Wikipedia:WikiProject Chemicals/Log/2010-01-13

Standard header for logs from CheMoBot

01:07:45 (2, 2, 4) (EDIT) User:Edgar181 (contribs, talk) edited Biotin (diff, hist)
Changed: 'Appearance' ('' -> 'White crystalline needles', SET 'White crystalline needles')
01:07:45 (2, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Biotin (diff, hist)
Changed: 'InventedBy' ('Steve Inglese' -> '', SET '')
03:29:36 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Trimethylsilylacetylene (diff, hist)
Added: 'verifiedrevid' ('' -> '310830296', SET '')
03:29:36 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Trimethylsilylacetylene (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
04:36:42 (2, 4, 5) (EDIT) User:Craxyxarc (contribs, talk) edited Cadmium_oxide (diff, hist)
Changed: 'Boiling_notes' ('[[sublimation]]<ref name=INCHEM_sheet>[http://www.inchem.org/documents/icsc/icsc/eics0117.htm Cadmium Oxide (Icsc)]</ref>' -> '[[Sublimation (chemistry)|sublimation]]<ref name=INCHEM_sheet>[http://www.inchem.org/documents/icsc/icsc/eics0117.htm Cadmium Oxide (Icsc)]</ref>', SET '[[sublimation]]<ref name=INCHEM_sheet>[http://www.inchem.org/documents/icsc/icsc/eics0117.htm Cadmium Oxide (Icsc)]</ref>')
04:58:04 (2, 4, 5) (EDIT) User:Tea with toast (contribs, talk) edited Arachidonic_acid (diff, hist)
Added: 'OtherNames' ('' -> '(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid', SET '')
05:00:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Triiron_dodecacarbonyl (diff, hist)
Added: 'verifiedrevid' ('' -> '268696027', SET '')
05:35:58 (2, 3, 5) (EDIT) User:Craxyxarc (contribs, talk) edited Beryllium_bromide (diff, hist)
Changed: 'Melting_notes' ('473Â°C [[sublimation|sublimes]]' -> '473Â°C [[Sublimation (chemistry)|sublimes]]')
05:38:43 (4, 3, 5) (EDIT) User:Craxyxarc (contribs, talk) edited Mercury(I)_bromide (diff, hist)
Changed: 'BoilingPt' ('[[sublimation|sublimes]] at 340-350Â°C<ref name="hand">{{Citation | last = Perry | first = Dale L. | author-link = | last2 = Phillips | first2 = Sidney L. | author2-link = | publication-date = | date = | year = 1995 | title = Handbook of Inorganic Compounds | edition = | volume = | series = | publication-place = | place = | publisher = CRC Press | id = | isbn = 0849386713 | doi = | oclc = | pages = 255 | url = http://books.google.com/books?id=0fT4wfhF1AsC&pg=PA255&dq=%22Mercury(I)+bromide%22&as_brr=3&sig=9IOtdrqpdYj5BIUYqvEI9PxYFek | accessdate = 2008-05-30}}</ref>' -> '[[Sublimation (chemistry)|sublimes]] at 340-350Â°C<ref name="hand">{{Citation | last = Perry | first = Dale L. | author-link = | last2 = Phillips | first2 = Sidney L. | author2-link = | publication-date = | date = | year = 1995 | title = Handbook of Inorganic Compounds | edition = | volume = | series = | publication-place = | place = | publisher = CRC Press | id = | isbn = 0849386713 | doi = | oclc = | pages = 255 | url = http://books.google.com/books?id=0fT4wfhF1AsC&pg=PA255&dq=%22Mercury(I)+bromide%22&as_brr=3&sig=9IOtdrqpdYj5BIUYqvEI9PxYFek | accessdate = 2008-05-30}}</ref>')
05:43:26 (4, 3, 5) (EDIT) User:Craxyxarc (contribs, talk) edited Mercury(I)_fluoride (diff, hist)
Changed: 'MeltingPt' ('[[sublimation|sublimes]] at -240Â°C' -> '[[Sublimation (chemistry)|sublimes]] at -240Â°C')
05:43:56 (4, 3, 5) (EDIT) User:Craxyxarc (contribs, talk) edited Lutetium(III)_chloride (diff, hist)
Changed: 'BoilingPt' ('[[sublimation|sublimes]] above 750Â°C<ref name="web">{{cite web |url= http://202.114.88.54/g/web18/wangluo/webelements/webelements/compounds/text/lu/cl3lu1-10099668.html |title= Chemistry: Periodic Table: Lutetium: compound data (lutetium (III) chloride) |accessdate=2008-06-27 |publisher= WebElements |date= }}</ref>' -> '[[Sublimation (chemistry)|sublimes]] above 750Â°C<ref name="web">{{cite web |url= http://202.114.88.54/g/web18/wangluo/webelements/webelements/compounds/text/lu/cl3lu1-10099668.html |title= Chemistry: Periodic Table: Lutetium: compound data (lutetium (III) chloride) |accessdate=2008-06-27 |publisher= WebElements |date= }}</ref>')
05:44:26 (4, 3, 5) (EDIT) User:Craxyxarc (contribs, talk) edited Selenium_tetrachloride (diff, hist)
Changed: 'MeltingPt' ('[[sublimation|sublimes]] at 191.4Â°C<ref name="hand">{{Citation | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 487 | url = http://books.google.com/books?id=lFjg0L-uOxoC&pg=PT872 | accessdate = 2008-07-02}}</ref>' -> '[[Sublimation (chemistry)|sublimes]] at 191.4Â°C<ref name="hand">{{Citation | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 487 | url = http://books.google.com/books?id=lFjg0L-uOxoC&pg=PT872 | accessdate = 2008-07-02}}</ref>')
06:05:25 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Hexamethylenediamine (diff, hist)
Added: 'verifiedrevid' ('' -> '307936974', SET '')
06:05:26 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Hexamethylenediamine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
06:34:12 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tetracyanoethylene (diff, hist)
Added: 'verifiedrevid' ('' -> '299520258', SET '')
06:34:12 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tetracyanoethylene (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
07:00:18 (3, 2, 4) (EDIT) User:Zzzhuh (contribs, talk) edited Xylitol (diff, hist)
Added links: http://www.stridegum.com/textonly/faq.php
10:26:29 (3, 2, 4) (EDIT) User:08902757r (contribs, talk) edited Poly(methyl_methacrylate) (diff, hist)
Added links: http://www.tangram.co.uk/TI-Polymer-PMMA.html
10:30:28 (3, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'realboxname' ('chembox' -> '')
10:30:28 (3, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'boxname' ('chembox' -> '')
10:30:29 (3, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'ImageFile' ('Oxaflozane.png' -> '')
10:30:29 (3, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'ImageSize' ('200px' -> '')
10:30:29 (3, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'Section1' ('{{Chembox Identifiers' -> '')
10:30:29 (3, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'Section2' ('{{Chembox Properties' -> '')
10:30:30 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'IUPACName' ('4-propan-2-yl-2-[3-(trifluoromethyl)phenyl]morpholine' -> '')
10:30:30 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'PubChem' ('71915' -> '')
10:30:30 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'SMILES' ('CC(C)N1CCOC(C1)C2=CC=C(C=C2)C(F)(F)F' -> '')
10:30:30 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'Formula' ('C14H18F3NO' -> '')
10:30:31 (3, 2, 4) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Added links: http://books.google.com/books?id=5GpcTQD_L2oC&lpg=PA766&dq=oxaflozane%20conflictan&as_brr=3&pg=PA766#v=onepage&q=oxaflozane%20conflictan&f=false, http://books.google.com/books?id=XCsJgUnclbcC&lpg=PA1122&dq=oxaflozane%20conflictan&as_brr=3&pg=PA1122#v=onepage&q=oxaflozane%20conflictan&f=false, http://medicinescomplete.com/mc/merck/2009/13-06977.htm, http://www.medicinescomplete.com/mc/martindale/2009/2295-z.htm
10:30:31 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'MolarMass' ('273.29403' -> '')
10:30:31 (5, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Oxaflozane (diff, hist)
Changed: 'CASNo' ('26629-87-8' -> '')
10:34:56 (2, 2, 4) (EDIT) User:Spinach Dip (contribs, talk) edited Trinitrotoluene (diff, hist)
Changed: 'ImageFileL1' ('' -> 'Trinitrotoluene.svg', SET 'Trinitrotoluene.svg')
10:36:11 (2, 4, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Added: '<nowiki>ImageFile' ('' -> 'Ammonium-acetate-2D.png', SET '')
10:36:12 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'ImageFile' ('Ammonium-acetate-2D.png' -> '', SET 'Ammonium-acetate-2D.png')
10:36:12 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Section2' ('{{Chembox Properties' -> '', SET '{{Chembox Properties')
10:36:12 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Appearance' ('white solid crystals [[deliquescent]]' -> '', SET 'white solid crystals [[deliquescent]]')
10:36:12 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Solubility' ('148 g/100 ml (4 Â°C)' -> '', SET '148 g/100 ml (4 Â°C)')
10:36:13 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'SolubleOther' ('7.89 g/100 mL (15 Â°C)' -> '', SET '7.89 g/100 mL (15 Â°C)')
10:36:13 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Solvent' ('methanol' -> '', SET 'methanol')
10:36:13 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Section3' ('{{Chembox Structure' -> '', SET '{{Chembox Structure')
10:36:13 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'CrystalStruct' ('[[orthorhombic]]' -> '', SET '[[orthorhombic]]')
10:36:13 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Section7' ('{{Chembox Hazards' -> '', SET '{{Chembox Hazards')
10:36:14 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'ExternalMSDS' ('[http://www.sciencelab.com/xMSDS-Ammonium_acetate-9927070 ScienceLab MSDS]' -> '', SET '[http://www.sciencelab.com/xMSDS-Ammonium_acetate-9927070 ScienceLab MSDS]')
10:36:14 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'NFPA-H' ('2' -> '', SET '2')
10:36:14 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'NFPA-F' ('1' -> '', SET '1')
10:36:14 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'NFPA-R' ('0' -> '', SET '0')
10:36:15 (2, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Section8' ('{{Chembox Related' -> '', SET '{{Chembox Related')
10:36:15 (4, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Formula' ('C2H3O2NH4' -> '', SET 'C2H3O2NH4')
10:36:15 (4, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'MolarMass' ('77.0825 g/mol' -> '', SET '77.0825 g/mol')
10:36:15 (4, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'Density' ('1.17 g/cm3<ref>Pradyot Patnaik. ''Handbook of Inorganic Chemicals''. McGraw-Hill, 2002, ISBN 0070494398</ref>' -> '', SET '1.17 g/cm3<ref>Pradyot Patnaik. ''Handbook of Inorganic Chemicals''. McGraw-Hill, 2002, ISBN 0070494398</ref>')
10:36:15 (4, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'MeltingPtC' ('114' -> '', SET '114')
10:36:16 (4, 5, 5) (EDIT) User:85.154.167.67 (contribs, talk) edited Ammonium_acetate (diff, hist)
Deleted: 'BoilingPt' ('decomposes' -> '', SET 'decomposes')
10:46:30 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ammonium_acetate (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
11:02:48 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'ImageFile' ('' -> 'Ammonium-acetate-2D.png', SET 'Ammonium-acetate-2D.png')
11:02:49 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Section2' ('' -> '{{Chembox Properties', SET '{{Chembox Properties')
11:02:49 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Appearance' ('' -> 'white solid crystals [[deliquescent]]', SET 'white solid crystals [[deliquescent]]')
11:02:49 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Solubility' ('' -> '148 g/100 ml (4 Â°C)', SET '148 g/100 ml (4 Â°C)')
11:02:49 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'SolubleOther' ('' -> '7.89 g/100 mL (15 Â°C)', SET '7.89 g/100 mL (15 Â°C)')
11:02:50 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Solvent' ('' -> 'methanol', SET 'methanol')
11:02:50 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Section3' ('' -> '{{Chembox Structure', SET '{{Chembox Structure')
11:02:50 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'CrystalStruct' ('' -> '[[orthorhombic]]', SET '[[orthorhombic]]')
11:02:50 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Section7' ('' -> '{{Chembox Hazards', SET '{{Chembox Hazards')
11:02:51 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'ExternalMSDS' ('' -> '[http://www.sciencelab.com/xMSDS-Ammonium_acetate-9927070 ScienceLab MSDS]', SET '[http://www.sciencelab.com/xMSDS-Ammonium_acetate-9927070 ScienceLab MSDS]')
11:02:51 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'NFPA-H' ('' -> '2', SET '2')
11:02:51 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'NFPA-F' ('' -> '1', SET '1')
11:02:51 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'NFPA-R' ('' -> '0', SET '0')
11:02:51 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Section8' ('' -> '{{Chembox Related', SET '{{Chembox Related')
11:02:52 (2, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Watchedfields' ('changed' -> '', SET '')
11:02:52 (2, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: '<nowiki>ImageFile' ('Ammonium-acetate-2D.png' -> '', SET '')
11:02:52 (4, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Formula' ('' -> 'C2H3O2NH4', SET 'C2H3O2NH4')
11:02:52 (4, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'MolarMass' ('' -> '77.0825 g/mol', SET '77.0825 g/mol')
11:02:53 (4, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'Density' ('' -> '1.17 g/cm3<ref>Pradyot Patnaik. ''Handbook of Inorganic Chemicals''. McGraw-Hill, 2002, ISBN 0070494398</ref>', SET '1.17 g/cm3<ref>Pradyot Patnaik. ''Handbook of Inorganic Chemicals''. McGraw-Hill, 2002, ISBN 0070494398</ref>')
11:02:53 (4, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'MeltingPtC' ('' -> '114', SET '114')
11:02:53 (4, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Ammonium_acetate (diff, hist)
Changed: 'BoilingPt' ('' -> 'decomposes', SET 'decomposes')
11:09:49 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited CCPA_(biochemistry) (diff, hist)
Changed: 'InChIKey' ('' -> 'XSMYYYQVWPZWIZ-IDTAVKCVBF')
11:09:50 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited CCPA_(biochemistry) (diff, hist)
Changed: 'SMILES' ('C1CCC(C1)NC2=NC(=NC3=C2N=CN3[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O)Cl' -> 'Clc1nc(c2ncn(c2n1)[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)CO)NC4CCCC4')
11:09:50 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited CCPA_(biochemistry) (diff, hist)
Changed: 'InChI' ('' -> '1/C15H20ClN5O4/c16-15-19-12(18-7-3-1-2-4-7)9-13(20-15)21(6-17-9)14-11(24)10(23)8(5-22)25-14/h6-8,10-11,14,22-24H,1-5H2,(H,18,19,20)/t8-,10-,11-,14-/m1/s1')
11:09:50 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited CCPA_(biochemistry) (diff, hist)
Changed: 'ChemSpiderID' ('' -> '110356')
11:40:06 (3, 2, 4) (EDIT) User:Materialscientist (contribs, talk) edited Titanium_dioxide (diff, hist)
Added links: http://www.photonics.com/Content/ReadArticle.aspx?ArticleID=35722
12:04:16 (2, 4, 5) (EDIT) User:Wickey-nl (contribs, talk) edited Tungsten_hexacarbonyl (diff, hist)
Changed: 'OtherNames' ('Tungsten carbonyl' -> 'Tungsten carbonyl Hexacarbonylwolfram', SET 'Tungsten carbonyl')
12:14:36 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tungsten_hexacarbonyl (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
12:14:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tungsten_hexacarbonyl (diff, hist)
Added: 'verifiedrevid' ('' -> '268875567', SET '')
12:15:45 (3, 2, 4) (EDIT) User:A5y (contribs, talk) edited Sodium_bromate (diff, hist)
Added links: http://www.rte.ie/news/2010/0113/waterford.html
12:24:30 (3, 2, 4) (EDIT) User:Materialscientist (contribs, talk) edited Serotonin (diff, hist)
Added links: http://books.google.com/books?id=AW7M6jBixj4C&pg=PA626
13:12:38 (4, 4, 5) (EDIT) User:58.8.136.222 (contribs, talk) edited Manganese(II)_chloride (diff, hist)
Changed: 'BoilingPt' ('1225 Â°C' -> '1226 Â°C', SET '1225 Â°C')
13:25:48 (4, 2, 4) (EDIT) User:Vsmith (contribs, talk) edited Manganese(II)_chloride (diff, hist)
Changed: 'BoilingPt' ('1226 Â°C' -> '1225 Â°C', SET '1225 Â°C')
14:02:12 (3, 2, 4) (EDIT) User:Healthycare (contribs, talk) edited Calcium_citrate (diff, hist)
Added links: http://www.cancer.gov/drugdictionary/?CdrID=41817
16:03:21 (2, 4, 5) (EDIT) User:92.9.130.173 (contribs, talk) edited Polyvinyl_alcohol (diff, hist)
Changed: 'OtherNames' ('PVOH; Ethenol, homopolymer; PVA; Polyviol; Vinol; Alvyl; Alkotex; Covol; Gelvatol; Lemol; Mowiol' -> 'PVOH; Poly(Ethenol), Ethenol, homopolymer; PVA; Polyviol; Vinol; Alvyl; Alkotex; Covol; Gelvatol; Lemol; Mowiol', SET 'PVOH; Ethenol, homopolymer; PVA; Polyviol; Vinol; Alvyl; Alkotex; Covol; Gelvatol; Lemol; Mowiol')
16:16:58 (3, 2, 4) (EDIT) User:LilHelpa (contribs, talk) edited Magnesium_citrate (diff, hist)
Added links: http://www.medicinenet.com/magnesium_citrate-oral/article.htm
16:52:49 (4, 3, 5) (EDIT) User:131.180.35.239 (contribs, talk) edited Bis(trimethylsilyl)sulfide (diff, hist)
Changed: 'Formula' ('C6H18S2Si' -> 'C6H18Si2S')
18:33:55 (3, 2, 4) (EDIT) User:×××××¨ (contribs, talk) edited DEET (diff, hist)
Added links: http://www.biomedcentral.com/1741-7007/7/47
19:01:48 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited 1,4,2-Dithiazole (diff, hist)
Changed: 'ImageSize' ('' -> '100px')
19:01:48 (2, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited 1,4,2-Dithiazole (diff, hist)
Changed: 'S' ('' -> '2')
19:01:48 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited 1,4,2-Dithiazole (diff, hist)
Changed: 'C' ('' -> '2')
19:01:49 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited 1,4,2-Dithiazole (diff, hist)
Changed: 'H' ('' -> '3')
19:01:49 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited 1,4,2-Dithiazole (diff, hist)
Changed: 'N' ('' -> '1')
19:01:49 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited 1,4,2-Dithiazole (diff, hist)
Changed: 'IUPACName' ('' -> '1,4,2-Dithiazole')
19:01:49 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited 1,4,2-Dithiazole (diff, hist)
Changed: 'Formula' ('C2H3NS2' -> '')
19:01:50 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited 1,4,2-Dithiazole (diff, hist)
Changed: 'MolarMass' ('105.18192' -> '')
19:05:10 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Elenolic_acid (diff, hist)
Changed: 'C' ('' -> '11')
19:05:10 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Elenolic_acid (diff, hist)
Changed: 'H' ('' -> '14')
19:05:11 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Elenolic_acid (diff, hist)
Changed: 'O' ('' -> '6')
19:05:11 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Elenolic_acid (diff, hist)
Changed: 'IUPACName' ('2-[(2S,3S,4S)-3-formyl-5-methoxycarbonyl-2-methyl-3, 4-dihydro-2H-pyran-4-yl]acetic acid' -> '2-[(2''S'',3''S'',4''S'')-3-formyl-5-methoxycarbonyl-2-methyl-3, 4-dihydro-2H-pyran-4-yl]acetic acid')
19:05:11 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Elenolic_acid (diff, hist)
Changed: 'Formula' ('C11H14O6' -> '')
19:05:12 (4, 3, 4) (EDIT) User:ChemNerd (contribs, talk) edited Elenolic_acid (diff, hist)
Changed: 'MolarMass' ('242.22526 g/mol' -> '')
19:58:49 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'ImageFile' ('Desoxyfructo-serotonin.svg' -> 'Desoxyfructo-serotonin.png')
19:58:49 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'ImageSize' ('' -> '200px')
19:58:49 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'OtherNames' ('' -> 'Deoxyfructo-serotonin; Desoxyfructosylserotonin; 1-Desoxy-(5-hydroxytryptamino)-D-fructose')
19:58:50 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'Reference' ('<ref>[http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=125621 Desoxyfructo-serotonin - Compound Summary], [[PubChem]].</ref>' -> '')
19:58:50 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'C' ('' -> '16')
19:58:50 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'H' ('' -> '22')
19:58:51 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'N' ('' -> '2')
19:58:51 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'O' ('' -> '6')
19:58:51 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'IUPACName' ('(3S,4S,5S)-6-chloro-1,3,4,5-tetrahydroxyhexan-2-one' -> '(3''S'',4''R'',5''R'')-3,4,5,6-tetrahydroxy-1-[2-(5-hydroxy-1''H''-indol-3-yl)ethylamino]hexan-2-one')
19:58:51 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'SMILES' ('C(C(C(C(C(=O)CO)O)O)O)Cl' -> 'C1=CC2=C(C=C1O)C(=CN2)CCNCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O')
19:58:52 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'Formula' ('C6H11ClO5' -> '')
19:58:52 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'MolarMass' ('198.60154' -> '')
20:53:29 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Desoxyfructo-serotonin (diff, hist)
Changed: 'PubChem' ('125621' -> '21120559')
21:16:43 (4, 3, 4) (EDIT) User:Nono64 (contribs, talk) edited Carthamin (diff, hist)
Changed: 'MolarMass' ('910.78' -> '910.78 g/mol')
21:16:43 (4, 3, 4) (EDIT) User:Nono64 (contribs, talk) edited Carthamin (diff, hist)
Changed: 'ExactMass' ('' -> '910.216773')
21:26:16 (3, 2, 4) (EDIT) User:Nono64 (contribs, talk) edited Carthamin (diff, hist)
Added links: http://pubs.acs.org/doi/abs/10.1021/jf9911038
21:33:34 (3, 2, 4) (EDIT) User:BHealthy (contribs, talk) edited Resveratrol (diff, hist)
Added links: http://www.resoundinghealth.com/casebook/show/422, http://www.bangordailynews.com/detail/50622.html
21:59:04 (3, 2, 4) (EDIT) User:BHealthy (contribs, talk) edited Resveratrol (diff, hist)
Added links: http://www.functionalingredientsmag.com/article/Anti-ageing/full_body_anti_ageing.aspx
23:09:26 (2, 4, 5) (EDIT) User:Christian75 (contribs, talk) edited Sodium_nitrate (diff, hist)
Changed: 'OtherNames' ('[[Caliche (mineral)|Caliche]] Chile saltpeter Nitrate of soda [[Nitratine]] Peru saltpeter Soda niter' -> '[[Caliche (mineral)#Chilean Caliche|Caliche]] Chile saltpeter Nitrate of soda [[Nitratine]] Peru saltpeter Soda niter', SET '[[Caliche (mineral)|Caliche]] Chile saltpetre Nitrate of soda [[Nitratine]] Peru saltpeter Soda nitre')
23:15:21 (2, 3, 4) (EDIT) User:Ronhjones (contribs, talk) edited Decamethyldizincocene (diff, hist)
Changed: 'ImageFile' ('Decamethyldizincocene.JPG' -> 'Decamethyldizincocene.svg')