Page namespace (page_namespace) | 0 |
Page title without namespace (page_title) | 'D-Galacturonic acid' |
Full page title (page_prefixedtitle) | 'D-Galacturonic acid' |
Old content model (old_content_model) | 'wikitext' |
New content model (new_content_model) | 'wikitext' |
Old page wikitext, before the edit (old_wikitext) | '{{DISPLAYTITLE:<small>D</small>-Galacturonic acid}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 464362073
| Name =<small>D</small>-Galacturonic acid
| ImageFile =Galacturonic_acid.png
| ImageSize =180px
| IUPACName =(''2S,3R,4S,5R'')-2,3,4,5-tetrahydroxy-6-oxo-hexanoic acid
| OtherNames =
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 76444
| InChI = 1/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6?/m0/s1
| InChIKey = AEMOLEFTQBMNLQ-YMDCURPLBW
| InChI1 = 1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1
| InChIKey1 = IAJILQKETJEXLJ-RSJOWCBRBL
| SMILES1 = O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IAJILQKETJEXLJ-RSJOWCBRSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 685-73-4
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = CEP8I6411H
| EINECS =211-682-6
| PubChem =84740
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 4153
| SMILES = O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O
}}
|Section2={{Chembox Properties
| Formula =C<sub>6</sub>H<sub>10</sub>O<sub>7</sub>
| MolarMass =194.139
| Appearance =
| Density =
| MeltingPtC = 159
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
'''D-Galacturonic acid''' is a sugar acid, an oxidized form of [[galactose|<small>D</small>-galactose]]. It is the main component of [[pectin]], in which it exists as the polymer [[polygalacturonic acid]].<ref>Debra Mohnen "Pectin structure and biosynthesis" Current Opinion in Plant Biology 2008, 11:266–277.
{{DOI|10.1016/j.pbi.2008.03.006}}.</ref> In its open form, it has an [[aldehyde]] group at C1 and a [[carboxylic acid]] group at C6. Other oxidized forms of <small>D</small>-galactose are <small>D</small>-galactonic acid (carboxylic group at C1) and ''meso''-galactaric acid ([[mucic acid]]) (carboxylic groups at C1 and C6). It is also a [[uronic acid]] or hexuronic acid. Naturally occurring uronic acids are <small>D</small>-[[glucuronic acid]], <small>D</small>-galacturonic acid, <small>L</small>-[[iduronic acid]] and <small>D</small>-[[mannuronic acid]].
==References==
<references />
{{DEFAULTSORT:Galacturonic acid, D-}}
[[Category:Uronic acids]]' |
New page wikitext, after the edit (new_wikitext) | '{{DISPLAYTITLE:<small>D</small>-Galacturonic acid}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 464362073
| Name =<small>D</small>-Galacturonic acid
| ImageFile =Galacturonic_acid.png
| ImageSize =180px
| IUPACName =(''2S,3R,4S,5R'')-2,3,4,5-tetrahydroxy-6-oxo-hexanoic acid
| OtherNames =
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 76444
| InChI = 1/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6?/m0/s1
| InChIKey = AEMOLEFTQBMNLQ-YMDCURPLBW
| InChI1 = 1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1
| InChIKey1 = IAJILQKETJEXLJ-RSJOWCBRBL
| SMILES1 = O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IAJILQKETJEXLJ-RSJOWCBRSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 685-73-4
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = CEP8I6411H
| EINECS =211-682-6
| PubChem =84740
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 4153
| SMILES = O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O
}}
|Section2={{Chembox Properties
| Formula =C<sub>6</sub>H<sub>10</sub>O<sub>7</sub>
| MolarMass =194.139
| Appearance =
| Density =
| MeltingPtC = 159
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
'''D-Galacturonic acid''' is a sugar acid, an oxidized form of [[galactose|<small>D</small>-galactose]]. It is the main component of [[pectin]], in which it exists as the polymer [[polygalacturonic acid]].<ref>Debra Mohnen "Pectin structure and biosynthesis" Current Opinion in Plant Biology 2008, 11:266–277.
{{DOI|10.1016/j.pbi.2008.03.006}}.</ref> In its open form, it has an [[aldehyde]] group at C1 and a [[carboxylic acid]] group at C6. Other oxidized forms of <small>D</small>-galactose are <small>D</small>-galactonic acid (carboxylic group at C1) and ''meso''-galactaric acid ([[mucic acid]]) (carboxylic groups at C1 and C6). It is also a [[uronic acid]] or hexuronic acid. Naturally occurring uronic acids are <small>D</small>-[[glucuronic acid]], <small>D</small>-galacturonic acid, <small>L</small>-[[iduronic acid]] and <small>D</small>-[[mannuronic acid]].
==References==
<references />
{{DEFAULTSORT:Galacturonic acid, D-}}
[[Category:Uronic acids]]
khadija ahmadi jan:{D-Galacturonic acid is technically pectin but it is the main resource it usually gives digestion problems as everyone says so don't have to much gumdrops.}
[it may be toxic on it's own but scientists figured out a way to disable the toxic parts]
[d-galacturonic acid comes in the category of >acids.]
{it may be made in the family of [glucuronic acid> to uronic acids]but eventually takes over iduronic acid]}['''Bold text'''written by: khadija ahmadi Jan gr.6 afghan Canadian]' |
