Trinitrotriazine

Trinitrotriazine
Names
	IUPAC name 2,4,6-Trinitro-1,3,5-triazine
Identifiers
CAS Number	140218-59-3;
3D model (JSmol)	Interactive image;
CompTox Dashboard (EPA)	DTXSID10621341 ;
	SMILES O=[N+]([O-])C1=NC([N+]([O-])=O)=NC([N+]([O-])=O)=N1;
Properties
Chemical formula	C3N6O6
Molar mass	216.07
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Trinitrotriazine, or 2,4,6-trinitro-1,3,5-triazine, is a potential explosive. It can be made by reacting 1,3,5-triazine (or s-triazine) with nitric acid and a sulfuric acid catalyst:

C₃H₃N₃ + 3 HNO₃ → C₃N₃(NO₂)₃ + 3 H₂O

It has a perfect oxygen balance, potentially making it a very powerful explosive:

C₃N₃(NO₂)₃ → 3 CO₂ + 3 N₂

This explosives-related article is a stub. You can help Wikipedia by expanding it.