Caesium bicarbonate

Caesium bicarbonate
Names
	IUPAC name Caesium bicarbonate
Identifiers
CAS Number	15519-28-5;
3D model (JSmol)	Interactive image;
ChemSpider	2006316;
ECHA InfoCard	100.035.943
PubChem CID	2724157;
CompTox Dashboard (EPA)	DTXSID70165852 ;
	InChI InChI=1S/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 Key: ZMCUDHNSHCRDBT-UHFFFAOYSA-M; InChI=1/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 Key: ZMCUDHNSHCRDBT-REWHXWOFAQ;
	SMILES [Cs+].[O-]C(=O)O;
Properties
Chemical formula	CHCsO3
Molar mass	193.922 g/mol
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Caesium bicarbonate is a chemical compound with the chemical formula CsHCO₃. It can be produced through the following reaction:

Cs₂CO₃ + CO₂ + H₂O → 2CsHCO₃

The compound can be used for synthesizing caesium salts, but less common than caesium bicarbonate.

References

Weast, Robert C., ed. (1981). CRC Handbook of Chemistry and Physics (62nd ed.). Boca Raton, FL: CRC Press. p. B-91. ISBN 0-8493-0462-8..