Pramiconazole

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 366890982 | IUPAC_name = 1-{4-[4-(4-{[(2R,4S)-2-(2,4-difluorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one | image = Pramiconazole.png | width = | image2 = | width2 = | drug_name =

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | index0 = | index2 = | CAS_number_Ref =  ^Y | CAS_number = | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem2 = 11411233 | PubChem = 3013050 | DrugBank_Ref =  ^Y | DrugBank = | UNII_Ref =  ^N | UNII = 4SYH0R661F | ChEMBL_Ref =  ^N | ChEMBL = 175797 | ChemSpiderID_Ref =  ^N | ChemSpiderID = 2281806 | chemical_formula = | C=35 | H=39 | F=2 | N=7 | O=4 | molecular_weight = 659.725 g/mol | SMILES = CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F | StdInChI_Ref =  ^N | StdInChI = 1S/C35H39F2N7O4/c1-25(2)43-17-18-44(34(43)45)29-6-4-27(5-7-29)40-13-15-41(16-14-40)28-8-10-30(11-9-28)46-20-33-47-22-35(48-33,21-42-24-38-23-39-42)31-12-3-26(36)19-32(31)37/h3-12,19,23-25,33H,13-18,20-22H2,1-2H3/t33-,35+/m0/s1 | StdInChIKey_Ref =  ^N | StdInChIKey = AEKNYBWUEYNWMJ-QWOOXDRHSA-N }}

Pramiconazole is a triazole antifungal undergoing research for the treatment of acute skin and mucosal fungal infections.

It is developed by Barrier Therapeutics.