Petroselinic acid
| Petroselinic acid | |
| Names | |
|---|---|
| IUPAC name
(6Z)-Octadec-6-enoic acid
| |
| Other names
(6Z)-Octadecenoic acid
(Z)-Octadec-6-enoic acid cis-6-Octadecenoic acid cis-Δ96/sup>-Octadecenoic acid Petroselinic acid 18:1 cis-6 | |
| Identifiers | |
3D model (JSmol)
|
|
| ECHA InfoCard | 100.008.901 |
CompTox Dashboard (EPA)
|
|
| |
| Properties | |
| C18H34O2 | |
| Molar mass | 282.468 g·mol−1 |
| Appearance | White powder |
| Insoluble | |
| Solubility in methanol | Soluble |
| Hazards | |
| NFPA 704 (fire diamond) | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Petroselinic acid is a fatty acid that occurs naturally in several animal and vegetable fats and oils. It is an white powder and commercially available. In chemical terms, petroselinic acid is classified as a monounsaturated omega-6 fatty acid, abbreviated with a lipid number of 18:1 cis-6. It has the formula CH3(CH2)10CH=CH(CH2)4COOH. The term "petroselinic" means related to, or derived from, oil of Petroselinum, parsley. Petroselinic acid is a naturally occuring isomer of oleic acid.
Occurrence
Fatty acids mostly occur as their esters, commonly the triglycerides, which are the greasy materials in many natural oils. Via the process of saponification, the fatty acids can be obtained.
Production and chemical behavior
The trans isomer of petroselinic acid is called petroselaidic acid.