Wikipedia:WikiProject Chemicals/Log/2010-07-06

Standard header for logs from CheMoBot

09:27:18 (3, 2, 4) (EDIT) User:193.0.118.39 (contribs, talk) edited Diethyl_ether (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/pmc/articles/PMC2890321
09:34:38 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'SystematicName' ('' -> '[ethoxy(3-methyl-4-(methylsulfanyl)phenoxy)phosphoryl](propan-2-yl)amine', SET '')
09:34:39 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'PubChem_Comment' ('' -> '(''R'')', SET '')
09:34:39 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'PubChem_Ref' ('' -> '{{pubchemcite}}', SET '')
09:34:39 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'PubChem1' ('' -> '38988460', SET '')
09:34:39 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'PubChem1_Comment' ('' -> '(''S'')', SET '')
09:34:39 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'PubChem1_Ref' ('' -> '{{pubchemcite}}', SET '')
09:34:40 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'PubChem2' ('' -> '31070', SET '')
09:34:40 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'PubChem2_Ref' ('' -> '{{pubchemcite}}', SET '')
09:34:40 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite}}', SET '')
09:34:40 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'UNNumber' ('' -> '2783', SET '')
09:34:41 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'InChIKey' ('' -> 'ZCJPOPBZHLUFHF-UHFFFAOYSA-N', SET '')
09:34:41 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'Beilstein' ('' -> '4752893', SET '')
09:34:41 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Changed: 'verifiedrevid' ('309656640' -> '', SET '')
09:34:41 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Deleted: 'IUPACName' ('N-[ethoxy-(3-methyl-4-methylsulfanylphenoxy)phosphoryl]propan-2-amine' -> '', SET 'N-[ethoxy-(3-methyl-4-methylsulfanylphenoxy)phosphoryl]propan-2-amine')
09:34:41 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'EINECS' ('' -> '244-848-1', SET '')
09:34:42 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Changed: 'PubChem' ('31070' -> '38988461', SET '31070')
09:34:42 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Changed: 'SMILES' ('CCOP(=O)(NC(C)C)OC1=CC(=C(C=C1)SC)C' -> 'CCOP(=O)(NC(C)C)OC1=CC=C(SC)C(C)=C1', SET 'CCOP(=O)(NC(C)C)OC1=CC(=C(C=C1)SC)C')
09:34:42 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'InChI' ('' -> '1S/C13H22NO3PS/c1-6-16-18(15,14-10(2)3)17-12-7-8-13(19-5)11(4)9-12/h7-10H,6H2,1-5H3,(H,14,15)', SET '')
09:34:42 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'ChEBI' ('' -> '38680', SET '')
09:34:43 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'ChemSpiderID' ('' -> '28827', SET '')
09:34:43 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'PIN' ('' -> 'N-[ethoxy-(3-methyl-4-methylsulfanylphenoxy)phosphoryl]propan-2-amine', SET '')
09:45:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Fenamiphos (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')

{{User:CheMoBot/Logline|id=2200|mainlevel=0|sublevel=0|infolevel=3|time=10:11:35|date=06-06-2010|user=Graham87|page=MediaWiki_talk:Acetylene|diff=|box=chembox|added=|changed=|deleted=|urls=|isIP=0|function=MOVE|reason=Moved watched page (indexed): import old edits, see [[User:Graham87/Import|whitelisted=0|timestamp=1278425495}}

11:03:42 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Changed: 'OtherNames' ('Monofluoromethane, Methyl fluoride, Fluoromethylidyne, Freon 41, Halocarbon 41, R41, UN 2454' -> 'Monofluoromethane, Methyl fluoride, Fluoromethylidyne, Freon 41, Halocarbon 41, R41', SET 'Monofluoromethane, Methyl fluoride, Fluoromethylidy
11:03:44 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'PubChem_Ref' ('' -> '{{pubchemcite}}', SET '')
11:03:45 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite}}', SET '')
11:03:47 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'UNNumber' ('' -> '2454', SET '')
11:03:48 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'InChIKey' ('' -> 'NBVXSUQYWXRMNV-UHFFFAOYSA-N', SET '')
11:03:50 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'Beilstein' ('' -> '1730725', SET '')
11:03:52 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'Gmelin' ('' -> '391', SET '')
11:03:55 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'SPhrases' ('' -> '{{S9}},{{S16}},{{S23}},{{S24/25}},{{S26}},{{S28}},{{S33}},{{S36/37/39}},{{S60}}', SET '')
11:03:58 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Changed: 'verifiedrevid' ('307947200' -> '', SET '')
11:03:59 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Changed: 'InChI' ('1/CH3F/c1-2/h1H3' -> '1S/CH3F/c1-2/h1H3', SET '1/CH3F/c1-2/h1H3')
11:04:00 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'MeSHName' ('' -> 'Fluoromethane', SET '')
11:04:00 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'ChemSpiderID' ('' -> '11148', SET '')
11:14:25 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Fluoromethane (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
11:24:20 (2, 4, 5) (EDIT) User:Seddon-j-06 (contribs, talk) edited Ethanethiol (diff, hist)
Added: 'ImageFile1' ('Ethanethiol.svg' -> 'Ethanethiol-skeletal.png', SET '')
11:29:05 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Nepetalactone (diff, hist)
Changed: 'IUPACName_hidden' ('' -> 'yes')
11:29:05 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Nepetalactone (diff, hist)
Changed: 'C' ('' -> '10')
11:29:06 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Nepetalactone (diff, hist)
Changed: 'H' ('' -> '14')
11:29:06 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Nepetalactone (diff, hist)
Changed: 'O' ('' -> '2')
11:29:06 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Nepetalactone (diff, hist)
Changed: 'IUPACName' ('4,7-dimethyl- 5,6,7,7a-tetrahydro- cyclopenta[c]pyran- 1(4aH)-one' -> '4,7-dimethyl-5,6,7,7a-tetrahydro-cyclopenta[c]pyran-1(4aH)-one')
11:29:06 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Nepetalactone (diff, hist)
Changed: 'InChI' ('1/C10H14O2/c1-6-3-4-8-7(2)5-12- 10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3' -> '1/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3')
11:29:10 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Nepetalactone (diff, hist)
Changed: 'Formula' ('C10H14O2' -> '')
11:29:10 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Nepetalactone (diff, hist)
Changed: 'MolarMass' ('166.217 g·mol−1' -> '')
11:43:48 (4, 3, 5) (EDIT) User:193.52.162.3 (contribs, talk) edited Triethyloxonium_tetrafluoroborate (diff, hist)
Changed: 'MolarMass' ('112.127 g/mol' -> '189,99 g/mol')
12:42:30 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-1,4-naphthalenedione (diff, hist)
Changed: 'SystematicName' ('' -> '2,3,5,6,7,8-hexahydroxy-1,4-dihydronaphthalene-1,4-dione')
12:42:31 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-1,4-naphthalenedione (diff, hist)
Changed: 'OtherNames' ('' -> '2,3,5,6,7,8-hexahydroxynaphthalene-1,4-dione')
12:42:31 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-1,4-naphthalenedione (diff, hist)
Changed: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite}}')
12:42:31 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-1,4-naphthalenedione (diff, hist)
Changed: 'InChIKey' ('' -> 'RUQPQFLYDCXMGX-UHFFFAOYSA-N')
12:42:31 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-1,4-naphthalenedione (diff, hist)
Changed: 'SMILES' ('O=C(C1=C2C(O)=C(O)C(O)=C1O)C(O)=C(O)C2=O' -> 'OC1=C(O)C(=O)C2=C(C1=O)C(O)=C(O)C(O)=C2O')
12:42:31 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-1,4-naphthalenedione (diff, hist)
Changed: 'InChI' ('' -> '1S/C10H6O8/c11-3-1-2(5(13)9(17)7(3)15)6(14)10(18)8(16)4(1)12/h11,13,15-18H')
12:42:32 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-1,4-naphthalenedione (diff, hist)
Changed: 'ChemSpiderID' ('' -> '15712468')
12:42:32 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-1,4-naphthalenedione (diff, hist)
Changed: 'PIN' ('' -> 'Hexahydroxy-1,4-naphthalenedione')
13:06:42 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'SystematicName' ('' -> '1,4,5,6,7,8-Hexahydroxy-2,3-dihydronaphthalene-2,3-dione')
13:06:42 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'OtherNames' ('' -> '1,4,5,6,7,8-Hexahydroxynaphthalene-2,3-dione')
13:06:43 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'PubChem_Ref' ('' -> '{{pubchemcite}}')
13:06:43 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite}}')
13:06:43 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'InChIKey' ('' -> 'PMIIXSYQVXRADO-UHFFFAOYSA-N')
13:06:43 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'IUPACName' ('' -> 'Hexahydroxy-2,3-naphthalenedione')
13:06:44 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'SMILES' ('C12=C(C(=O)C(=O)C(=C1C(=C(C(=C2O)O)O)O)O)O' -> 'OC1=C(O)C2=C(O)C(=O)C(=O)C(O)=C2C(O)=C1O')
13:06:44 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'InChI' ('' -> '1S/C10H6O8/c11-3-1-2(5(13)9(17)7(3)15)6(14)10(18)8(16)4(1)12/h11-15,17H')
13:06:44 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxy-2,3-naphthalenedione (diff, hist)
Changed: 'ChemSpiderID' ('' -> '7992219')
13:31:29 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxybenzene_triscarbonate (diff, hist)
Changed: 'SystematicName' ('' -> '3,5,8,10,13,15-Hexaoxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-4,9,14-trione')
13:31:29 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxybenzene_triscarbonate (diff, hist)
Changed: 'PubChem_Ref' ('' -> '{{pubchemcite}}')
13:31:30 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxybenzene_triscarbonate (diff, hist)
Changed: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite}}')
13:31:30 (2, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxybenzene_triscarbonate (diff, hist)
Changed: 'InChIKey' ('' -> 'ZBAXYMCJUNMJHE-UHFFFAOYSA-N')
13:31:30 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxybenzene_triscarbonate (diff, hist)
Changed: 'SMILES' ('C12=C(C3=C(C4=C1OC(=O)O4)OC(=O)O3)OC(=O)O2' -> 'O=C1OC2=C3OC(=O)OC3=C3OC(=O)OC3=C2O1')
13:31:30 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxybenzene_triscarbonate (diff, hist)
Changed: 'InChI' ('' -> '1S/C9O9/c10-7-13-1-2(14-7)4-6(18-9(12)17-4)5-3(1)15-8(11)16-5')
13:31:31 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxybenzene_triscarbonate (diff, hist)
Changed: 'ChemSpiderID' ('' -> '10311361')
13:31:31 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Hexahydroxybenzene_triscarbonate (diff, hist)
Changed: 'PIN' ('' -> 'Hexahydroxybenzene triscarbonate')
15:45:39 (3, 2, 4) (EDIT) User:Rifleman 82 (contribs, talk) edited Tributyl_phosphate (diff, hist)
Added links: http://www.scorecard.org/chemical-profiles/consumer-products.tcl?edf_substance_id=126-73-8
16:07:19 (4, 3, 5) (EDIT) User:Aa77zz (contribs, talk) edited User:Aa77zz/Sandbox1 (diff, hist)
Changed: 'PubChem' ('6333920' -> '6324599')
16:07:19 (4, 3, 5) (EDIT) User:Aa77zz (contribs, talk) edited User:Aa77zz/Sandbox1 (diff, hist)
Changed: 'SMILES' ('CCN(CC1=CC(=CC=C1)S(=O)(=O)O)C2=CC(=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)O)C=C3C)C5=CC=C(C=C5)NC6=CC=C(C=C6)OCC)C' -> 'CCN(CC1=CC(=CC=C1)S(=O)(=O)[O-])C2=CC(=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)[O-])C=C3C)C5=CC=C(C=C5)N
16:07:20 (4, 3, 5) (EDIT) User:Aa77zz (contribs, talk) edited User:Aa77zz/Sandbox1 (diff, hist)
Changed: 'Formula' ('C47H50N3O7S2+' -> 'C47H48N3NaO7S2 (Sodium salt)')
16:07:20 (4, 3, 5) (EDIT) User:Aa77zz (contribs, talk) edited User:Aa77zz/Sandbox1 (diff, hist)
Changed: 'MolarMass' ('833.048' -> '854.02')
16:20:53 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'ImageFileL1' ('' -> 'Isoindoline numbering.svg')
16:20:53 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'ImageSizeL1' ('' -> '100px')
16:20:53 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'ImageFileR1' ('' -> 'Isoindoline3d.png')
16:20:54 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'ImageSizeR1' ('' -> '100px')
16:20:54 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'ImageNameR1' ('' -> '3D representation of isoindoline')
16:20:54 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'CASOther' (' <ref>http://www.chemicalregister.com/Isoindoline/Suppliers/pid63368.htm</ref>' -> ' <ref>[http://www.chemicalregister.com/Isoindoline/Suppliers/pid63368.htm Isoindoline]</ref>')
16:20:55 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'ImageFile1' ('Isoindoline3d.png' -> '')
16:20:55 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'ImageSize1' ('100px' -> '')
16:20:55 (3, 3, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Changed: 'ImageName1' ('3D representation of isoindoline' -> '')
16:20:55 (3, 2, 4) (EDIT) User:148.177.1.216 (contribs, talk) edited Isoindoline (diff, hist)
Added links: http://www.chemsynthesis.com/base/chemical-structure-22914.html
16:45:08 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'Name' ('3,4,5-Tri-O-galloylquinic acid' -> '3,4,5-Tri-''O''-galloylquinic acid')
16:45:08 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'ImageFile' ('' -> '3,4,5-Tri-O-galloylquinic acid.png')
16:45:08 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'OtherNames' ('TGQA (3R,5R)-1-Hydroxy-3,4,5-tris(3,4,5-trihydroxyphenylcarbonyloxy)cyclohexanecarboxylic acid' -> 'TGQA (3''R'',5''R'')-1-Hydroxy-3,4,5-tris(3,4,5-trihydroxyphenylcarbonyloxy)cyclohexanecarboxylic acid')
16:45:08 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'C' ('' -> '28')
16:45:09 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'H' ('' -> '24')
16:45:09 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'O' ('' -> '18')
16:45:09 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'IUPACName' ('<nowiki>(3R,5R)-1-hydroxy-3,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid' -> '(1S,3R,4S,5R)-1-Hydroxy-3,4,5-tris((3,4,5-trihydroxybenzoyl)oxy)cyclohexanecarboxylic acid')</nowiki>
16:45:09 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'SMILES' ('C1C(C(C(CC1(C(=O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O' -> 'O[C@]1(C(O)=O)C[C@@H](OC(C2=CC(O)=C(O)C(O)=C2)=O)[C@H](OC(C3=CC(O)=C(O)C(O)=C3)=O)[C@H](OC(C4=CC(O)=C(O)C(O)=C4)=O)C1')
16:45:10 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'Formula' ('C28H24O18' -> '')
16:45:10 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 3,4,5-Tri-O-galloylquinic_acid (diff, hist)
Changed: 'MolarMass' ('648.47 g/mol' -> '')
16:45:46 (4, 3, 5) (EDIT) User:Citation bot 1 (contribs, talk) edited Magnesium_iodide (diff, hist)
Changed: 'Formula' ('MgI2 (anhydrous) MgI2.6H2O (hexahydrate) MgI2.8H2O (octahydrate)<ref>{{Citation | last = Perry | first =Dale L. | author-link = | last2 = Phillips | first2 =Sidney L. | author2-link
16:45:46 (3, 2, 4) (EDIT) User:Citation bot 1 (contribs, talk) edited Magnesium_iodide (diff, hist)
Added links: http://books.google.com/?id=0fT4wfhF1AsC&pg=PA240&dq=%22magnesium+iodide%22, http://books.google.com/?id=Xqj-TTzkvTEC&pg=RA1-PA527&dq=%22magnesium+iodide%22, http://books.google.com/?id=qijhLyZ6SokC&pg=PA59&dq=%22magnesium+iodide%22+reactions
16:51:31 (3, 2, 4) (EDIT) User:Sournick3 (contribs, talk) edited Starch (diff, hist)
Added links: http://www.nature.com/ng/journal/v39/n10/full/ng2123.html
17:32:39 (3, 2, 4) (EDIT) User:134.53.244.206 (contribs, talk) edited Steviol_glycoside (diff, hist)
Added links: http://www.cspinet.org/new/200808281.html, http://cspinet.org/new/pdf/stevia-cspi-cover-letter-8-4-08.pdf
17:58:15 (2, 4, 5) (EDIT) User:99.237.104.65 (contribs, talk) edited Tetrafluoromethane (diff, hist)
Added: 'OtherCpds' ('' -> '[[Tetrachloromethane]] [[Tetrabromomethane]] [[Tetraiodomethane]]', SET '')
18:04:08 (2, 4, 5) (EDIT) User:99.237.104.65 (contribs, talk) edited Carbon_tetrachloride (diff, hist)
Added: 'OtherCations' ('' -> '[[Silicon tetrachloride]] [[Germanium tetrachloride]] [[Tin tetrachloride]] [[Lead tetrachloride]]', SET '')
19:19:10 (3, 2, 4) (EDIT) User:Tetsuo (contribs, talk) edited Aspartame (diff, hist)
Added links: http://www.renalandurologynews.com/diet-soda-salt-may-harm-kidneys/article/162107/, http://www.webmd.com/diet/news/20091102/diet-sodas-hard-on-the-kidneys
19:32:07 (2, 3, 4) (EDIT) User:Yikrazuul (contribs, talk) edited Coenzyme_B (diff, hist)
Changed: 'ImageFile' ('CoB.png' -> 'Coenzyme B (CoB).svg')
19:59:14 (3, 3, 5) (EDIT) User:Citation bot 1 (contribs, talk) edited Osmium(IV)_chloride (diff, hist)
Changed: 'SolubleOther' ('soluble in organic solvents<ref name="handin">{{Citation | last = Perry | first = Dale L. | last2 = Phillips | first2 = Sidney L. | year = 1995 | title = Handbook of Inorganic Compounds | publisher = CRC Press | isbn = 0849386713 | page
19:59:15 (3, 2, 4) (EDIT) User:Citation bot 1 (contribs, talk) edited Osmium(IV)_chloride (diff, hist)
Added links: http://books.google.com/?id=lFjg0L-uOxoC&pg=PT864&dq=%22Osmium(IV)+chloride%22, http://books.google.com/?id=MwA5AAAAIAAJ&pg=PA727&dq=%22Osmium+tetrachloride%22, http://books.google.com/?id=Xqj-TTzkvTEC&pg=PA510&dq=%22Lutetium+chloride%22
20:17:45 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited CHAPS_detergent (diff, hist)
Changed: 'ImageFile' ('' -> 'CHAPS.png')
20:17:46 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited CHAPS_detergent (diff, hist)
Changed: 'S' ('' -> '1')
20:17:46 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited CHAPS_detergent (diff, hist)
Changed: 'C' ('' -> '32')
20:17:46 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited CHAPS_detergent (diff, hist)
Changed: 'H' ('' -> '58')
20:17:47 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited CHAPS_detergent (diff, hist)
Changed: 'N' ('' -> '2')
20:17:47 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited CHAPS_detergent (diff, hist)
Changed: 'O' ('' -> '7')
20:17:47 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited CHAPS_detergent (diff, hist)
Changed: 'Formula' ('C32N2H58SO7' -> '')
20:17:48 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited CHAPS_detergent (diff, hist)
Changed: 'MolarMass' ('614.877 gÂ·mol-1' -> '')
20:53:31 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'ImageFile' ('' -> 'Levoglucosan.png')
20:53:32 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'ImageSize' ('' -> '150px')
20:53:32 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'OtherNames' ('' -> '1,6-Anhydro-beta-glucopyranose; Leucoglucosan')
20:53:33 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'SystematicName' ('6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol' -> '')
20:53:33 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'C' ('' -> '6')
20:53:33 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'H' ('' -> '10')
20:53:34 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'O' ('' -> '5')
20:53:34 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'IUPACName' ('' -> '6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol')
20:53:35 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'Formula' ('C6H10O5' -> '')
20:53:35 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'MolarMass' ('162.1406 gÂ·mol-1' -> '')
20:53:35 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'MeltingPt' ('183 Â°C' -> '182-184 Â°C')
20:53:36 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'BoilingPt' ('383.8 Â°C' -> '')
20:53:36 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'BoilingPtC' ('' -> '383.8')
20:53:37 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'PIN' ('Levoglucosan' -> '')
20:56:13 (3, 3, 5) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'Reference' ('' -> '<ref>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=316555')
20:56:13 (3, 3, 5) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'ALDRICH&N5' ('' -> 'SEARCH_CONCAT_PNO')
20:56:13 (3, 3, 5) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Changed: 'BRAND_KEY&F' ('' -> 'SPEC Levoglucosan] at [[Sigma-Aldrich]]</ref>')
20:56:14 (3, 2, 4) (EDIT) User:Edgar181 (contribs, talk) edited Levoglucosan (diff, hist)
Added links: http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=316555
21:05:25 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'ImageFile' ('' -> 'Myristamine oxide.png')
21:05:26 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'ImageSize' ('' -> '200px')
21:05:26 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'OtherNames' ('N,N-Dimethyl-1-tetradecanamine-N-oxide;Myristyl dimethyl amine oxide; Myristyldimethylamine oxide; N,N-Dimethyltetradecylamine N-oxide; Dimethyl-oxido-tetradecyl-azanium;' -> '''N'',''N''-Dimethyl-1-tetradecanamine-''N''-oxide;Myristyl dime
21:05:26 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'Appearance' ('' -> 'Clear liquid')
21:05:26 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'C' ('' -> '16')
21:05:27 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'H' ('' -> '35')
21:05:27 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'N' ('' -> '1')
21:05:27 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'O' ('' -> '1')
21:05:27 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'IUPACName' ('' -> '''N'',''N''-Dimethyltetradecan-1-amine oxide')
21:05:28 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'SMILES' ('' -> '[O-][N+](C)(C)CCCCCCCCCCCCCC')
21:05:28 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'Formula' ('C16H35NO' -> '')
21:05:28 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'MolarMass' ('257.46' -> '')
21:05:29 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'MeltingPt' ('-10 C' -> '')
21:05:29 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'MeltingPtC' ('' -> '-10')
21:05:30 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'BoilingPt' ('100 C' -> '')
21:05:30 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'BoilingPtC' ('' -> '100')
21:05:31 (5, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Myristamine_oxide (diff, hist)
Changed: 'CASNo' ('3332-27-2; 217643-95-3' -> '3332-27-2')
21:15:57 (2, 3, 4) (EDIT) User:SmackBot (contribs, talk) edited 1,3,5-Trichlorobenzene (diff, hist)
Changed: 'CASNo_Ref' ('{{}}' -> '')
21:34:29 (3, 2, 4) (EDIT) User:Tuchomator (contribs, talk) edited 2C-I (diff, hist)
Added links: http://www.mpf.gov.ar/biblioteca/newsletter/n197/DECRETO_299_2010.pdf
21:51:40 (3, 2, 4) (EDIT) User:Tuchomator (contribs, talk) edited 2C-B (diff, hist)
Added links: http://www.mpf.gov.ar/biblioteca/newsletter/n197/DECRETO_299_2010.pdf
21:52:35 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'realboxname' ('' -> 'chembox')
21:52:36 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'boxname' ('' -> 'chembox')
21:52:36 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'ImageFile' ('' -> '2C-T-2.svg')
21:52:36 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'ImageSize' ('' -> '200px')
21:52:36 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'ImageFile2' ('' -> '2C-T-2 anim.gif')
21:52:37 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'ImageSize2' ('' -> '200px')
21:52:37 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'Section1' ('' -> '{{Chembox Identifiers')
21:52:37 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'InChIKey' ('' -> 'HCWQGDLBIKOJPM-UHFFFAOYAX')
21:52:38 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'Section2' ('' -> '{{Chembox Properties')
21:52:38 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'Section3' ('' -> '{{Chembox Hazards')
21:52:39 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'error' ('empty' -> '')
21:52:39 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'IUPACName' ('' -> '2-[4-(Ethylthio)-2,5-dimethoxyphenyl]ethanamine')
21:52:39 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'SMILES' ('' -> 'CCSc1cc(OC)c(cc1OC)CCN')
21:52:40 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'InChI' ('' -> '1/C12H19NO2S/c1-4-16-12-8-10(14-2)9(5-6-13)7-11(12)15-3/h7-8H,4-6,13H2,1-3H3')
21:52:40 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'ChemSpiderID' ('' -> '16787961')
21:52:40 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'Formula' ('' -> 'C12H19NO2S')
21:52:41 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'MolarMass' ('' -> '241.35 g/mol')
21:52:41 (6, 6, 6) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Changed: 'CASNo' ('' -> '207740-24-7')
21:52:41 (3, 2, 4) (EDIT) User:Tuchomator (contribs, talk) edited 2C-T-2 (diff, hist)
Added links: http://www.mpf.gov.ar/biblioteca/newsletter/n197/DECRETO_299_2010.pdf
22:08:51 (3, 2, 4) (EDIT) User:82.21.42.163 (contribs, talk) edited Xenon_difluoride (diff, hist)
Added links: http://dvice.com/archives/2010/07/battery-breakth.php
22:22:49 (3, 2, 4) (EDIT) User:Puellanivis (contribs, talk) edited Brodifacoum (diff, hist)
Added links: http://pmep.cce.cornell.edu/profiles/rodent/rodent_A_L/brodifacoum/brodif_prf_0185.html, http://www.inchem.org/documents/pims/chemical/pim077.htm
22:28:37 (3, 2, 4) (EDIT) User:Puellanivis (contribs, talk) edited Brodifacoum (diff, hist)
Added links: http://msds.orica.com/pdf/shess-en-cds-010-000000020872.pdf