = 1S/C25H27F4N3O3S/c1-23(2,26)14-20(22(33)32-24(15-30)12-13-24)31-21(25(27,28)29)18-6-4-16(5-7-18)17-8-10-19(11-9-17)36(3,34)35/h4-11,20-21,31H,12-14H2,1-3H3,(H,32,33)/t20-,21-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = FWIVDMJALNEADT-SFTDATJTSA-N
| synonyms = (2S)-N-(1-cyanocyclopropyl)-4-fluoro-4-methyl-2-{[(1S)-2,2,2-trifluoro-1-{4'-(methanesulfonyl)-[1,1'-biphenyl]-4-yl}ethyl]amino}pentanamide
}}
Odanacatib (pINN; codenamed MK-0822) is an investigational treatment for osteoporosis and bone metastasis.[1] It is an inhibitor of cathepsin K,[2] an enzyme involved in bone resorption.
It is being developed by Merck & Co.. The phase III clinical trial for this compound was stopped early after a review showed it was highly effective and had a good safety profile. It is expected Merck will apply for approval by mid-2013. J.P. Morgan's analysis suggests it will bring a billion a year in sales by 2017.[3]
This drug was developed at Merck Frosst in Montreal.
References
- ^ PMID 18685424
- ^ Gauthier JY, Chauret N, Cromlish W; et al. (2008). "The discovery of odanacatib (MK-0822), a selective inhibitor of cathepsin K". Bioorg. Med. Chem. Lett. 18 (3): 923–8. doi:10.1016/j.bmcl.2007.12.047. PMID 18226527.
{{cite journal}}: Explicit use of et al. in:|author=(help); Unknown parameter|month=ignored (help)CS1 maint: multiple names: authors list (link) - ^ "Has Merck Found The Heir To Fosamax?". Forbes. 2012-07-11. Retrieved 2012-09-23.
 | This drug article relating to the musculoskeletal system is a stub. You can help Wikipedia by expanding it. |